COMPOSITIONS WITH IMPROVED UREASE-INHIBITING EFFECT COMPRISING (THIO) PHOSPHORIC ACID TRIAMIDE AND FURTHER COMPOUNDS SUCH AS AMINES AND COLORANTS

Abstract

 A composition comprising:
(A) a mixture comprising at least one (thio)phosphoric acid triamide according to the general formula (I)

         R¹R²N-P(X)(NH₂)₂,

wherein
X
is oxygen or sulfur;
R¹
is a C, to C₂₀ alkyl, C₃ to C₂₀ cycloalkyl, C₆ to C₂₀ aryl, or dialkylaminocarbonyl group;
R²
is H, or
R¹ and R²
together with the nitrogen atom linking them define a 5- or 6-membered saturated or unsaturated heterocyclic radical, which optionally comprises 1 or 2 further heteroatoms selected from the group consisting of nitrogen, oxygen, and sulfur,
and
(L1) at least one amine selected from the group consisting of (L29).

Description

Field of the Invention

[0001] This invention essentially relates to compositions with improved urease-inhibiting effect comprising (thio)phosphoric acid triamide and further compounds and the use of such compositions as additive or coating material for nitrogen-containing fertilizers.

Description of the Prior Art

[0002] Worldwide, the predominant and further-increasing amount of the nitrogen used for fertilizing is employed in the form of urea or urea-containing fertilizers. Urea itself, however, is a form of nitrogen which is absorbed very little if at all, being hydrolyzed relatively rapidly by the enzyme urease, which is present ubiquitously in the soil, to form ammonia and carbon dioxide. In this process, in certain circumstances, gaseous ammonia is emitted to the atmosphere, and is then no longer available in the soil for the plants, thereby lowering the efficiency of fertilization.

[0003] It is known that the degree of utilization of the nitrogen when using urea-containing fertilizers can be improved by spreading urea-containing fertilizers together with substances which are able to inhibit or decrease the enzymatic cleavage of urea (for a general review, see Kiss, S. Simihäian, M. (2002) Improving Efficiency of Urea Fertilizers by Inhibition of Soil Urease Activity, ISBN 1-4020-0493-1, Kluwer Academic Publishers, Dordrecht, The Netherlands). Among the most potent known urease inhibitors are N-alkylthiophosphoric acid triamides and N-alkylphosphoric acid triamides, which are described in EP 0 119 487, for example.

[0004] Additionally, mixtures of N-alkylthiophosphoric acid triamides such as N-(n-butyl)thiophosphoric acid triamide (NBPT) and N-(n-propyl)thiophosphoric acid triamide (NPPT) can be used. The mixtures and their preparation are described in US 2010/218575 A1, for example.

[0005] These urease inhibitors are described in U.S. Pat. No. 4,530,714, for example. In order for this class of compound to be able to act as a urease inhibitor, there must first be a conversion to the corresponding oxo form. That form reacts subsequently with the urease, causing its inhibition.

[0006] It is advisable to apply the urease inhibitors together with the urea onto or into the soil, since this ensures that the inhibitor comes into contact, together with the fertilizer, with the soil. The urease inhibitor may be incorporated in the urea by, for example, dissolving it into the melt prior to urea granulation or prilling. A process of this kind is described in U.S. Pat. No. 5,352,265, for example. A further option is to apply the urease inhibitor to the urea granules or prills, in the form of a solution, for example.

[0007] Corresponding processes for application, and suitable solvents, are described in US 2010/218575 A1, for example. Other suitable additives, for example amines selected from methyldiethanolamine, tetrahydroxypropylethylenediamine, trimethylaminoethylethanolamine, N,N,N',N'-tetramethyl-1 ,6-hexanediamine, N,N',N"-tris(dimethylaminopropyl)hexahydrotriazine, and 2,2'-dimorpholinyldiethyl ether, are described in US 2011/0154874 A1.

[0008] The storage life of the urease inhibitor is limited. The higher the temperature, the shorter the storage life. If, for example, urea is stored under tropical conditions, a major part of the urease inhibitor has undergone decomposition, generally, after about four weeks of storage. If the urease inhibitor is introduced into the urea melt, the decomposition is less. For the commercialization of the urea stabilized with the urease inhibitor, however, it is often vital to apply the urease inhibitor to urea and to store the treated fertilizer until the time of its spreading to the soil.

Objects of the invention

[0009] One of the objects of the present invention was to provide a composition containing (thio)phosphoric acid triamide which

(i) enhances the stability of the (thio)phosphoric acid triamide(s), and/or

(ii) enhances the urease inhibiting effect of the (thio)phosphoric acid triamide(s), and/or

(iii) enhances the yield increase effect of the (thio)phosphoric acid triamide(s), and/or

(iv) has a relatively long storage life, particularly before being applied to or coated on nitrogen-containing fertilizers, and/or

(v) enhances the stability of the (thio)phosphoric acid triamide particularly when applied to or coated on nitrogen-containing fertilizers such as urea, and/or

(vi) protects the (thio)phosphoric acid triamide applied to or coated on nitrogen-containing fertilizers such as urea from decomposition or loss, and/or

(vii)is toxicologically unobjectionable, and/or

(viii) does not adversely affect the urease-inhibiting effect and/or activity of the (thio)phosphoric acid triamide, and/or

(ix) can be easily and safely packaged, transported and shipped, even in large quantities, and/or

(x) can be easily and safely handled and applied for soil treatment, even in large quantities, and/or

(xi) can be easily recognized and distinguished in case several different compositions are used for different purposes.

Summary of the invention

[0010] Accordingly, a composition (Q4) was found which comprises:

(A) a mixture comprising at least one (thio)phosphoric acid triamide according to the general formula (I)

         R¹R²N-P(X)(NH₂)₂,

wherein

X

is oxygen or sulfur;

R¹

is a C₁ to C₂₀ alkyl, C₃ to C₂₀ cycloalkyl, C₆ to C₂₀ aryl, or dialkylaminocarbonyl group;

R²

is H, or

R¹ and R²

together with the nitrogen atom linking them define a 5- or 6-membered saturated or unsaturated heterocyclic radical, which optionally comprises 1 or 2 further heteroatoms selected from the group consisting of nitrogen, oxygen, and sulfur,

and

(L1) at least one amine selected from the group consisting of (L10), (L11), (L12), (L13), (L14), (L15), (L16), (L17), (L18), (L19), (L20), (L21), (L22), (L23), (L24) and (L29) as described further below.

[0011] Accordingly, a composition (Q5) was found which comprises:

(A) a mixture comprising at least one (thio)phosphoric acid triamide according to the general formula (I)

         R¹R²N-P(X)(NH₂)₂,

wherein

X

is oxygen or sulfur;

R¹

is a C₁ to C₂₀ alkyl, C₃ to C₂₀ cycloalkyl, C₆ to C₂₀ aryl, or dialkylaminocarbonyl group;

R²

is H, or

R¹ and R²

together with the nitrogen atom linking them define a 5- or 6-membered saturated or unsaturated heterocyclic radical, which optionally comprises 1 or 2 further heteroatoms selected from the group consisting of nitrogen, oxygen, and sulfur,

and

(L2) at least one colorant selected from the group consisting of (L700) to (L848) as described further below.

[0012] Accordingly, a further composition (Q2) was found which comprises:

(A) a mixture comprising at least one (thio)phosphoric acid triamide according to the general formula (I)

         R¹R²N-P(X)(NH₂)₂,

wherein

X

is oxygen or sulfur;

R¹

is a C₁ to C₂₀ alkyl, C₃ to C₂₀ cycloalkyl, C₆ to C₂₀ aryl, or dialkylaminocarbonyl group;

R²

is H, or

R¹ and R²

together with the nitrogen atom linking them define a 5- or 6-membered saturated or unsaturated heterocyclic radical, which optionally comprises 1 or 2 further heteroatoms selected from the group consisting of nitrogen, oxygen, and sulfur,

and

(C) at least one amine selected from the group consisting of

(C1) a polymeric polyamine, and

(C2) an amine containing not more than one amino group and at least three alkoxy- or hydroxy-substituted C₂ to C₁₂ alkyl groups R²¹, wherein at least one of the groups R²¹ is different to the other groups R²¹, and

(C3) an amine containing not more than one amino group and at least two alkoxy- or hydroxy-substituted C₂ to C₁₂ alkyl groups R²², wherein at least one of the groups R²² bears the alkoxy or hydroxy substituent at a secondary or tertiary carbon atom and wherein at least one of the groups R²² is different to the other group(s) R²², and

(C4) an amine containing at least one saturated or unsaturated C₈ to C₄₀ alkyl group R²³, and

(C5) a saturated or unsaturated heterocyclic amine which contains at least one oxygen atom as ring atom and which does not contain a further alkoxy group.

[0013] Accordingly, yet a further composition (Q3) was found which comprises:

(A) a mixture comprising at least one (thio)phosphoric acid triamide according to the general formula (I)

         R¹R²N-P(X)(NH₂)₂,

wherein

X

is oxygen or sulfur;

R¹

is a C₁ to C₂₀ alkyl, C₃ to C₂₀ cycloalkyl, C₆ to C₂₀ aryl, or dialkylaminocarbonyl group;

R²

is H, or

R¹ and R²

together with the nitrogen atom linking them define a 5- or 6-membered saturated or unsaturated heterocyclic radical, which optionally comprises 1 or 2 further heteroatoms selected from the group consisting of nitrogen, oxygen, and sulfur,

and

(D) at least one amide according to the general formula (VI)

         R³¹CO-NR³²R³³

wherein

R³¹CO

is an acyl radical having 1 to 22 carbon atoms,

R³² is

hydrogen or alkyl, and

R³³ is

hydrogen or alkyl, or

R³² and R³³

together with the nitrogen atom linking them define a 5- or 6-membered saturated or unsaturated heterocyclic radical, which optionally comprises 1 or 2 further heteroatoms selected from the group consisting of nitrogen, oxygen, and sulfur.

[0014] In addition, a process for treating the soil comprising applying the compositions of the invention into the soil in-furrow and/or as side dress and/or as broadcast was found.

[0015] Moreover, the use of the compositions of the invention as additive or coating material for nitrogen-containing fertilizers has been found.

[0016] Preferred embodiments are explained in the claims and the specification. It is understood that combinations of preferred embodiments are within the scope of the present invention.

[0017] The term "at least one" is to be understood as 1, 2, 3 or more. A mixture comprising at least one amine refers for example to a mixture comprising 1, 2, 3 or more amines.

[0018] The term "soil" is to be understood as a natural body comprised of living (e.g. microorganisms (such as bacteria and fungi), animals and plants) and non-living matter (e.g. minerals and organic matter (e.g. organic compounds in varying degrees of decomposition), liquid, and gases) that occurs on the land surface, and is characterized by soil horizons that are distinguishable from the initial material as a result of various physical, chemical, biological, and anthropogenic processes. From an agricultural point of view, soils are predominantly regarded as the anchor and primary nutrient base for plants (plant habitat).

[0019] The term "fertilizer" is to be understood as chemical compounds applied to promote plant and fruit growth. Fertilizers are typically applied either through the soil (for uptake by plant roots) or by foliar feeding (for uptake through leaves). The term "fertilizer" can be subdivided into two major categories: a) organic fertilizers (composed of decayed plant/animal matter) and b) inorganic fertilizers (composed of chemicals and minerals). Organic fertilizers include manure, slurry, worm castings, peat, seaweed, sewage, and guano. Green manure crops are also regularly grown to add nutrients (especially nitrogen) to the soil. Manufactured organic fertilizers include compost, blood meal, bone meal and seaweed extracts. Further examples are enzymatically digested proteins, fish meal, and feather meal. The decomposing crop residue from prior years is another source of fertility. In addition, naturally occurring minerals such as mine rock phosphate, sulfate of potash and limestone are also considered inorganic fertilizers. Inorganic fertilizers are usually manufactured through chemical processes (such as the Haber-Bosch process), also using naturally occurring deposits, while chemically altering them (e.g. concentrated triple superphosphate). Naturally occurring inorganic fertilizers include Chilean sodium nitrate, mine rock phosphate, and limestone.

[0020] "Manure" is organic matter used as organic fertilizer in agriculture. Depending on its structure, manure can be divided into liquid manure, semi-liquid manure, stable or solid manure and straw manure. Depending on its origin, manure can be divided into manure derived from animals or plants. Common forms of animal manure include feces, urine, farm slurry (liquid manure) or farmyard manure (FYM) whereas FYM also contains a certain amount of plant material (typically straw), which may have been used as bedding for animals. Animals from which manure can be used comprise horses, cattle, pigs, sheep, chickens, turkeys, rabbits, and guano from seabirds and bats. The application rates of animal manure when used as fertilizer highly depends on the origin (type of animals). Plant manures may derive from any kind of plant whereas the plant may also be grown explicitly for the purpose of plowing them in (e.g. leguminous plants), thus improving the structure and fertility of the soil. Furthermore, plant matter used as manure may include the contents of the rumens of slaughtered ruminants, spent hops (left over from brewing beer) or seaweed.

[0021] The compositions of the invention are referred to as the compositions (Q2), (Q3), (Q4) and (Q5) in the following. The composition (Q2) comprises (A) and (C) and optionally further components as described below. The composition (Q3) comprises (A) and (D) and optionally further components as described below. The composition (Q4) comprises (A) and (L1) and optionally further components as described below. The composition (Q5) comprises (A) and (L2) and optionally further components as described below.

[0022] According to the invention, the compositions (Q2), (Q3), (Q4) and (Q5) comprises - as one of their essential components -

(A) a mixture comprising at least one (thio)phosphoric acid triamide according to the general formula (I)

         R¹R²N-P(X)(NH₂)₂,

wherein

X

is oxygen or sulfur;

R¹

is a C₁ to C₂₀ alkyl, C₃ to C₂₀ cycloalkyl, C₆ to C₂₀ aryl, or dialkylaminocarbonyl group;

R²

is H, or

R¹ and R²

together with the nitrogen atom linking them define a 5- or 6-membered saturated or unsaturated heterocyclic radical, which optionally comprises 1 or 2 further heteroatoms selected from the group consisting of nitrogen, oxygen, and sulfur.

X in the general formula (I) of (A) is preferably sulfur.

[0023] R¹ in the general formula (I) of (A) is preferably C₁-C₂₀-alkyl, more preferably C₁-C₁₀-alkyl, most preferably C₂-C₇ alkyl, for example C₃-C₄ alkyl.

[0024] Examples of alkyl groups are methyl, ethyl, propyl, isopropyl, butyl, isobutyl, sec-butyl, tert-butyl, pentyl, isopentyl, neopentyl, tert-pentyl, hexyl, 2-methylpentyl, heptyl, octyl, 2-ethylhexyl, isooctyl, nonyl, isononyl, decyl and isodecyl. Examples of cycloalkyl groups are cyclopropyl, cyclobutyl, cyclopentyl, cyclohexyl and cyclooctyl, examples of aryl groups are phenyl or naphthyl. Examples of heterocyclic radicals R₁R₂N- are piperazinyl, morpholinyl, pyrrolyl, pyrazolyl, triazolyl, oxazolyl, thiazolyl or imidazolyl groups.

[0025] According to one embodiment, (A) is N-n-butylthiophosphoric acid triamide (NBPT).

[0026] According to another embodiment, (A) is N-n-propylthiophosphoric acid triamide (NPPT).

[0027] According to another embodiment, (A) is a mixture of NBPT and NPPT.

[0028] According to another embodiment, (A) comprises at least two different (thio)phosphoric acid triamides having structures of the general formula (I) and wherein said at least two different (thio)phosphoric acid triamides differ in at least one of radicals R¹ or R², and preferably, one of said at least two different (thio)phosphoric acid triamides is N-n-butylthiophosphoric acid triamide (NBPT), and more preferably, the other of said at least two different (thio)phosphoric acid triamides is selected from the group consisting of N-cyclohexyl-, N-pentyl-, N-isobutyl- and N-n-propylphosphoric acid triamide and -thiophosphoric acid triamide. Especially preferred are mixtures (A) which comprise NBPT in amounts of from 40 to 95 wt.%, most preferably from 60 to 85% wt.%, particularly preferably from 72 to 80 wt.%, in each case based on the total weight of (A).

[0029] Generally, the mixture (A) can be contained in varying amounts in the composition (Q2), (Q3), (Q4), or (Q5). Preferably, the amount of (A) is not more than 85 wt.% (wt.% stands for "percent by weight"), more preferably not more than 60 wt.%, most preferably not more than 45 wt.%, most particularly preferably not more than 35 wt.%, particularly not more than 30 wt.%, for example not more than 27 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5). Preferably, the amount of (A) is at least 1 wt.%, more preferably at least 4 wt.%, most preferably at least 10 wt.%, most particularly preferably at least 15 wt.%, particularly at least 20 wt.%, for example at least 23 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5).

[0030] According to the invention, a composition (Q4) was found which comprises:

(A) a mixture comprising at least one (thio)phosphoric acid triamide according to the general formula (I)

         R¹R²N-P(X)(NH₂)₂,

wherein

X

is oxygen or sulfur;

R¹

is a C₁ to C₂₀ alkyl, C₃ to C₂₀ cycloalkyl, C₆ to C₂₀ aryl, or dialkylaminocarbonyl group;

R²

is H, or

R¹ and R²

together with the nitrogen atom linking them define a 5- or 6-membered saturated or unsaturated heterocyclic radical, which optionally comprises 1 or 2 further heteroatoms selected from the group consisting of nitrogen, oxygen, and sulfur,

and

(L1) at least one amine selected from the group consisting of (L10), (L11), (L12), (L13), (L14), (L15), (L16), (L17), (L18), (L19), (L20), (L21), (L22), (L23), (L24) and (L29):

(L10) an aliphatic alkylenediamine according to the general formula (IA)



wherein the radicals are defined as follows:

R¹ and R² are simultaneously or each independently hydrogen, linear or branched C₁- to C₁₂-alkyl, C₇- to C₁₂-aralkyl, C₆- to C₁₀-aryl, C₃- to C₈-cycloalkyl or C₃- to C₈-cycloalkyl in which optionally - preferably mandatorily - one or more CH₂ groups have been replaced by O, NH or NR¹⁰; or

alternatively R¹ and R² jointly represents a linear or branched C₁- to C₁₂-alkyl, C₇- to C₁₂-aralkyl, C₆- to C₁₀-aryl, C₃- to C₈-cycloalkyl or C₃- to C₈-cycloalkyl in which optionally - preferably mandatorily - one or more CH₂ groups have been replaced by O, NH or NR¹⁰; and

R³x and R⁴x are simultaneously or each independently hydrogen, linear or branched C₁- to C₁₂-alkyl, C₇- to C₁₂-aralkyl, C₆- to C₁₀-aryl, C₃- to C₈-cycloalkyl or C₃- to C₈-cycloalkyl in which optionally - preferably mandatorily - one or more CH₂ groups have been replaced by O, NH or NR¹⁰; and

R¹⁰ is linear or branched C₁- to C₁₂-alkyl, C₇- to C₁₂-aralkyl, C₆- to C₁₀-aryl or C₃- to C₈-cycloalkyl; and

z is a value from 2 to 20, preferably from 2 to 12; and

x is an index which can assume all values from 1 to z;

(L11) oligomeric polyalkyleneamines according to the general formula (II)

wherein the radicals are each defined as follows:

R1, R2 and R5 are simultaneously or each independently hydrogen, linear or branched C₁- to C₁₂-alkyl, C₇- to C₁₂-aralkyl, C₆- to C₁₀-aryl, C₃- to C₈-cycloalkyl or C₃- to C₈-cycloalkyl in which optionally - preferably mandatorily - one or more CH₂ groups have been replaced by O, NH or NR10; or

two of the three radicals R1, R2 and R5 are covalently bonded to each other to form a linear or branched C₁- to C₁₂-alkyl, C₇- to C₁₂-aralkyl, C₆- to C₁₀-aryl, C₃- to C₈-cycloalkyl or C₃- to C₈-cycloalkyl in which optionally - preferably mandatorily - one or more CH₂ groups have been replaced by O, NH or NR¹⁰, and the remaining one of the three radicals R1, R2 and R5 is hydrogen, linear or branched C₁- to C₁₂-alkyl, C₇- to C₁₂-aralkyl, C₆- to C₁₀-aryl, C₃- to C₈-cycloalkyl or C₃- to C₈-cycloalkyl in which optionally - preferably mandatorily - one or more CH₂ groups have been replaced by O, NH or NR¹⁰; and

R3_y and R4_y are simultaneously or each independently hydrogen, linear or branched C₁- to C₁₂-alkyl, C₇- to C₁₂-aralkyl, C₆- to C₁₀-aryl, C₃- to C₈-cycloalkyl or C₃- to C₈-cycloalkyl in which optionally - preferably mandatorily - one or more CH₂ groups have been replaced by O, NH or NR¹⁰;

R¹⁰ is linear or branched C₁- to C₁₂-alkyl, C₇- to C₁₂-aralkyl, C₆- to C₁₀-aryl or C₃- to C₈-cycloalkyl;

a is a value of 2 to 5;
b is a value of 2 to 12;
and y is an index which can assume all values between 1 and b;

(L12) polyetheramines according to general formula (III):

wherein the radicals are each defined as follows:

R1 and R2 are simultaneously or each independently hydrogen, linear or branched C₁- to C₁₂-alkyl, C₇- to C₁₂-aralkyl, C₆- to C₁₀-aryl, C₃- to C₈-cycloalkyl or C₃- to C₈-cycloalkyl in which optionally - preferably mandatorily - one or more CH₂ groups have been replaced by O, NH or NR¹⁰;
alternatively R1 and R2 jointly represents a linear or branched C₁- to C₁₂-alkyl, C₇- to C₁₂-aralkyl, C₆- to C₁₀-aryl, C₃- to C₈-cycloalkyl or C₃- to C₈-cycloalkyl in which optionally - preferably mandatorily - one or more CH₂ groups have been replaced by O, NH or NR¹⁰; and

R3, R4 and R5 are simultaneously or each independently hydrogen, linear or branched C₁- to C₁₂-alkyl, C₇- to C₁₂-aralkyl, C₆- to C₁₀-aryl, C₃- to C₈-cycloalkyl or C₃- to C₈-cycloalkyl in which optionally - preferably mandatorily - one or more CH₂ groups have been replaced by O, NH or NR¹⁰;

R¹⁰ is linear or branched C₁- to C₁₂-alkyl, C₇- to C₁₂-aralkyl, C₆- to C₁₀-aryl or C₃- to C₈-cycloalkyl;

x, y and z are each independently a value from 0 to 100 and the sum of x, y and z are at least 2;

(L13) polyvinylamine-related polymers selected from the group consisting of

(L501) polyvinylamine,

(L502) a polyvinylamine according to the general formula (IV)

which has an average molar mass (Mw) of from 200 to 2,000,000 g/mol and wherein R⁷ to R¹¹ are independently from each other

hydrogen, linear or branched C₁- to C₂₀-alkyl, -alkoxy, -polyoxyethylene, -hydroxyalkyl, -(alkyl)carboxy, -phosphonoalkyl, -alkylamino radicals, formamidyl, pyrrolidonyl-, imidazolyl radicats, C₂- to C₂₀-alkenyl radicals or C₆- to C₂₀-aryl, -aryloxy, o-Hydroxybenzoyl, Phthalimidoyl, o-Carboxamidobenzoyl, o-(C₁- to C₈-Alkoxycarbonyl)benzoyl, o-Aminobenzoyl, o-(Mono-C₁- to C₈-alkylamino)benzoyl, o-(Di-C₁ to C₈-alkylamino)benzoyl, 2-Cyano-3,3-diphenylacryloyl, or m-Benzimidazolyl-p-hydroxybenzoyl radicals which may be optionally further substituted, wherein s is an integer, t is 0 or an integer, wherein the sum of s and t must be chosen in such a way that the average molar mass is within the specified range,

(L503) polyallylamine,

(L504) poly(diallyldimethylammonium chloride),

(L505) cationic polyvinylformamide,

(L506) cationic polyvinylpyrrolidone,

(L507) cationic polyvinylacetamide,

(L508) cationic polyvinylmethylformamide,

(L509) cationic polyvinylmethylacetamide,

(L510) poly(dimethylaminopropylmethacrylamide),

(L511) poly(dimethylaminoethyl acrylate),

(L512) poly(diethylaminoethyl acrylate),

(L513) poly(acryloylethyltrimethylammonium chloride),

(L514) poly(acrylamido propyltrimethylammonium chloride),

(L515) poly(methacrylamidotripropyltrimethyla- mmonium chloride),

(L516) cationic polyacrylamide,

(L517) poly(vinylpyridine),

(L518) hexadimethrine bromide,

(L519) poly(dimethylamine-co-epichlorohydrin),

(L520) poly(dimethylamine-co-epichlorohydrin-co-ethylenediamine),

(L521) poly(amidoamine-epichlorohydrin),

(L522) linear, branched or hyperbranched polyamidoamines, or

(L523) polyamidoamines having an average molar mass (MW) of from 1,000 to 200,000 g/mol,

(L524) cationic starch, or copolymers which contain N-vinylformamide, allylamine, diallyldimethylammonium chloride, N-vinylacetamide, N-vinylpyrrolidone, N-methyl-N-vinylformamide, N-methyl-N-vinylacetamide, dimethylaminopropylmethacrylamide, dimethylaminoethyl acrylate, diethylaminoethyl acrylate, acryloylethyltrimethylammonium chloride or methacrylamidopropyltrimethylammonium chloride in the form of polymerized units and, if desired, in cleaved form, and the salts thereof when the polymers are basic polymers;

(L14) polyethyleneimine according to the general formula (V)

which has an average molar mass (MW) of from 200 to 1,000,000 g/mol and in which R¹ to R⁶ are - independently from each other - hydrogen, linear or branched C₁- to C₂₀-alkyl, - alkoxy, -polyoxyalkylene, -polyoxyethylene, -hydroxyalkyl, -(alkyl)carboxy, -phosphonoalkyl, - alkylamino radicals, C₂- to C₂₀-alkenyl radicals or C₆- to C₂₀-aryl, -aryloxy, -hydroxyaryl, -arylcar-boxy or -arylamino radicals which are optionally further substituted, and

R², R³ and R⁵ may - independently from each other - optionally be each additionally further polyethyleneimine polymer chains, and

R¹ may optionally be an NR³R⁴ or an NH₂ radical, and

x, y and z are - independently from each other - 0 or an integer, wherein the sum of x, y and z must be chosen in such a way that the average molar mass is within the specified range;

(L15) polyethyleneimine according to the general formula (V) wherein at least one of the radicals R² to R⁶ is a polyoxyalkylene radical;

(L16) a polymer obtainable by the process (L16P) comprising the step L16a)

L16a) condensation of at least one compound selected from N-(hydroxyalkyl)amines of formulae (I.a) and/or (I.b),

wherein

A are independently selected from C₁-C₆-alkylene;

R¹, R^1*, R², R^2*, R3, R^3*, R⁴, R^4*, R⁵ and R^5* are independently of one another selected from hydrogen, alkyl, cycloalkyl or aryl, wherein the last three mentioned radicals may be optionally substituted; and

R⁶ is selected from hydrogen, alkyl, cycloalkyl or aryl, which may be optionally substituted;

(L17) a polymer obtainable by the process (L17P) comprising the two steps L17a) and L17b)

L17a) condensation of at least one compound selected from N-(hydroxyalkyl)amines of formulae (I.a) and/or (I.b),

wherein

A are independently selected from C₁-C₆-alkylene;

R¹, R^1*, R², R^2*, R³, R^3*, R⁴, R^4*, R⁵ and R^5* are independently of one another selected from hydrogen, alkyl, cycloalkyl or aryl, wherein the last three mentioned radicals may be optionally substituted; and

R⁶ is selected from hydrogen, alkyl, cycloalkyl or aryl, which may be optionally substituted; and

L17b) reacting at least a part of the remaining hydroxy groups and/or, if present, at least a part of the secondary amino groups of the polyether provided in step L17a) with at least one alkylene oxide;

(L18) a derivative obtainable by quaternization, protonation, sulphation and/or phosphation of the polymer (L16) or (L17);

(L19) dendritic polyamines or their precursors selected from

(L554) N ,N ,N' ,N'-tetraaminopropylalkylenediamine,

(L555) dendritic amines obtainable from N,N,N',N'-tetraaminopropylalkylenediamine by amino-n-propylation (for example known as N14-, N30-, N62- and N128-amine according to the number of their nitrogen atoms),

(L556) N,N,N',N'-tetraaminopropylethylenediamine,

(L557) dendritic amines obtainable from N,N,N',N'-tetraaminopropylethylenediamine by amino-n-propylation (for example known as N14-, N30-, N62- and N128-amine according to the number of their nitrogen atoms),

(L558) N,N,N',N'-tetraaminopropylpropylenediamine,

(L559) dendritic amines obtainable from N,N,N',N'-tetraaminopropylpropylenediamine by amino-n-propylation (for example known as N14-, N30-, N62- and N128-amine according to the number of their nitrogen atoms),

(L560) N,N,N',N'-tetraaminopropylbutylenediamine,

(L561) dendritic amines obtainable from N,N,N',N'-tetraaminopropylbutylenediamine by amino-n-propylation (for example known as N14-, N30-, N62- and N128-amine according to the number of their nitrogen atoms);

(L20) a bicyclic, tricyclic or higher polycyclic polyamine;

(L21) an amine containing not more than one amino group and two alkoxy- or hydroxy-substituted C₂ to C₁₂ alkyl groups R^21a and one C₁ to C₁₀ alkyl group R^21b, wherein the R^21a group bears the alkoxy or hydroxy substituent at a secondary or tertiary carbon atom and wherein the two groups R^21a are identical;

(L22) an amine containing not more than one amino group and one alkoxy- or hydroxy-substituted C₂ to C₁₂ alkyl group R^22a and two C₁ to C₁₀ alkyl groups R^22b, wherein the two groups R^22b are identical;

(L23) imidazolidinones N-substituted on one or two of its nitrogen atoms with alkyl groups R²³ wherein R²³ may optionally be substituted with OH groups;

(L24) morpholines N-substituted with alkyl groups R²⁴ wherein R²⁴ may optionally be substituted with OH groups;

(L29) homo- or copolymers of amino acids.

[0031] Generally, the amine(s) (L1) can be contained in varying amounts in the composition (Q4). Preferably, the amount of (L1) is not more than 90 wt.% (wt.% stands for "percent by weight"), more preferably not more than 65 wt.%, most preferably not more than 45 wt.%, most particularly preferably not more than 30 wt.%, particularly not more than 22 wt.%, for example not more than 16 wt.%, based on the total weight of the composition (Q4). Preferably, the amount of (L1) is at least 1 wt.%, more preferably at least 3 wt.%, most preferably at least 6 wt.%, most particularly preferably at least 9 wt.%, particularly at least 12 wt.%, for example at least 15 wt.%, based on the total weight of the composition (Q4).

[0032] If present, the amine(s) (L1) can generally be contained in varying amounts in the composition (Q2), (Q3), or (Q5). If present, the amount of (L1) is preferably not more than 90 wt.% (wt.% stands for "percent by weight"), more preferably not more than 65 wt.%, most preferably not more than 45 wt.%, most particularly preferably not more than 30 wt.%, particularly not more than 22 wt.%, for example not more than 16 wt.%, based on the total weight of the composition (Q2), (Q3), or (Q5). If present, the amount of (L1) is preferably at least 1 wt.%, more preferably at least 3 wt.%, most preferably at least 6 wt.%, most particularly preferably at least 9 wt.%, particularly at least 12 wt.%, for example at least 15 wt.%, based on the total weight of the composition (Q2), (Q3), or (Q5).

[0033] Preferably, the composition (Q2) or (Q4) comprises the mixture (A) and

a) at least one low molecular weight or non-polymeric amine selected from the group consisting of (L101) to (L222) and

b) at least one polymeric amine selected from the group consisting of (L501) to (L571).

[0034] The compositions (Q2), (Q3) or (Q5) can optionally further comprise
(L1) at least one amine selected from the group consisting of (L10), (L11), (L12), (L13), (L14), (L15), (L16), (L17), (L18), (L19), (L20), (L21), (L22), (L23), (L24) and (L29) as described above.

[0035] Particularly preferred aliphatic alkylenediamines (L10) are those alkylenediamines selected from the list consisting of:

(L101) ethylenediamine,

(L102) 1,3-propylenediamine,

(L103) 1,2-propylenediamine,

(L104) 1,4-butylenediamine (alternative names: 1,4-diaminobutane, or putrescine),

(L105) 1,2-butylenediamine,

(L106) 1,5-diaminopentane,

(L107) 1,2-diaminopentane,

(L108) 1,5-diamino-2-methylpentane,

(L109) 1,6-diaminohexane,

(L110) 1,2-diaminohexane,

(L111) 1,7-diaminoheptane,

(L112) 1,2-diaminoheptane,

(L113) 1,8-diaminooctane,

(L114) 1,2-diaminooctane,

(L115) 1,9-nonamethylenediamine,

(L116) 1,10-decamethylenediamine,

(L117) 1,2-diaminodecane,

(L118) 1,11 -undecamethylenediamine,

(L119) 1,2-diaminoundecane,

(L120) 1,12-dodecamethylenediamine,

(L121) 1,2-diaminododecane,

(L122) 2,2-dimethylpropane-1,3-diamine,

(L123) 4,7,10-trioxatridecane-1,13-diamine,

(L124) 4,9-dioxadodecane-1,12-diamine,

(L125) d3-(methylamino)propylamine,

(L126) 3,3'-dimethyl-4,4'-diaminodicyclohexylmethane,

(L127) 4,4'-diaminodicyclohexylmethane,

(L128) isophoronediamine,

(L129) [bis(4-aminocyclohexyl)methane],

(L130) [bis(4-amino-3,5-dimethylcyclohexyl)methane],

(L131) [bis(4-amino-3-methylcyclohexyl)methane],

(L132) 3-(cyclohexylamino)propylamine,

(L133) bis(aminoethyl)piperazine,

(L134) bis(aminomethyl)piperazine,

(L135) piperazine,

(L136) isomeric bis(aminomethyl)benzenes,

(L137) meta-xylenediamine (MXDA),

(L138) isomeric bis(aminomethyl)benzenes,

(L139) isomers of aminobenzylamine (2-aminobenzylamine, 4-aminobenzylamine),

(L140) 4-(2-aminoethyl)aniline,

(L141) m-xylylenediamine,

(L142) o-xylylenediamine,

(L143) 2,2'-biphenyldiamines,

(L144) oxydianilines,

(L145) 4,4'-oxydianiline,

(L146) isomers of diaminofluorene,

(L147) isomers of diaminophenanthrene

(L148) 4,4'-ethylenedianiline,

or mixtures thereof.

[0036] Further preferred aliphatic alkylenediamines (L10) are
(L149) alkylenediamines according to general formula (IA) wherein R1, R2, R3_x and R4_x in formula (IA) are each hydrogen and z in formula (IA) is a value from 2 to 8.

[0037] Further preferred aliphatic alkylenediamines (L10) are

(L150) alkylenediamines according to general formula (IA) which are at least partially N-ethoxylated,

(L151) alkylenediamines according to general formula (IA) which are at least partially N-propoxylated,

(L152) alkylenediamines according to general formula (IA) which are at least partially N-butoxylated, or

(L153) alkylenediamines according to general formula (IA) which are at least partially N-alkoxylated.

[0038] Further preferred diamines (L10) are cyclic diamines in which the amino groups are joined either directly or indirectly to one or more mutually connected unsubstituted or substituted cycloaliphatic or heteroaliphatic, aromatic or heteroaromatic rings. Particularly preferred cyclic diamines are alicyclic diamines, particularly 3,3'-dimethyl-4,4'-diaminodicyclohexylmethane, 4,4'-diaminodicyclohexylmethane, isophoronediamine, [bis(4-aminocyclohexyl)methane], [bis(4-amino-3,5-dimethylcyclohexyl)methane] or [bis(4-amino-3-methylcyclohexyl)methane], 3-(cyclohexylamino)propylamine, bis(aminoethyl)piperazine, bis(aminomethyl)piperazine, or piperazine. Particularly preferred aromatic cyclic diamines are aromatic diamines in which the amino group is not substituted directly on the aromatic ring. Preferred aromatic diamines are the isomeric bis(aminomethyl)benzenes, especially meta-xylenediamine (MXDA), or the isomeric bis(aminomethyl)benzenes, isomers of aminobenzylamine (2-aminobenzylamine, 4-aminobenzylamine), 4-(2-aminoethyl)aniline, m-xylylenediamine, o-xylylenediamine, or 2,2'-biphenyldiamines, or oxydianilines, for example 4,4'-oxydianiline, isomers of diaminofluorene, isomers of diaminophenanthrene and 4,4'-ethylenedianiline.
Particularly preferred oligomeric polyalkyeneamines (L11) are

(L154) N,N-bis(3-aminopropyl)methylamine,

(L155) diethylenetriamine (DETA),

(L156) triethylenetetramine (TETA),

(L157) tetraethylenepentamine (TEPA),

(L158) di-1,3-propylenetriamine,

(L159) tri-1,3-propylenetetramine,

(L160) tetra-1,3-propylenepentamine,

(L161) di-1,2-propylenetriamine,

(L162) tri-1,2-propylenetetramine,

(L163) tetra-1,2-propylenepentamine,

(L164) dihexamethylenetriamine,

(L165) trihexamethylenetetramine,

(L166) tetrahexamethylenepentamine,

(L167) spermidine (CAS no. 124-20-9), or

(L168) spermine (CAS no. 71-44-3)

[0039] Further preferred oligomeric polyalkyeneamines (L11) are

(L169) polyalkyeneamines according to general formula (II) which are at least partially N-ethoxylated,

(L170) polyalkyeneamines according to general formula (II) which are at least partially N-propoxylated,

(L171) polyalkyeneamines according to general formula (II) which are at least partially N-alkoxylated.

[0040] Preferred polyetheramines (L12) are
(L562) polyetheramines according to the general formula (III) in which in formula (III) x and z each assume a value of 0 and y assumes a value > 0, and the substituents R1 to R⁵ in formula (III) are preferably hydrogen (polyetheramines based on ethylene glycol).

[0041] Further preferred polyetheramines (L12) are
(L563) polyetheramines according to the general formula (III) in which in formula (III) y assumes a value of 0 and (x+z) a value of > 0, and the substituents R1 and R2 are preferably hydrogen and the substituents R3 to R5 are preferably methyl (polyetheramines based on propylene glycol).

[0042] Further preferred polyetheramines (L12) are
(L564) polyetheramines according to the general formula (III) in which in formula (III) y assumes a value of > 0 and (x+z) a value of > 0, and the substituents R1 to R2 are preferably hydrogen and the substituents R3 to R5 are preferably methyl (block polyetheramines having a central block based on polyethylene glycol and outer blocks based on propylene glycol).

[0043] Very particularly preferred polyetheramines (L12) are

(L565) 4,7,10-trioxatridecane-1,13-diamine,

(L566) 4,9-dioxadodecane-1,12-diamine,

(L567) Jeffamines® from Huntsman, especially Jeffamine D230, Jeffamine D400, Jeffamine D2000, Jeffamine D4000, Jeffamine ED600, Jeffamine ED900, Jeffamine ED2003, Jeffamine EDR148, or Jeffamine EDR176 (names from the product brochure from Alfa Chemicals Ltd with reference number "Hunt32").

[0044] Among the polyvinylamine-related polymers (L13), the linear, branched or hyperbranched polyamidoamines (L221) are for example described in US 4435548, EP 115 771, EP 234 408, EP 802 215, in L. J. Hobson und W. J. Feast, Polymer 1999, 40, 1279 - 1297 or in H.-B. Mekelburger, W. Jaworek and F. Vogtle, Angewandte Chemie 1992, 104, No. 12, 1609 - 1614. Preferred polyamidoamines have an average molar mass (Mw) of 500 to 1,000,000 g/mol, more preferably 1000 to 200,000 g/mol.

[0045] Preferred polyethyleneimines (L14) are

(L525) polyethyleneimine according to the general formula (V) having an average molar mass (MW) of from 250 to 100,000 g/mol;

(L526) polyethyleneimine according to the general formula (V) having an average molar mass (MW) of from 300 to 25,000 g/mol;

(L527) polyethyleneimine according to the general formula (V) in which R¹ to R⁶ are each hydrogen, methyl, ethyl, carboxymethyl, carboxyethyl, phosphonomethyl, 2-hydroxyethyl, 2-(2'-hydroxyethoxy)ethyl or 2-[2'-(2"-hydroxyethoxy)-ethoxy]ethyl;

(L528) branched polyethyleneimine having a molecular weight of approx. 800 (GPC) and a charge density of approx.. 16 meq/g of dry substance, determined at pH 4.5, and having a ratio primary/secondary/tertiary amino (as determined by 13C-NMR) of 1/0.9/0.5;

(L529) Branched polyethyleneimine having a molecular weight of approx. 25000 (GPC), a charge density of approx. 17 meq/g of dry substance, determined at pH 4.5, and having a ratio primary/secondary/tertiary amino (as determined by 13C-NMR) of 1/1.1/0.7.

[0046] Other preferred polyethyleneimines (L14) are

(L610) a linear polyethyleneimine;

(L611) a linear polyethyleneimine showing a single peak at 2.72 ppm in 1H-NMR, wherein other peaks have not more than 15%, preferably not more than 10%, more preferably not more than 6%, most preferably not more than 3%, particularly not more than 1 % of the intensity of the single peak at 2.72 ppm;

(L612) a linear polyethyleneimine prepared as follows:
1500 g of 2-methyl-2-oxazoline, 212 g of N-methyl-2-ethyl-2-oxazoline methylsulfate and 3000 g of acetonitrile were heated to 80 °C during 24 h. Afterwards the acetonitrile was removed via steam distillation and the product was obtained as an aqueous solution containing 38% of poly(2-methyl-2-oxazoline). GPC analysis: Mn = 2550 g/mol; Mw = 3180; 1579 g of a solution of 38% poly(2-methyl-2-oxazoline) in water was mixed with 1899 g of a solution of 25% potassium hydroxide in water. The mixture was heated under reflux during 72 h. Upon cooling to 23 °C the linear polyethyleneimine precipitated, was filtered off, washed with water and dried in a vacuum oven. 223 g of the product were obtained as white powder. The 1H-NMR-spectrum of the product showed a single peak at 2.72 ppm indicating the strict linearity of the polyethyleneimine. GPC analysis: Mn = 900 g/mol.

[0047] Polyethyleneimines (L15) are preferably obtainable by reacting at least a part of the primary or secondary amino groups of the polyethyleneimine (L14) with at least one alkylene oxide.

[0048] Preferred polyethyleneimines (L15) are polyethyleneimines according to the general formula (V) wherein at least one of the radicals R² to R⁶ is a polyoxyethylene or polyoxypropylene radical.

[0049] Preferred polyethyleneimines (L15) are

(L530) Polymer obtainable by reacting at least a part of the primary or secondary amino groups of the polyethyleneimine (L14) with epoxyethane (= ethylene oxide);

(L531) Polymer obtainable by reacting at least a part of the primary or secondary amino groups of the polyethyleneimine (L14) with epoxypropane (= propylene oxide) ;

(L532) Polymer obtainable by reacting at least a part of the primary or secondary amino groups of the polyethyleneimine (L14) with 1,2- epoxybutane (= alpha butylene oxide);

(L533) Polymer obtainable by reacting at least a part of the primary or secondary amino groups of the polyethyleneimine (L14) with 2,3-epoxybutane (= beta butylene oxide), 1,2 epoxy-2 methyl-propane (= isobutylene oxide), 1,2-epoxypentane, 2,3-epoxypentane, 1,2-epoxy-2 methylbutane, or 2,3-epoxy-2 methylbutane, 1,2-epoxyhexane, 2,3-epoxyhexane, 3,4-epoxyhexane, or optionally substituted (1,2-epoxyethylene)benzene (= styrene oxide) compound;

(L534) Polyethyleneimine according to the general formula (V) wherein at least one of the radicals R² to R⁶ is a polyoxyethylene radical;

(L535) N-ethoxylated polyethyleneimine;

(L536) Polyethyleneimine with 5 to 40, preferably 10 to 30, most preferably 15 to 25 ethoxylate groups per -NH;

(L537) Polyethyleneimine (MW= 600) with 20 ethoxylate groups per-NH;

(L538) Ethoxylated polyethylenimine comprising 5 parts by weight of a branched polyethyleneimine core of molecular weight of approx. 600-800 (GPC) and approx. 95 parts by weight of moieties of formula -CH2-CH2-O-;

[0050] Particularly preferred polyethyleneimines (L15) are

(L613) polyethyleneimine with 0.75 to 0.99 EO (ethylene oxide) per NH unit, and

(L614) polyethyleneimine with 0.75 to 0.99 PO (propylene oxide) per NH unit, and

(L615) polyethyleneimine with 0.85 to 0.95 EO (ethylene oxide) per NH unit, and

(L616) polyethyleneimine with 0.85 to 0.95 PO (propylene oxide) per NH unit, and

(L617) PEI600 (=polyethyleneimine with a weight average molecular weight of 600 g/mol as measured by GPC) plus 0.9 EO (ethylene oxide) per NH unit, free of water,

(L618) PEI600 plus 0.9 PO (propylene oxide) per NH unit, free of water.

The polyethyleneimine (L613) to (L618) are preferably prepared by the synthesis procedure disclosed in WO2009/060059.

[0051] In yet another embodiment, particularly preferred polyethyleneimines (L15) are

(L619) Polytriethanolamine, and

(L620) a polytriethanolamine with a weight average molecular weight in the range of from 1,000 to 10,000 g/mol, and

(L621) a polytriethanolamine with a weight average molecular weight in the range of from 7,000 to 9,000 g/mol.

Preferred polytriethanolamines are those polytriethanolamines in which more than 90%, preferably more than 95%, more preferably more than 98% of the amine groups are tertiary amine groups, and in which more than 90%, preferably more than 95%, more preferably more than 98% of the hydroxyl groups are primary hydroxyl groups.

[0052] Regarding (L16) or (L17), the term "alkyl" as used herein and in the term alkoxy refers to saturated straight-chain or branched hydrocarbon radicals. C₁-C₄-alkyl refers to saturated straight-chain or branched hydrocarbon radicals having 1 to 4 carbon atoms such as methyl, ethyl, propyl, 1-methylethyl, butyl, 1-methylpropyl, 2-methylpropyl and 1,1-dimethylethyl. Optionally substituted alkyl refers to an alkyl radical which is unsubstituted or wherein a part or all of the hydrogen atoms are replaced by hydroxy, halogen, cyano or C₁-C₄-alkoxy. Preferably alkyl is unsubstituted.

[0053] Regarding (L16) or (L17), the term "cycloalkyl" as used herein refers to saturated or partially unsaturated mono- or bicyclic hydrocarbon radicals. Preferably the term cycloalkyl relates to monocyclic hydrocarbon radicals having 3 to 8, in particular 3 to 6 carbon atoms (C₃-C₈-cycloalkyl, C₃-C₆-cycloalkyl). Examples of such preferred cycloalkyl radicals are cyclopropyl, cyclobutyl, cyclopentyl, cyclohexyl, cycloheptyl and cyclooctyl. Optionally substituted cycloalkyl refers to a cycloalkyl radical which is unsubstituted or wherein a part or all of the hydrogen atoms are replaced by hydroxy, halogen, cyano, C₁-C₄-alkyl or C₁-C₄-alkoxy. Preferably cycloalkyl is unsubstituted or carries 1, 2 or 3 C₁-C₄-alkyl radicals.

[0054] Regarding (L16) or (L17), the term "aryl" as used herein refers to phenyl or naphthyl, preferably phenyl. Optionally substituted aryl refers to an aryl radical which is unsubstituted or wherein a part or all of the hydrogen atoms are replaced by hydroxy, halogen, cyano, C₁-C₄-alkyl or C₁-C₄-alkoxy. Preferably cycloalkyl is unsubstituted or carries 1, 2 or 3 C₁-C₄-alkyl radicals.

[0055] Regarding (L16) or (L17), the term "C₁-C₆-alkylene" as used herein refers to a saturated, divalent straight chain or branched hydrocarbon chains of 2, 3, 4, 5 or 6 carbon groups, examples including methylene, ethane-1,2-diyl, propane-1,3-diyl, propane-1,2-diyl, 2-methylpropane-1,2-diyl, 2,2-dimethylpropane-1,3-diyl, butane-1,4-diyl, butane-1,3-diyl (= 1-methylpropane-1,3-diyl), butane-1,2-diyl, butane-2,3-diyl, 2-methyl-butan-1,3-diyl, 3-methyl-butan-1,3-diyl (= 1,1-dimethylpropane-1,3-diyl), pentane-1,4-diyl, pentane-1,5-diyl, pentane-2,5-diyl, 2-methylpentane-2,5-diyl (= 1,1-dimethylbutane-1,3-diyl) and hexane-1,6-diyl.

[0056] Regarding (L15) or (L17), the term "alkylene oxide" as used herein relates to alkyl or alkylaryl compounds carrying at least one, preferably 1 or 2, in particular 1 epoxy group at the alkyl moieties of the compound. Regarding (L17), examples of alkyl compounds carrying one epoxy group are epoxyethane (= ethylene oxide), epoxypropane (= propylene oxide), 1,2-epoxybutane (= alpha butylene oxide), 2,3-epoxybutane (= beta butylene oxide), 1,2 epoxy-2 methyl-propane (= isobutylene oxide), 1,2-epoxypentane, 2,3-epoxypentane, 1,2-epoxy-2 methylbutane, 2,3-epoxy-2 methylbutane, 1,2-epoxyhexane, 2,3-epoxyhexane and 3,4-epoxyhexane. Examples of alkylaryl compounds carrying one epoxy group are optionally substituted (1,2-epoxyethylene)benzene (= styrene oxide) compounds.

[0057] Regarding (L16) or (L17), the term "condensation" as used herein refers to a chemical reaction wherein a covalent bond between two corresponding functional groups is formed together with the formal loss of a small molecule such as water. Preferably the term condensation refers to an etherification together with a dehydration reaction.

[0058] Regarding (L16) or (L17), examples of N-(Hydroxyalkyl)amines (I.a) are e.g. N-tri-(2-hydroxyalkyl)-amines. N-tri-(2-hydroxyalkyl)-amines are e.g. obtainable by reacting ammonia with three equivalents of an alkylene oxides (ammonolysis). Preferred examples of such compounds (I.a) are triethanolamine, triisopropanolamine and tributan-2-olamine.

[0059] Regarding (L16) or (L17), examples of N-(Hydroxyalkyl)amines (I.b) are e.g. N-di-(2-hydroxyalkyl)-amines which are obtainable by reacting a primary amine of formula H₂N-R⁶, wherein R⁶ has one of the meanings given above, with two equivalents of an alkylene oxide (aminolysis). Preferred examples of such compounds (I.b) are e.g. N-methyldiethanolamine, N,N-bis-(2-hydroxypropyl)-N-methylamine, N,N-bis-(2-hydroxybutyl)-N-methylamine, N-isopropyldiethanolamine, N-n-butyldiethanolamine, N-sec-butyldiethanolamine, N-cyclohexyldiethanolamine, N-benzyldiethanolamine, N-4-tolyldiethanolamine, N,N-Bis-(2-hydroxyethyl)-anilin and the like.

[0060] Regarding (L16) or (L17), preferred are polymers obtainable from compounds selected from N-(hydroxyalkyl)amines of formulae (I.a) and/or (I.b), wherein A is a methylene group, which is unsubstituted or carries one substituent selected from C₁C₄-alkyl. More preferred are polymers obtainable from compounds (I.a) and/or (I.b), wherein A is methylene or methylene carrying one methyl group. Particularly preferred are polymers obtainable from compounds (I.a) and/or (I.b), wherein A is unsubstituted methylene.

[0061] Regarding (L16) or (L17), preferred are polymers obtainable from compounds selected from N-(hydroxyalkyl)amines of formulae (I.a) and/or (I.b), wherein R¹, R^1*, R², R^2*, R³, R^3*, R⁴, R^4*, R⁵ and R^5* are independently of one another selected from hydrogen and C₁-C₄-alkyl, i.e. hydrogen, methyl, ethyl, n-propyl, isopropyl, n-butyl, sec.-butyl and tert.-butyl. More preferably R¹, R^1*, R², R^2*, R³, R^3*, R⁴, R^4*, R⁵ and R^5* are independently of one another selected from hydrogen and methyl.

[0062] Regarding (L16) or (L17), preferred are polymers obtainable from N-(hydroxyalkyl)amines of formulae (I.a) and/or (I.b), wherein R^1*, R^2*, R^3*, R^4* and R^5* are hydrogen and R¹, R², R³, R⁴, and R⁵ are independently of one another selected from hydrogen and C₁-C₄-alkyl. More preferably R^1*, R^2*, R^3*, R^4* and R^5* are hydrogen and R¹, R², R³, R⁴, and R⁵ are independently of one another selected from hydrogen and methyl.

[0063] Regarding (L16) or (L17), preferred are polymers obtainable from N-(hydroxyalkyl)amines of formula (I.b) wherein R⁶, if present, is preferably selected from hydrogen and C₁-C₄-alkyl.

[0064] Regarding (L17), the polymer is preferably obtainable by reacting 1 to 100 moles, preferably 2 to 80 moles of the at least one alkylene oxide with 1 mol of the remaining hydroxy groups and, if present, of the secondary amino groups of the polyether obtainable by condensation of the at least one compound of formulae (I.a) and/or (I.b).

[0065] Regarding (L16) or (L17), the polymer preferably has a number average molecular weight in the range of 500 to 100 000 g/mol, more preferably in the range of 1000 to 80 000 g/mol, and in particular in the range of from 2 000 to 50 000 g/mol.

[0066] Regarding (L16) or (L17), the polymer preferably has a polydispersity (Mw/Mn) in the range of 1 to 10, and in particular in the range of 1 to 5.

[0067] Regarding (L16) or (L17), in one particular embodiment the polymer s obtainable by a process wherein in step a) less than 5% by weight, preferably less than 1% by weight and more preferably substantially no, i.e. less than 0.1% by weight, of co-condensable compounds different from compounds of formulae (I.a) and/or (I.b), are employed (i.e. co-condensed) based on the amount of the compounds of formulae (I.a) and/or (I.b).

[0068] Preferred polymers (L16) are:

(L539) Polymer obtainable by the process (L16P) wherein the N-(Hydroxyalkyl)amine (I.a) is triethanolamine;

(L540) Polymer obtainable by the process (L16P) wherein the N-(Hydroxyalkyl)amine (I.a) is triisopropanolamine;

(L541) Polymer obtainable by the process (L16P) wherein the N-(Hydroxyalkyl)amine (I.a) is tributan-2-olamine;

(L542) Polymer obtainable by the process (L16P) wherein the N-(Hydroxyalkyl)amine (I.b) is N-methyldiethanolamine;

(L543) Polymer obtainable by the process (L16P) wherein the N-(Hydroxyalkyl)amine (I.b) is N,N-bis-(2-hydroxypropyl)-N-methylamine, N,N-bis-(2-hydroxybutyl)-N-methylamine, N-isopropyldiethanolamine, N-n-butyldiethanolamine, N-sec-butyldiethanolamine, N-cyclohexyldiethanolamine, N-benzyldiethanolamine, N-4-tolyldiethanolamine, or N,N-Bis-(2-hydroxyethyl)-anilin;

[0069] Preferred polymers (L17) are

(L544) Polymer obtainable by the process (L17P) wherein the N-(Hydroxyalkyl)amine (I.a) is triethanolamine;

(L545) Polymer obtainable by the process (L17P) wherein the N-(Hydroxyalkyl)amine (I.a) is triisopropanolamine;

(L546) Polymer obtainable by the process (L17P) wherein the N-(Hydroxyalkyl)amine (I.a) is tributan-2-olamine;

(L547) Polymer obtainable by the process (L17P) wherein the N-(Hydroxyalkyl)amine (I.b) is N-methyldiethanolam ine;

(L548) Polymer obtainable by the process (L17P) wherein the N-(Hydroxyalkyl)amine (I.b) is N,N-bis-(2-hydroxypropyl)-N-methylamine, N,N-bis-(2-hydroxybutyl)-N-methylamine, N-isopropyldiethanolamine, N-n-butyldiethanolamine, N-sec-butyldiethanolamine, N-cyclohexyldiethanolamine, N-benzyldiethanolamine, N-4-tolyldiethanolamine, or N,N-Bis-(2-hydroxyethyl)-anilin;

(L549) Polymer obtainable by the process (L17P) wherein the alkylene oxide is epoxyethane (= ethylene oxide);

(L550) Polymer obtainable by the process (L17P) wherein the alkylene oxide is epoxypropane (= propylene oxide) ;

(L551) Polymer obtainable by the process (L17P) wherein the alkylene oxide is 1,2- epoxybutane (= alpha butylene oxide);

(L552) Polymer obtainable by the process (L17P) wherein the alkylene oxide is 2,3-epoxybutane (= beta butylene oxide), 1,2 epoxy-2 methyl-propane (= isobutylene oxide), 1,2-epoxypentane, 2,3-epoxypentane, 1,2-epoxy-2 methylbutane, or 2,3-epoxy-2 methylbutane, 1,2-epoxyhexane, 2,3-epoxyhexane or 3,4-epoxyhexane;

(L553) Polymer obtainable by the process (L17P) wherein the alkylene oxide is an optionally substituted (1,2-epoxyethylene)benzene (= styrene oxide) compound;

[0070] Dendritic polyamines or their precursors precursors (L19) include N,N,N',N'-tetraaminopropylalkylenediamine, also known as N6-amine, and the dendritic amines obtainable therefrom by aminopropylation and known as N14-, N30-, N62- and N128-amine according to the number of their nitrogen atoms. These amines have for example a basic ethylenediamine, propylenediamine or butylenediamine skeleton whose hydrogen atoms are substituted by amino(n-propyl) radicals on the nitrogen. The terminal amino groups may in turn be substituted by corresponding aminopropyl groups (NI 4-amine) etc. Methods for preparing these amines are described in WO 96/15097 starting from ethylenediamine. Likewise preferred examples of these amines are corresponding N-amines as described in WO 93/14147, which are prepared from butylenediamine.
The bicyclic, tricyclic or higher polycyclic polyamine (L20) is preferably selected from the group consisting of:

(L172) bicylic polyamine;

(L173) tricylic polyamine;

(L174) n-cyclic polyamine with n (number of cyclic structures) being larger than 3;

(L175) bicyclic aliphatic diamine;

(L176) bicyclic aliphatic diamine wherein both of the two amino groups of the diamine are tertiary amino groups, more preferably wherein additionally both of the two nitrogen atoms of the two amino groups of the diamine are bridgehead atoms;

(L177) 1,4-Diazabicyclo[2.2.2]octan (DABCO);

(L178) Substituted 1,4-Diazabicyclo[2.2.2]octan (DABCO);

[0071] The amine (L21) is preferably selected from the group consisting of

(L179) Methyldiisopropanolamine

(L180) Butyldiethanolamine

[0072] The amine (L22) is preferably selected from the group consisting of

(L181) N,N-Dibutylethanolamine

(L182) N,N,-Dimethylisopropanolamine

[0073] The imidazolidinone (L23) is preferably (L183) 1-(2-Hydroxyethyl)-2-imidazolidinone [alternative name: (2-Hydroxyethyl)ethyleneurea].

[0074] The morpholine (L24) is preferably (L184) N-(2-Hydroxyethyl)morpholine.

[0075] The homo- or copolymer of amino acids (L29) is preferably selected from the group consisting of

(L573) a homo- or copolymer of an alpha-amino acid (a-amino acid),

(L574) a homo- or copolymer of a naturally occurring alpha-amino acid,

(L575) a homo- or copolymer of a proteinogenic alpha-amino acid,

(L576) a homo- or copolymer of alanine,

(L577) a homo- or copolymer of arginine,

(L578) a homo- or copolymer of asparagine,

(L579) a homo- or copolymer of aspartic acid,

(L580) a homo- or copolymer of cysteine,

(L581) a homo- or copolymer of glutamic acid,

(L582) a homo- or copolymer of glutamine,

(L583) a homo- or copolymer of glycine,

(L584) a homo- or copolymer of histidine,

(L585) a homo- or copolymer of isoleucine,

(L586) a homo- or copolymer of leucine,

(L587) a homo- or copolymer of lysine,

(L588) a homo- or copolymer of methionine,

(L589) a homo- or copolymer of phenylalanine,

(L590) a homo- or copolymer of proline,

(L591) a homo- or copolymer of serine,

(L592) a homo- or copolymer of threonine,

(L593) a homo- or copolymer of tryptophan,

(L594) a homo- or copolymer of tyrosine,

(L595) a homo- or copolymer of valine,

(L596) a homo- or copolymer of selenocysteine,

(L597) a homo- or copolymer of pyrrolysine,

(L598) a homo- or copolymer of N-formylmethionine, and

(L599) a homo- or copolymer of ornithine.

[0076] The homo- or copolymer of amino acids (L29) is preferably a homopolymer of amino acids.

[0077] In another embodiment, the homo- or copolymer of amino acids (L29) is preferably a copolymer of amino acids.

[0078] The homo- or copolymer of lysine (L587) is preferably selected from the group consisting of

(L600a) a homopolymer of L-lysine,

(L601 a) a homopolymer of D-lysine,

(L600b) a copolymer of D-lysine,

(L601b) a copolymer of D-lysine,

(L602) alpha-polylysine,

(L603) epsilon-polylysine.

[0079] The homo- or copolymer of lysine (L587) has preferably a weight average molecular weight of from 250 to 10,000 g/mol, more preferably from 500 to 5,000 g/mol, most preferably from 800 to 3,500 g/mol, particularly preferaby from 1,200 to 2,800 g/mol, particularly from 1,700 to 2,300 g/mol. In another embodiment, the homo- or copolymer of lysine (L587) has preferably a weight average molecular weight of from 800 to 1,100 g/mol. In yet another embodiment, the homo- or copolymer of lysine (L587) has preferably a weight average molecular weight of from 3,000 to 3,500 g/mol.

[0080] The homo- or copolymer of lysine (L587) has preferably a number average molecular weight of from 250 to 10,000 g/mol, more preferably from 500 to 5,000 g/mol, most preferably from 700 to 3,000 g/mol, particularly preferaby from 750 to 2,000 g/mol, particularly from 1,200 to 1,500 g/mol. In another embodiment, the homo- or copolymer of lysine (L587) has preferably a number average molecular weight of from 750 to 900 g/mol. In yet another embodiment, the homo- or copolymer of lysine (L587) has preferably a number average molecular weight of from 1500 to 1750 g/mol.

[0081] The homo- or copolymer of lysine (L587) has preferably a amine number of from 100 to 2,000 mgKOH/g, more preferably from 200 to 1,000 mgKOH/g, most preferably from 300 to 700 mgKOH/g, particularly preferaby from 370 to 630 mgKOH/g, particularly from 420 to 500 mgKOH/g. In another embodiment, the homo- or copolymer of lysine (L587) has preferably a amine number of from 360 to 440 mgKOH/g. In yet another embodiment, the homo- or copolymer of lysine (L587) has preferably a amine number of from 560 to 640 mgKOH/g.

[0082] The homo- or copolymer of lysine (L587) is preferably prepared through one of the processes of the below process embodiments (L587P1) to (L587P16):

(L587P1) A process for preparing a polylysine, comprising the steps of

(a) heating a boiling aqueous reaction mixture comprising lysine and water in a weight ratio of 1:10 to 3:1 within 2 to 8 hours to a temperature in the range from 135 to 165 °C, and

(b) keeping the reaction mixture of step (a) at a temperature in a range from 135 to 165 °C at a pressure below atmospheric pressure,
wherein water is removed from the mixture, and any temperature increase is ≤ 30 °C in 60 minutes;

(L587P2) The process of embodiment (L587P1), wherein water is removed from the mixture in both steps;

(L587P3) The process of embodiment (L587P1) or (L587P2), wherein the first step is carried out at atmospheric pressure;

(L587P4) The process of any of the embodiments (L587P1) to (L587P3), wherein the pressure is reduced in the second step to a pressure in the range from 0.1 to 500 mbar, preferably to a pressure in the range from 50 to 350 mbar;

(L587P5) The process of any of the embodiments (L587P1) to (L587P4), wherein water is removed from the mixture in the second step until a product consisting essentially of molten polylysine is obtained.

(L587P6) The process of any of the embodiments (L587P1) to (L587P5), wherein the polylysine obtained in the second step is cooled to solidify it.

(L587P7) The process of any of the embodiments (L587P1) to (L587P6), wherein in the second step the reaction mixture is kept for 1 to 5 hours at a temperature in a range from 135 to 165 °C.

(L587P8) The process of any of the embodiments (L587P1) to (L587P7), wherein the heating time for the first and second step together is 4.5 to 11 hours.

(L587P9) The process of any of the embodiments (L587P1) to (L587P8), wherein the mixture is kept at a temperature of 160 °C or more for at most 6 hours.

(L587P10) The process of any of the embodiments (L587P1) to (L587P9), wherein the boiling aqueous reaction mixture of the first step is provided by heating a starting mixture comprising lysine and water in a weight ratio of 1:10 to 3:1.

(L587P11) The process of any of the embodiments (L587P1) to (L587P10) further comprising a chemical modification of the polylysine to obtain a chemically modified polylysine.

(L587P12) The process of any of the embodiments (L587P1) to (L587P11), wherein the polylysine is a non-crosslinked branched polylysine.

(L587P13) The process of any of the embodiments (L587P1) to (L587P12), wherein the polylysine has a weight-average molecular weight in the range from 1 000 Da to 10 000 Da.

The polylysin prepared by the process (L587P1) is referred to as polylysine (L607).
In another embodiment, the homo- or copolymer of lysine (L587) is preferably a branched polylysine obtainable by the process of any of process embodiments (L587P1) to (L587P13).

[0083] In another embodiment, the homo- or copolymer of lysine (L587) has preferably a weight-average molecular weight in the range from 1500 Da to 4000 Da and a polydispersity of <2.
In another embodiment, the homo- or copolymer of lysine (L587) has preferably a degree of branching of from 0.21 to 0.28.
In another embodiment, the homo- or copolymer of lysine (L587) is preferably
(L604) a polylysine prepared as follows:
800 g of 50% water solution of L-Lysine were placed in a 2L four-necked flask equipped with a stirrer a condensation column, a thermometer and a Nitrogen inlet. The L-Lysine solution was heated to the boiling point. Then the temperature of the external heat source was increased according to the following profile 1 h at 150C, 1h at 160 and 1h at 170 and 1 h at 180C while water was distilled off. The pressure was then decreased to 200 mbar while the external heat source was maintained at 180 °C. The reaction for circa 2 hours continued under vacuo (200 mbar). The warm reaction melt was collected in an aluminum vessel. At room temperature a solid material was obtained. The polymer was characterized via Gel permeation Chromatography in water and regarding amino numbers: Mn: 1690 g/mol; Mw: 3298 g/mol; polydispersity (M_w/M_n): 1.9; amine number**: 396 mgKOH/g (given for 100% pure polylysine).

[0084] In yet another embodiment, the homo- or copolymer of lysine (L587) is preferably
(L605) a polylysine prepared as follows:
1700 g of 50% water solution of L-Lysine were placed in a 2L four-necked flask equipped with a stirrer a condensation column, a thermometer and a nitrogen inlet. The L-Lysine solution was heated to the boiling point. Then the temperature of the external heat source was increased according to the following profile 1 h at 150C, 1h at 160 and 1h at 170 and 1 h at 180C while water was distilled off. The pressure was then decreased to 200 mbar while the external heat source was maintained at 180 °C and the reaction for circa 1 + ½ hour continued under vacuo (200 mbar). The warm reaction melt was collected in an aluminum vessel. At room temperature a solid material was obtained. The polymer was characterized via Gel permeation Chromatography in water and regarding amino numbers: Mn: 1380 g/mol; Mw: 1980 g/mol; polydispersity (M_w/M_n): 1.4; amine number**: 458 mgKOH/g* (given for 100% pure polylysine).

[0085] In yet another embodiment, the homo- or copolymer of lysine (L587) is preferably
(L606) a polylysine prepared as follows:
1700 g of 50% water solution of L-Lysine were placed in a 2L four-necked flask equipped with a stirrer a condensation column, a thermometer and a nitrogen inlet. The L-Lysine solution was heated to the boiling point. Then the temperature of the external heat source was increased according to the following profile 1 h at 150C, 1h at 160 and 1h at 170 and 1 h at 180C while water was distilled off. The pressure was then decreased to 200 mbar while the external heat source was maintained at 180 °C and the reaction for circa 15 minutes continued under vacuo (200 mbar). The warm reaction melt was collected in an aluminum vessel. At room temperature a solid material was obtained. The polymer was characterized via Gel permeation Chromatography in water and regarding amine numbers: Mn: 840 g/mol; Mw: 940 g/mol; polydispersity (M_w/M_n): 1.1; Amine number: 598 mgKOH/g (given for 100% pure polylysine).

[0086] According to the invention, a further composition (Q5) was found which comprises:

(A) a mixture comprising at least one (thio)phosphoric acid triamide according to the general formula (I)

         R¹R²N-P(X)(NH₂)₂,

wherein

X

is oxygen or sulfur;

R¹

is a C₁ to C₂₀ alkyl, C₃ to C₂₀ cycloalkyl, C₆ to C₂₀ aryl, or dialkylaminocarbonyl group;

R²

is H, or

R¹ and R²

together with the nitrogen atom linking them define a 5- or 6-membered saturated or unsaturated heterocyclic radical, which optionally comprises 1 or 2 further heteroatoms selected from the group consisting of nitrogen, oxygen, and sulfur,

and

(L2) at least one colorant selected from the group consisting of

(L700) CI 20470 (Acid Black 1; C22H14N6Na209S2; EINECS 213-903-1; CAS 1064-48-8);

(L701) CI 50420 (Acid Black 2; -; EINECS -; CAS 8005-03-6 );

(L702) CI 42045 (Acid Blue 1; C27H31N2Na06S2; EINECS 204-934-1; CAS 129-17-9);

(L703) CI 42735 (Acid Blue 104; C43H49N3Na06S2; EINECS 229-390-2; CAS 6505-30-2);

(L704) CI 42051 (Acid Blue 3; C54H62CaN4014S4; EINECS 222-573-8; CAS 3536-49-0);

(L705) CI 62045 (Acid Blue 62; C20H19N2Na05S; EINECS 224-460-9; CAS 4368-56-3);

(L706) CI 42080 (Acid Blue 7; C37H35N2Na06S2; EINECS 222-476-0; CAS 3486-30-4);

(L707) CI 73015 (Acid Blue 74; C16H8N2Na208S2; EINECS 212-728-8; CAS 860-22-0);

(L708) CI 61585 (Acid Blue 80; C32H28N2Na208S2; EINECS 224-748-4; CAS 4474-24-2);

(L709) CI 42090 (Acid Blue 9; C37H34N2Na209S3; EINECS 223-339-8; CAS 3844-45-9);

(L710) CI 10020 (Acid Green 1; C30H15FeN3Na3015S3; EINECS 243-010-2; CAS 19381-50-1);

(L711) CI 42170 (Acid Green 22; C39H38CIN2NaO6S2; EINECS 227-513-4; CAS 5863-51-4);

(L712) CI 61570 (Acid Green 25; C28H20N2Na208S2; EINECS 224-546-6; CAS 4403-90-1);

(L713) CI 44090 (Acid Green 50; C27H25N2Na07S2; EINECS 221-409-2; CAS 3087-16-9);

(L714) CI 42100 (Acid Green 9; C37H34CIN2NaO6S2; EINECS 225-458-0; CAS 4857-81-2);

(L715) CI 16230 (Acid Orange 10; C16H10N2Na207S2; EINECS 217-705-6; CAS 1936-15-8);

(L716) CI 45370 (Acid Orange 11; C20H8Br2Na205; EINECS 224-468-2; CAS 4372-02-5 );

(L717) CI 14270 (Acid Orange 6; C12H10N205SNa; EINECS 208-924-8; CAS 547-57-9);

(L718) CI 15510 (Acid Orange 7; C16H11N204SNa; EINECS 211-199-0; CAS 633-96-5);

(L719) CI 18050 (Acid Red 1; C18H13N3Na208S2; EINECS 223-098-9; CAS 3734-67-6);

(L720) CI 14720 (Acid Red 14; C20H12N2Na207S2; EINECS 222-657-4; CAS 3567-69-9);

(L721) CI 14720:1 (Acid Red 14 Aluminum Lake; C60H36AI2N6O21S6; EINECS 282-478-2; CAS 84238-07-3);

(L722) CI 18130 (Acid Red 155; -; EINECS -; CAS 10236-37-0);

(L723) CI 24790 (Acid Red 163; C44H34N4Na2012S3; EINECS 236-531-1; CAS 13421-53-9);

(L724) CI 16255 (Acid Red 18; C20H11 N2Na3010S3; EINECS 220-036-2; CAS 2611-82-7);

(L725) CI 16255:1 (Acid Red 18 Aluminum Red; C20H14AIN2010S3; EINECS 235-438-3; CAS 12227 -64-4);

(L726) CI 18736 (Acid Red 180; C34H27C12CrN8Na204; EINECS 229-051-9; CAS 6408-26-0);

(L727) CI 16185 (Acid Red 27; C20H11N2Na3010S3; EINECS 213-022-2; CAS 915-67-3);

(L728) CI 17200 (Acid Red 33; C16H11 N3Na207S2; EINECS 222-656-9; CAS 3567-66-6);

(L729) CI 16290 (Acid Red 41; C20H10N2Na4013S4; EINECS 227-454-4; CAS 5850-44-2);

(L730) CI 16250 (Acid Red 44; C20H12N2Na207S2; EINECS -; CAS 2766-77-0);

(L731) CI 45220 (Acid Red 50; C25H25N2Na07S2; EINECS 227-528-6; CAS 5873-16-5);

(L732) CI 45430 (Acid Red 51; C20H614Na205; EINECS 240-474-8; CAS 16423-68-0);

(L733) CI 45100 (Acid Red 52; C27H29N2Na07S2; EINECS 222-529-8; CAS 3520-42-1);

(L734) CI 45380 (Acid Red 87; C20H6Br4Na205; EINECS 241-409-6; CAS 17372-87-1);

(L735) CI 15620 (Acid Red 88; C20H13N2Na04S; EINECS 216-760-3; CAS 1658-56-6);

(L736) CI 45410 (Acid Red 92; C20H2Br4C14Na205; EINECS 242-355-6; CAS 18472-87-2);

(L737) CI 45405 (Acid Red 98; C20H4Br4C12K205; EINECS 229-225-4; CAS 6441-77-6);

(L738) CI 60730 (Acid Violet 43; C21H14NNa06S; EINECS 224-618-7; CAS 4430-18-6);

(L739) CI 50325 (Acid Violet 50; C29H22N4Na07S2; EINECS 229-951-1; CAS 6837-46-3);

(L740) CI 45190 (Acid Violet 9; C34H26N2Na06S; EINECS 228-377-9; CAS 6252-76-2);

(L741) CI 10316 (Acid Yellow 1; C10H4N2Na208S; EINECS 212-690-2; CAS 846-70-8);

(L742) CI 18820 (Acid Yellow 11; C16H13N4Na04S; EINECS 228-808-0; CAS 6359-82-6);

(L743) CI 18965 (Acid Yellow 17; C16H10Na2N407S2; EINECS 228-819-0; CAS 6359-98-4);

(L744) CI 19140 (Acid Yellow 23; C16H9N4Na309S2; EINECS 217-699-5; CAS 1934-21-0);

(L745) CI 47005 (Acid Yellow 3; C18H9NNa208S2; EINECS 305-897-5; CAS 8004-92-0);

(L746) CI 13065 (Acid Yellow 36; C18H14N3Na03S; EINECS 209-608-2; CAS 587-98-4);

(L747) CI 18690 (Acid Yellow 59; C34H25CrN806; EINECS 227-022-5; CAS 5601-29-6);

(L748) CI 45350 (Acid Yellow 73; C20H10Na205; EINECS 208-253-0; CAS 518-47-8);

(L749) CI 13015 (Acid Yellow 9; C12H11N3Na06S2; EINECS 220-293-0; CAS 2706-28-7);

(L750) CI 16035 (Allurarot AC; C18H14N2Na208S2; EINECS 247-368-0; CAS 25956-17-6);

(L751) CI 44045 (Basic Blue 26; C33H32CIN3; EINECS 219-943-6; CAS 2580-56-5);

(L752) CI 12251 (Basic Brown 17; C19H20CIN503; EINECS 269-944-0; CAS 68391-32-2);

(L753) CI 12251:1 (Basic Red 118; -; EINECS 275-216-3; CAS 71134-97-9);

(L754) CI 42510 (Basic Violet 14; C20H19N3 . HCI; EINECS 211-189-6; CAS 632-99-5);

(L755) CI 42520 (Basic Violet 2; C22H24N3CI; EINECS 221-831-7; CAS 3248-91-7);

(L756) CI 40215 (Direct Orange 39; -; EINECS 215-397-8; CAS 1325-54-8);

(L757) CI 40215 (Direct Orange 46; -; EINECS 256-783-6; CAS 50814-31-8);

(L758) CI 60724 (Disperse Violet 27; C20H13N03; EINECS 242-939-0; CAS 19286-75-0);

(L759) CI 28440 (Food Black 1; C28H17N5Na4014S4; EINECS 219-746-5; CAS 2519-30-4);

(L760) CI 27755 (Food Black 2; C26H15N5Na4013S4; EINECS 218-326-9; CAS 2118-39-0);

(L761) CI 42053 (Food Green 3; C37H34N2Na2010S3; EINECS 219-091-5; CAS 2353-45-9);

(L762) CI 40800 (Food Orange 5; C40H56; EINECS 230-636-6; CAS 7235-40-7);

(L763) CI 40820 (Food Orange 6; C30H400; EINECS 214-171-6; CAS 1962-15-8);

(L764) CI 40825 (Food Orange 7; C32H4402; EINECS 214-173-7; CAS 1109-11-1);

(L765) CI 40850 (Food Orange 8; C40H5202; EINECS 208-187-2; CAS 514-78-3);

(L766) CI 14700 (Food Red 1; C18H14N2Na207S2; EINECS 224-909-9; CAS 4548-53-2);

(L767) CI 14815 (Food Red 2; C18H14N2Na207S2; EINECS 221-856-3; CAS 3257-28-1);

(L768) CI 15985 (Food Yellow 3; C16H10N2Na207S2; EINECS 220-491-7; CAS 2783-94-0);

(L769) CI 74160 (Pigment Blue 15; C32H16CuN8; EINECS 205-685-1; CAS 147-14-8);

(L770) CI 74100 (Pigment Blue 16; C32H18N8; EINECS 209-378-3; CAS 574-93-6);

(L771) CI 69800 (Pigment Blue 60; C28H14N204; EINECS 201-375-5; CAS 81-77-6);

(L772) CI 69825 (Pigment Blue 64; C28H12C12N204; EINECS 204-980-2; CAS 130-20-1);

(L773) CI 73000 (Pigment Blue 66; C16H10N202; EINECS 207-586-9; CAS 482-89-3);

(L774) CI 12480 (Pigment Brown 1; C25H19C12N304; EINECS 229-106-7; CAS 6410-40-8);

(L775) CI 74260 (Pigment Green 7; -; EINECS 215-524-7; CAS 1328-53-6);

(L776) CI 10006 (Pigment Green 8; C30H18FeN3Na06; EINECS 240-299-7; CAS 16143-80-9);

(L777) CI 11725 (Pigment Orange 1; C18H18N405; EINECS 228-901-6; CAS 6371-96-6);

(L778) CI 71105 (Pigment Orange 43; C26H12N402; EINECS 224-597-4; CAS 4424-06-0);

(L779) CI 12370 (Pigment Red 112; C24H16C13N302; EINECS 229-440-3; CAS 6535-46-2);

(L780) CI 73915 (Pigment Red 122; C22H16N202; EINECS 213-561-3; CAS 980-26-7);

(L781) CI 45430:1 (Pigment Red 172; C60H27AII12015; EINECS 235-440-4; CAS 12227-78-0);

(L782) CI 73360 (Pigment Red 181; C18H10C1202S2; EINECS 219-163-6; CAS 2379-74-0);

(L783) CI 12120 (Pigment Red 3; C17H13N303; EINECS 219-372-2; CAS 2425-85-6);

(L784) CI 12085 (Pigment Red 4; C16H10ClN303; EINECS 220-562-2; CAS 2814-77-9);

(L785) CI 15865 (Pigment Red 48; C18H11CIN2Na206S; EINECS 222-642-2; CAS 3564-21-4);

(L786) CI 15865:1 (Pigment Red 48:1; C18H11BaCIN206S; EINECS 231-494-8; CAS 7585-41-3);

(L787) Cl 15865:2 (Pigment Red 48:2; C18H11CaClN2O6S; EINECS 230-303-5; CAS 7023-61-2);

(L788) Cl 15865:3 (Pigment Red 48:3; C18H11ClN2O6SSr; EINECS 239-879-2; CAS 15782-05-5);

(L789) Cl 15865:4 (Pigment Red 48:4; C18H11ClMnN2O6S; EINECS 226-102-7; CAS 5280-66-0);

(L790) Cl 15630 (Pigment Red 49; C17H12Cl2NaO4S; EINECS 214-998-2; CAS 1248-18-6);

(L791) Cl 15630:1 (Pigment Red 49:1; C40H26BaN4O8S2; EINECS 214-160-6; CAS 1103-38-4);

(L792) Cl 15630:2 (Pigment Red 49:2; C40H26CaN4O8S2; EINECS 214-161-1; CAS 1103-39-5);

(L793) Cl 12490 (Pigment Red 5; C30H31ClN4O7S; EINECS 229-107-2; CAS 6410-41-9);

(L794) Cl 15580 (Pigment Red 51; C34H26BaN4O8S2; EINECS 227-459-1; CAS 5850-87-3);

(L795) Cl 15585 (Pigment Red 53; C17H12ClN2NaO4S; EINECS 218-248-5; CAS 2092-56-0);

(L796) Cl 15585:1 (Pigment Red 53:1; C34H24BaCl2N4O8S2; EINECS 218-248-5; CAS 5160-02-1);

(L797) Cl 15585:2 (Pigment Red 53:2; C34H24CaCl2N4O8S2; EINECS 288-057-6; CAS 67990-35-6);

(L798) Cl 15850 (Pigment Red 57; -; EINECS 227-497-9; CAS 5858-81-1);

(L799) Cl 15850 (Pigment Red 57:1; C18H12CaN2O6S; EINECS 226-109-5; CAS 5281-04-9);

(L800) Cl 15880 (Pigment Red 63; -; EINECS -; CAS 5858-84-4);

(L801) Cl 15980 ? (Pigment Red 63:?; -; EINECS 219-073-7; CAS 2347-72-0);

(L802) Cl 15880:1 (Pigment Red 63:1; C21H12CaN2O6S; EINECS 229-142-3; CAS 6417-83-0);

(L803) Cl 15800 (Pigment Red 64:1; C34H22CaN4O6; EINECS 228-899-7; CAS 6371-76-2);

(L804) Cl 15525 (Pigment Red 68; C34H18CaCl2N4Na2O12S2; EINECS 227-456-5; CAS 5850-80-6) ;

(L805) Cl 12420 (Pigment Red 7; C25H19Cl2N3O2; EINECS 229-315-3; CAS 6471-51-8);

(L806) Cl 58000 (Pigment Red 83; C14H8O4; EINECS 200-782-5; CAS 72-48-0);

(L807) Cl 45380:3 (Pigment Red 90:1; -; EINECS 240-005-7; CAS 15876-39-8);

(L808) Cl 73900 (Pigment Violet 19; C20H12N2O2; EINECS 213-879-2; CAS 1047-16-1);

(L809) Cl 45170 (Pigment Violet 19; C28H31ClN2O3; EINECS ; CAS 81-88-9);

(L810) Cl 51319 (Pigment Violet 23; C34H22Cl2N4O2; EINECS 228-767-9; CAS 6358-30-1);

(L811) Cl 73385 (Pigment Violet 36; C18H10Cl2O2S2; EINECS 226-750-0; CAS 5462-29-3);

(L812) Cl 58055 (Pigment Violet 5; C14H8O7S; EINECS -; CAS 145-48-2);

(L813) Cl 11680 (Pigment Yellow 1; C17H16O4N4; EINECS 219-730-8; CAS 2512-29-0);

(L814) Cl 19140:1 (Pigment Yellow 100; C48H33AlN12O27S6; EINECS 235-428-9; CAS 12225-21-7);

(L815) Cl 15985:1 (Pigment Yellow 104; C16H12AlN2O7S2; EINECS 239-888-1; CAS 15790-07-5);

(L816) Cl 21100 (Pigment Yellow 13; C36H34Cl2N6O4; EINECS 225-822-9; CAS 5102-83-0);

(L817) Cl 13980 (Pigment Yellow 151; C18H15N5O5; EINECS-; CAS 31837-42-0);

(L818) Cl 20040 (Pigment Yellow 16; C34H28Cl4N6O4; EINECS 227-783-3; CAS 5979-28-2);

(L819) Cl 11710 (Pigment Yellow 3; C16H12Cl2N4O4; EINECS 229-355-1; CAS 6486-23-3);

(L820) Cl 21108 (Pigment Yellow 83; C36H32Cl4N6O8; EINECS 226-939-8; CAS 5567-15-7);

(L821) Cl 74180 (Solvent Blue 38; -; EINECS 215-523-1; CAS 1328-51-4);

(L822) Cl 61565 (Solvent Green 3; C28H22N2O2; EINECS 204-909-5; CAS 128-80-3);

(L823) Cl 59040 (Solvent Green 7; C16H7Na3O10S3; EINECS 228-783-6; CAS 6358-69-6);

(L824) Cl 11920 (Solvent Orange 1; C12H10N2O2; EINECS 218-131-9; CAS 2051-85-6);

(L825) Cl 45396 (Solvent Orange 16; C20H10N2O9; EINECS 246-308-0; CAS 24545-86-6);

(L826) Cl 12100 (Solvent Orange 2; C17H14N2O; EINECS 220-162-8; CAS 2646-17-5);

(L827) Cl 12140 (Solvent Orange 7; C18H16N2O; EINECS 221-490-4; CAS 3118-97-6);

(L828) Cl 12150 (Solvent Red 1; C17H14N2O2; EINECS 214-968-9; CAS 1229-55-6);

(L829) Cl 26100 (Solvent Red 23; C22H16N4O; EINECS 201-638-4; CAS 85-86-9);

(L830) Cl 26105 (Solvent Red 24; C24H20N4O; EINECS -; CAS 85-83-6);

(L831) Cl 12010 (Solvent Red 3; C18H16N2O2; EINECS 229-439-8; CAS 6535-42-8);

(L832) Cl 45380:2 (Solvent Red 43; C20H8Br4O5; EINECS 239-138-3; CAS 15086-94-9);

(L833) Cl 45410 (Solvent Red 48; C20H4Br4Cl4O5; EINECS 236-747-6; CAS 13473-26-2);

(L834) Cl 45370 (Solvent Red 72; C20H10Br2O5; EINECS 209-876-0; CAS 596-03-2);

(L835) Cl 12156 (Solvent Red 80; C18H16N2O3; EINECS 228-778-9; CAS 6358-53-8);

(L836) Cl 60725 (Solvent Violet 13; C21H15NO3; EINECS 201-353-5; CAS 81-48-1);

(L837) Cl 12055 (Solvent Yellow 14; C16H12N2O; EINECS -; CAS 842-07-9);

(L838) Cl 12700 (Solvent Yellow 16; C16H14N4O; EINECS 224-330-1; CAS 4314-14-1);

(L839) Cl 21230 (Solvent Yellow 29; -; EINECS 229-754-0; CAS 6706-82-7);

(L840) Cl 47000 (Solvent Yellow 33; C18H11NO2; EINECS 232-318-2; CAS 8003-22-3);

(L841) Cl 73300 (Vat Red 41; C16H8O2S2; EINECS -; CAS 522-75-8);

(L842) Cl 47005 (-; -; EINECS 305-632-3; CAS 94891-32-4);

(L843) Orasol Yellow 141

(L844) C.I. Pigment Blue 29 (CAS 57455-37-5) (Alternative names: Ultramarine blue; Cl 77007; Ultrablue; Gunjo 8000; gunjo 4000; Gunjo 2000; FRENCH BLUE; ultramarine; LAUNDRY BLUE; gunjo ap 201);

(L845) C.I. Acid Red 33 (CAS 3567-66-6) (Alternative names: D&C Red No. 33, Azo grenadine, Azo fuchsine, Acid fuchsine D, Redusol Z, Azo magenta G, Certicol Red B, Fast acid magenta, Hexalan Red B, Acetyl Red B, Naphthalene Red B, C.I. 17200);

(L846) Benzenemethanaminium, N-ethyl-N-(4-((4-(ethyl((3-sulfophenyl)methyl)amino)phenyl)(2-sulfophenyl)methylene)-2,5-cyclohexadien-1-ylidene)-3-sulfo-, hydroxide, inner salt, disodium salt (CAS 3844-45-9) (Alternative names: FD&C Blue No. 1, Acid Blue 9, D&C Blue No. 4, Alzen Food Blue No. 1, Atracid Blue FG, Erioglaucine, Eriosky blue, Patent Blue AR, Xylene Blue VSG, C.I. 42090);

(L847) 1H-Pyrazole-3-carboxylic acid, 4,5-dihydro-5-oxo-1-(4-sulfophenyl)-4-((4-sulfophenyl)azo)-, trisodium salt (CAS 1934-21-0) (Alternative names: FD&C Yellow No. 5, Acid Yellow 23, Tartrazin)

(L848) Orasol Orange 251 (CAS 85029-59-0) [Alternative name: Amines, C10-14-branched and linear alkyl, [2,4-dihydro-4-[(2-hydroxy-5-nitrophenyl)azo]-5-methyl-2-phenyl-3H-pyrazol-3-onato(2-)][2-[(4,5-dihydro-3-methyl-5-oxo-1-phenyl-1H-pyrazol-4-yl)azo]benzoato(2-)]chromate(1-)]

[0087] Generally, the colorant(s) (L2) can be contained in varying amounts in the composition (Q5). Preferably, the amount of (L2) is not more than 30 wt.% (wt.% stands for "percent by weight"), more preferably not more than 15 wt.%, most preferably not more than 10 wt.%, most particularly preferably not more than 5 wt.%, particularly not more than 2 wt.%, for example not more than 1.1 wt.%, based on the total weight of the composition (Q5). Preferably, the amount of (L2) is at least 0.01 wt.%, more preferably at least 0.1 wt.%, most preferably at least 0.2 wt.%, most particularly preferably at least 0.4 wt.%, particularly at least 0.5 wt.%, for example at least 0.9 wt.%, based on the total weight of the composition (Q5).

[0088] If present, the colorant(s) (L2) can generally be contained in varying amounts in the composition (Q2), (Q3), or (Q4). If present, the amount of (L2) is preferably not more than 30 wt.% (wt.% stands for "percent by weight"), more preferably not more than 15 wt.%, most preferably not more than 10 wt.%, most particularly preferably not more than 5 wt.%, particularly not more than 2 wt.%, for example not more than 1.1 wt.%, based on the total weight of the composition (Q2), (Q3), or (Q4).If present, the amount of (L2) is preferably at least 0.01 wt.%, more preferably at least 0.1 wt.%, most preferably at least 0.2 wt.%, most particularly preferably at least 0.4 wt.%, particularly at least 0.5 wt.%, for example at least 0.9 wt.%, based on the total weight of the composition (Q2), (Q3), or (Q4).

[0089] The compositions (Q2), (Q3), or (Q4) can optionally further comprise
(L2) at least one colorant selected from the group consisting of (L700) to (L848) as described above.

[0090] Preferably, the addition of the colorant(s) (L2) improves the stability and/or the urease inhibiting effect and/or yield increasing effect of the (thio)phosphoric acid triamide(s), most preferably in a synergistic way.

[0091] According to the invention, the composition (Q2) comprises - as one of its essential components - and the compositions (Q3), (Q4), and (Q5) can further comprise - as one of its optional components -
(C) at least one amine selected from the group consisting of

(C1) a polymeric polyamine, and

(C2) an amine containing not more than one amino group and at least three alkoxy- or hydroxy-substituted C₂ to C₁₂ alkyl groups R²¹, wherein at least one of the groups R²¹ is different to the other groups R²¹, and

(C3) an amine containing not more than one amino group and at least two alkoxy- or hydroxy-substituted C₂ to C₁₂ alkyl groups R²², wherein at least one of the groups R²² bears the alkoxy or hydroxy substituent at a secondary or tertiary carbon atom and wherein at least one of the groups R²² is different to the other group(s) R²², and

(C4) an amine containing at least one saturated or unsaturated C₈ to C₄₀ alkyl group R²³, and

(C5) a saturated or unsaturated heterocyclic amine which contains at least one oxygen atom as ring atom and which does not contain a further alkoxy group.

[0092] Generally, the amine(s) (C) can be contained in varying amounts in the composition (Q2). Preferably, the amount of (C) is not more than 90 wt.% (wt.% stands for "percent by weight"), more preferably not more than 65 wt.%, most preferably not more than 48 wt.%, most particularly preferably not more than 37 wt.%, particularly not more than 30 wt.%, for example not more than 24 wt.%, based on the total weight of the composition (Q2). Preferably, the amount of (C) is at least 1 wt.%, more preferably at least 3 wt.%, most preferably at least 6 wt.%, most particularly preferably at least 9 wt.%, particularly at least 14 wt.%, for example at least 18 wt.%, based on the total weight of the composition (Q2).

[0093] If present, the amine(s) (C) can generally be contained in varying amounts in the composition (Q3), (Q4), or (Q5). If present, the amount of (C) is preferably not more than 90 wt.% (wt.% stands for "percent by weight"), more preferably not more than 65 wt.%, most preferably not more than 48 wt.%, most particularly preferably not more than 37 wt.%, particularly not more than 30 wt.%, for example not more than 24 wt.%, based on the total weight of the composition (Q3), (Q4), or (Q5). If present, the amount of (C) is preferably at least 1 wt.%, more preferably at least 3 wt.%, most preferably at least 6 wt.%, most particularly preferably at least 9 wt.%, particularly at least 14 wt.%, for example at least 18 wt.%, based on the total weight of the composition (Q3), (Q4), or (Q5).

[0094] In another embodiment, if present, the amount of polymeric polyamine (L572), polyalkyleneimine (L568), or polyethyleneimine (L569) is preferably not more than 35 wt.%, more preferably not more than 24 wt.%, most preferably not more than 17 wt.%, most particularly preferably not more than 12 wt.%, particularly not more than 9 wt.%, for example not more than 7 wt.%, based on the total weight of the composition (Q3), (Q4), or (Q5). If present, the amount of polymeric polyamine (L572), polyalkyleneimine (L568), or polyethyleneimine (L569) is preferably at least 0.2 wt.%, more preferably at least 1 wt.%, most preferably at least 2.5 wt.%, most particularly preferably at least 4 wt.%, particularly at least 5 wt.%, for example at least 5.5 wt.%, based on the total weight of the composition (Q3), (Q4), or (Q5).

[0095] According to one embodiment, (C) is (C1) a polymeric polyamine.

[0096] Generally, (C1) can be any polymeric polyamine, and is preferably a polyalkyleneimine or polyvinylamine, more preferably a

(L568) polyalkyleneimine,
and (C1) is most preferably

(L569) polyethyleneimine,

(L570) polypropyleneimine, or

(L571) polybutyleneimine,

and is particularly a polyethyleneimine.

[0097] According to one embodiment, (C1) is preferably any polymeric polyamine comprising ethyleneimine (-CH2CH2NH-) as monomeric units, including homo- or copolymers and any copolymers of ethyleneimine, and is preferably a homo- or copolymer of ethyleneimine. Copolymers can be alternating, periodic, statistical or block copolymers.

[0098] Generally, (C1) can be of any polymer structure, for example a linear polymer, a ring polymer, a cross-linked polymer, a branched polymer, a star polymer, a comb polymer, a brush polymer, a dendronized polymer, or a dendrimer etc. According to one embodiment, (C1) is an essentially linear polymer, and is preferably a linear polymer.

[0099] Polyethyleneimines which may be used are polyethyleneimine homo- or copolymers which may be present in uncrosslinked or crosslinked form. The polyethyleneimine homo- or copolymers can be prepared by known processes, as described, for example, in Römpps (Chemie Lexikon, 8th edition, 1992, pages 3532-3533), or in Ullmanns Enzyklopädie der Technischen Chemie, 4th edition, 1974, vol. 8, pages 212-213. and the literature stated there. They have a molecular weight in the range from about 200 to 1 000 000 g/mol. Corresponding commercial products are for example available under the name Lupasol® from BASF SE.

[0100] According to one embodiment of the invention, the polyethyleneimine (C1) is preferably a polyethylenimine having a degree of branching in the range of from 0.1 to 0.95 (also referred to as "highly branched polyethyleneimine"), and more preferably a polyethylenimine having a degree of branching in the range of from 0.25 to 0.90, more preferably a polyethylenimine having a degree of branching in the range of from 0.30 to 0.80, und most preferably a polyethylenimine having a degree of branching in the range of 0.50 to 0.80.

[0101] Highly branched polyethyleneimines are characterized by its high degree of branching, which can be determined for example via ¹³C-NMR spectroscopy, preferably in D₂O, and is defined as follows:

D (dendritic) equals the percentage of tertiary amino groups, L (linear) equals the percentage of secondary amino groups, and T (terminal) equals the percentage of primary amino groups.

[0102] Generally, the polymeric polyamine (C1) can have different weight average molecular weights. The weight average molecular weight of (C1) is preferably at least 200, more preferably at least 400, most preferably at least 550, particularly at least 650, for example at least 750. The weight average molecular weight of (C1) is preferably not more than 10,000, more preferably not more than 4,000, most preferably not more than 1,900, particularly not more than 1,500, for example not more than 1,350. The weight average molecular weight can be determined by standard gel permeation chromatography (GPC) known to the person skilled in the art.

[0103] According to another embodiment, (C) is
(C2) an amine containing not more than one amino group and at least three alkoxy- or hydroxy-substituted C₂ to C₁₂ alkyl groups R²¹, wherein at least one of the groups R²¹ is different to the other groups R²¹.

[0104] A number of groups R²¹ within (C2) is at least 3, preferably 3 to 5, more preferably 3 to 4, and most preferably 3.

[0105] The number of carbon atoms in each group R²¹ within (C2) is 2 to 12, preferably 2 to 9, more preferably 2 to 7, most preferably 2 to 5, particularly preferably 2 to 4, particularly 2 to 3, for example 3, wherein said number of carbon atoms does not include carbon atoms in any alkoxy groups or any other substituents of R²¹.

[0106] The groups R²¹ within (C2) are alkoxy- or hydroxy-substituted, preferably hydroxy-substituted.

[0107] For one amine (C2), among the at least three groups R²¹, at least one of the groups R²¹ is different to the other groups R²¹, preferably one of the groups R²¹ is different to the other groups R²¹.

[0108] Preferably at least one of the groups R²¹, more preferably at least two of the groups R²¹, most preferably at least three of the groups R²¹, particularly all groups R²¹ is or are covalently bound to the amino group of the amine (C2).

[0109] According to another preferred embodiment, (C2) is

(L185) an amine containing not more than one amino group and at least three hydroxy-substituted C₂ to C₈ - or preferably C₂ to C₅ - alkyl groups R²¹, wherein at least one of the groups R²¹ is different to the other groups R²¹,
and (C2) is preferably

(L186) an amine containing not more than one amino group and at least three hydroxy-substituted C₂ to C₃ alkyl groups R²¹, wherein at least one of the groups R²¹ is different to the other groups R²¹,
and (C2) is more preferably

(L187) an amine containing not more than one amino group and three hydroxy-substituted C₂ to C₃ alkyl groups R²¹ which are covalently bound to the amino group, wherein one of the groups R²¹ is different to the other groups R²¹,
and (C2) is for example an amine selected from the group consisting of

(L188) N,N-Bis(2-hydroxyethyl)-isopropanolamine (DEIPA), and

(L189) 1,1'-((2-Hydroxyethyl)imino)dipropan-2-ol.

[0110] According to another preferred embodiment, (C2) is
(L190) an amine N(R²¹)₃ wherein
R²¹ is a an alkoxy- or hydroxy-substituted - preferably a hydroxyl-substituted - C₂ to C₁₂ - preferably a C₂ to C₇, more preferably a C₂ to C₃ - alkyl group and wherein one of the groups R²¹ is different to the other group R²¹.
According to another preferred embodiment, (C2) is
(L191) an amine N(R²¹)₃ wherein
R²¹ is a an alkoxy- or hydroxy-substituted - preferably a hydroxyl-substituted - C₂ to C₁₂ - preferably a C₂ to C₇, more preferably a C₂ to C₃ - alkyl group and wherein one of the groups R²¹ is different to the other group R²¹ and wherein at least one of the groups R²¹ bears the alkoxy or hydroxy substituent at a secondary or tertiary carbon atom.

[0111] According to another embodiment, (C) is
(C3) an amine containing not more than one amino group and at least two alkoxy- or hydroxy-substituted C₂ to C₁₂ alkyl groups R²², wherein at least one of the groups R²² bears the alkoxy or hydroxy substituent at a secondary or tertiary carbon atom and wherein at least one of the groups R²² is different to the other group(s) R²².

[0112] A number of groups R²² within (C3) is at least 2, preferably 2 to 5, more preferably 2 to 4, and most preferably 2 to 3, for example 2.

[0113] The number of carbon atoms in each group R²² within (C3) is 2 to 12, preferably 2 to 9, more preferably 2 to 7, most preferably 2 to 5, particularly preferably 2 to 4, particularly 2 to 3, for example 3, wherein said number of carbon atoms does not include carbon atoms in any alkoxy groups or any other substituents of R²².

[0114] The groups R²² within (C3) are alkoxy- or hydroxy-substituted, preferably hydroxy-substituted. For one amine (C3), among the at least two groups R²², at least one of the groups R²² is different to the other group(s) R²², preferably one of the groups R²² is different to the other group(s) R²².

[0115] Preferably at least one of the groups R²², more preferably at least two of the groups R²², most preferably all groups R²² is or are covalently bound to the amino group of the amine (C3).

[0116] Preferably at least one of the groups R²², more preferably one of the groups R²² bears the alkoxy or hydroxy substituent at a secondary or tertiary carbon atom, particularly at a secondary carbon atom.

[0117] According to another preferred embodiment, (C3) is

(L192) an amine containing not more than one amino group and at least two hydroxy-substituted C₂ to C₇ alkyl groups R²², wherein at least one of the groups R²² bears the hydroxy substituent at a secondary or tertiary carbon atom and wherein at least one of the groups R²² is different to the other group(s) R²²,
and (C3) is more preferably

(L193) an amine containing not more than one amino group and at least two hydroxy-substituted C₂ to C₄ alkyl groups R²², wherein at least one of the groups R²² bears the hydroxy substituent at a secondary carbon atom and wherein at least one of the groups R²² is different to the other group(s) R²²,
and (C3) is most preferably

(L194) an amine containing not more than one amino group and two hydroxy-substituted C₂ to C₃ alkyl groups R²² which are covalently bound to the amino group of the amine (C3),
wherein at least one of the groups R²² bears the hydroxy substituent at a secondary carbon atom and wherein one of the groups R²² is different to the other group R²²,
and (C2) is for example an amine selected from the group consisting of

(L195) 1-((2-hydroxyethyl)amino)propan-2-ol, and

(L196) N-Methyl-N-hydroxyethyl-isopropanolamine.

[0118] According to another preferred embodiment, (C3) is
(L197) an amine R²⁴N(R²²)₂ wherein
R²⁴ is H or a C₁ to C₁₂ - preferably a C₁ to C₇, more preferably a C₁ to C₃ - alkyl group and
R²² is an alkoxy- or hydroxy-substituted - preferably a hydroxyl-substituted - C₂ to C₁₂ - preferably a C₂ to C₇, more preferably a C₂ to C₃ - alkyl group and wherein at least one of the groups R²² bears the hydroxy substituent at a secondary carbon atom and wherein one of the groups R²² is different to the other group R²².

[0119] According to another embodiment, (C) is
(C4) an amine containing at least one saturated or unsaturated C₈ to C₄₀ alkyl group R²³.

[0120] The number of carbon atoms in each group R²³ within (C4) is 8 to 40, preferably 8 to 32, more preferably 8 to 24, most preferably 8 to 19, particularly preferably 8 to 16.

[0121] The group R²³ within (C4) is saturated or unsaturated, preferably unsaturated.

[0122] According to another preferred embodiment, (C4) contains at least one alkoxy or hydroxy group, more preferably at least one alkoxy and at least one hydroxy groups, most preferably at least two alkoxy and at least one hydroxyl group, particularly (C4) is
(L198) an amine containing at least one saturated or unsaturated C₈ to C₄₀ alkyl group R²³ and containing at least four alkoxy and at least one hydroxyl group.

[0123] For example, (C4) is an amine selected from the group consisting of:

(L199) ethoxylated (2) cocoalkylamine,

(L200) ethoxylated (5) cocoalkylamine,

(L201) ethoxylated (15) cocoalkylamine,

(L202) ethoxylated (2) oleylamine,

(L203) lauryl-dimethylamine,

(L204) oleyl-dimethylamine,

(L205) 2-propylheptylamine ethoxylate (5 EO),

(L206) 2-propylheptylamine ethoxylate (10 EO), and

(L207) 2-propylheptylamine ethoxylate (20 EO).

[0124] According to another embodiment, (C) is
(C5) a saturated or unsaturated heterocyclic amine which contains at least one oxygen atom as ring atom and which does not contain a further alkoxy group.

[0125] The term "heterocyclic amine" stands for a heterocyclic compound in which at least one ring atom of the heterocyclic ring is a nitrogen atom.

[0126] The heterocyclic amine (C5) is saturated or unsaturated, preferably saturated.

[0127] The heterocyclic amine (C5) contains preferably a 5-, 6- or 7-membered heterocyclic ring, more preferably a 5- or 6-membered ring, most preferably a 6-membered ring.

[0128] The heterocyclic amine (C5) contains at least one, more preferably 1 to 3, most preferably 1 to 2, particularly one oxygen atom(s) as ring atom(s) of the heterocyclic ring.

[0129] The heterocyclic amine (C5) is preferably

(L208) a morpholine or morpholine derivative,
and (C5) is more preferably

(L209) N-alkyl morpholine,
and (C5) is most preferably N-methyl, N-ethyl, N-propyl, or N-butyl morpholine, for example is (L210) N-methyl morpholine.

[0130] According to the invention, the composition (Q3) comprises - as one of its essential components - and the composition (Q2), (Q4) or (Q5) can further comprise - as one of its optional components - (D) at least one amide according to the general formula (VI)

         R³¹CO-NR³²R³³

wherein

R³¹CO

is an acyl radical having 1 to 22 carbon atoms;

R³²

is H or alkyl, and

R³³

is H or alkyl, or

R³² and R³³

together with the nitrogen atom linking them define a 5- or 6-membered saturated or unsaturated heterocyclic radical, which optionally comprises 1 or 2 further heteroatoms selected from the group consisting of nitrogen, oxygen, and sulfur.

[0131] Generally, the amide(s) (D) can be contained in varying amounts in the composition (Q3). Preferably, the amount of (D) is not more than 90 wt.% (wt.% stands for "percent by weight"), more preferably not more than 65 wt.%, most preferably not more than 45 wt.%, most particularly preferably not more than 30 wt.%, particularly not more than 22 wt.%, for example not more than 16 wt.%, based on the total weight of the composition (Q3). Preferably, the amount of (D) is at least 1 wt.%, more preferably at least 3 wt.%, most preferably at least 6 wt.%, most particularly preferably at least 9 wt.%, particularly at least 12 wt.%, for example at least 15 wt.%, based on the total weight of the composition (Q3).

[0132] If present, the amide (D) can generally be contained in varying amounts in the composition (Q2), (Q4), or (Q5). If present, the amount of (D) is preferably not more than 90 wt.% (wt.% stands for "percent by weight"), more preferably not more than 65 wt.%, most preferably not more than 45 wt.%, most particularly preferably not more than 30 wt.%, particularly not more than 22 wt.%, for example not more than 16 wt.%, based on the total weight of the composition (Q2), (Q4), or (Q5). If present, the amount of (D) is preferably at least 1 wt.%, more preferably at least 3 wt.%, most preferably at least 6 wt.%, most particularly preferably at least 9 wt.%, particularly at least 12 wt.%, for example at least 15 wt.%, based on the total weight of the composition (Q2), (Q4), or (Q5).

[0133] In the general formula (VI) of (D) R³² is H or alkyl, preferably H or C₁ to C₄₀ alkyl, more preferably H or C₁ to C₂₀ alkyl, most preferably H or C₁ to C₁₀ alkyl, particularly preferably H or C₁ to C₄ alkyl, most particularly preferably C₁ to C₄ alkyl, particularly C₁ to C₂ alkyl, for example methyl.

[0134] In the general formula (VI) of (D) R³³ is H or alkyl, preferably H or C₁ to C₄₀ alkyl, more preferably H or C₁ to C₂₀ alkyl, most preferably H or C₁ to C₁₀ alkyl, particularly preferably H or C₁ to C₄ alkyl, most particularly preferably C₁ to C₄ alkyl, particularly C₁ to C₂ alkyl, for example methyl.

[0135] According to one preferred embodiment, in the general formula (VI) of (D) R³² is H or C₁ to C₄ alkyl, and R³³ is H or C₁ to C₄ alkyl, more preferably, R³² is C₁ to C₄ alkyl, and R³³ is C₁ to C₄ alkyl, most preferably, R³² is C₁ to C₂ alkyl, and R³³ is C₁ to C₂ alkyl.

[0136] According to another preferred embodiment (D1PE), in the general formula (VI) of (D) R³¹CO is a hydroxysubstituted acyl radical having 1 to 22 carbon atoms, and more preferably, R³¹CO is a hydroxysubstituted acyl radical having 1 to 22 carbon atoms, and R³² is alkyl, and R³³ is alkyl, and most preferably, R³¹CO is a hydroxysubstituted acyl radical having 1 to 7 carbon atoms, and R³² is C₁ to C₄ alkyl, and R³³ is C₁ to C₄ alkyl.

[0137] According to another preferred embodiment, the amide (D) is

(L401) a N,N-dialkyl amide based on lactic acid, citric acid, tartaric acid, ricinoleic acid, 12-hydroxy stearic acid, or their mixtures,
and the amide (D) is preferably

(L402) a N,N-dialkyl amide based on lactic acid, citric acid, tartaric acid, or their mixtures,
and the amide (D) is most preferably

(L403) a N,N-dimethyl amide based on lactic acid, citric acid, tartaric acid,
and the amide (D) is particularly

(L404) a lactic acid N,N-dimethylamide (=N,N-dimethyllactamide).

[0138] According to another preferred embodiment (D2PE), in the general formula (VI) of (D) R³¹CO is an acyl radical having 6 to 12 carbon atoms, more preferably, R³¹CO is an acyl radical having 8 to 10 carbon atoms.

[0139] According to another preferred embodiment, in the general formula (VI) of (D) R³¹CO does not contain a hydroxy group, and more preferably, R³¹CO does not contain a hydroxy group and is an acyl radical having 6 to 12 carbon atoms, and most preferably, R³¹CO does not contain a hydroxy group and is an acyl radical having 8 to 10 carbon atoms. For example, the amide (D) is selected from the group consisting of

(L405) N,N-dimethyloctanamide,

(L406) N,N-dimethylnonanamide, and

(L407) N,N-dimethyldecanamide.

[0140] According to another preferred embodiment (D3PE), in the general formula (VI) of (D) R³¹CO is an acyl radical having 1 to 3 carbon atoms, more preferably, R³¹CO is an acyl radical having 1 to 2 carbon atoms.

[0141] According to another preferred embodiment, in the general formula (VI) of (D) R³² and R³³ together with the nitrogen atom linking them define a 5- or 6-membered saturated or unsaturated heterocyclic radical which optionally comprises 1 or 2 further heteroatoms selected from the group consisting of nitrogen, oxygen, and sulfur, and more preferably, R³² and R³³ together with the nitrogen atom linking them define a 6-membered saturated or unsaturated heterocyclic radical which optionally comprises one further heteroatom selected from the group consisting of nitrogen, oxygen, and sulfur, most preferably R³² and R³³ together with the nitrogen atom linking them define a 6-membered saturated heterocyclic radical which comprises one further oxygen heteroatom, particularly R³² and R³³ together with the nitrogen atom linking them define a morpholinyl radical. For example, the amide (D) is

(L408) N-acylmorpholine (alternative term: N-alkylcarbonyl-morpholine),

(L409) N-acetylmorpholine, or

(L410) N-formylmorpholine.

[0142] According to another preferred embodiment (D4PE), in the general formula (VI) of (D) R³² and R³³ together with the nitrogen atom linking them define a 5-membered saturated or unsaturated heterocyclic radical which optionally comprises 1 or 2 further heteroatoms selected from the group consisting of nitrogen, oxygen, and sulfur, and more preferably, R³² and R³³ together with the nitrogen atom linking them define a 5-membered saturated heterocyclic radical which optionally comprises one further nitrogen heteroatoms, most preferably R³² and R³³ together with the nitrogen atom linking them define a 5-membered saturated heterocyclic radical which comprises one further nitrogen heteroatom which is covalently bound to the carbon atom of the carbonyl group of R³¹CO, particularly R³² and R³³ together with the nitrogen atom linking them define a imidazolidinonyl radical. For example, the amide (D) is
(L411) 1,3-Dimethyl-2-imidazolidinone (also referred to as dimethylethylenurea).

[0143] According to another preferred embodiment (D5PE), in the general formula (VI) of (D) R³² is an acyloxy substituted alkyl group, more preferably, R³¹CO is an acyl radical having 1 to 4 carbon atoms, and R³² is an acyloxy substituted alkyl group, most preferably, R³¹CO is an acyl radical having 1 to 4 carbon atoms, R³² is an acyloxy substituted alkyl group and R³³ is C₁ to C₄ alkyl. For example, the amide (D) is
(L412) N-[2-(acetyloxy)ethyl]-N-methyl acetamide.

[0144] The composition (Q2), (Q3), (Q4), or (Q5) can further optionally comprise (E) an alcohol comprising at least two hydroxy groups which are not dissociable in the aqueous medium. The alcohol (E) is different from the components (A), (L1), (L2), (C) and (D).

[0145] "Not dissociable" means that the pK_a value (logarithmic measure of the acid dissociation constant) for the reaction alcohol (D) → deprotonated alcohol (D) + H⁺ of the hydroxy group in the neutral aqueous phase is more than 9.9, more preferably more than 11, most preferably more than 12, particularly preferably more than 13, for example more than 14 as measured in de-ionized water at 25°C and atmospheric pressure. For example, propane-1,2-diol (alpha-propylene glycol) has a pK_a value of 14.9 as measured in de-ionized water at 25°C and atmospheric pressure.

[0146] If present, the alcohol (E) is preferably used as solvent in the compositions (Q2), (Q3), (Q4), or (Q5).

[0147] Preferably, the alcohol (E) is a diol, triol, tetraol, pentaol, hexaol, heptaol, octaol, nonaol, decaol, or a polyol. More preferably, (E) is a diol, triol, tetraol, pentaol, or hexaol. Most preferably, (E) is a diol. Particularly most preferably, the alcohol (E) is
(L421) ethanediol (ethylene glycol), propanediol (propylene glycol), or butanediol (butylene glycol).
Particularly, (E) is propanediol (propylene glycol). For example, (E) is
(L422) propane-1,2-diol (alpha-propylene glycol; CAS 57-55-6).
According to another preferred embodiment, the alcohol (E) is
(L423) diethylene glycol.
According to another preferred embodiment, the alcohol (E) is
(L424) 3-Methoxy-3-methyl-1-butanol (CAS 56539-66-3).

[0148] The alcohol (E) is preferably an alcohol having 2 to 50 carbon atoms, more preferably an alcohol having 2 to 20 carbon atoms, most preferably an alcohol having 2 to 11 carbon atoms, particularly preferably an alcohol having 2 to 7 carbon atoms, in particular an alcohol having 2 to 4 carbon atoms, for example an alcohol having 3 carbon atoms.

[0149] If present, the alcohol (E) can be contained in varying amounts in the composition (Q2), (Q3), (Q4), or (Q5). If present, the amount of (E) is preferably not more than 99 wt.% (wt.% stands for "percent by weight"), more preferably not more than 93 wt.%, most preferably not more than 87 wt.%, most particularly preferably not more than 80 wt.%, particularly not more than 75 wt.%, for example not more than 70 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5). If present, the amount of (E) is at least 13 wt.%, more preferably at least 20 wt.%, most preferably at least 35 wt.%, most particularly preferably at least 45 wt.%, particularly at least 55 wt.%, for example at least 60 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5).

[0150] According to another embodiment, the amount of (E) is preferably not more than 78 wt.%, more preferably not more than 67 wt.%, most preferably not more than 61 wt.%, most particularly preferably not more than 56 wt.%, particularly not more than 53 wt.%, for example not more than 50 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5). Preferably, the amount of (E) is at least 16 wt.%, more preferably at least 21 wt.%, most preferably at least 26 wt.%, most particularly preferably at least 30 wt.%, particularly at least 37 wt.%, for example at least 40 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5).

[0151] The composition (Q2), (Q3), (Q4), or (Q5) can further optionally comprise (F) a nitrogen-containing fertilizer. The nitrogen-containing fertilizer (F) is different from the components (A), (L1), (L2), (C) and (D).

[0152] The nitrogen-containing fertilizer (F) preferably comprises manure, ammonium sulfate, ammonium nitrate, ammonium chloride, cyanamide, dicyandiamide (DCD), calcium nitrate, or urea-containing fertilizer (F1), more preferably comprises urea-containing fertilizer (F1), most preferably comprises urea, for example is urea.

[0153] The urea-containing fertilizer (F1) is defined as a fertilizer comprising at least one component selected from the group consisting of urea, urea ammonium nitrate (UAN), isobutylidene diurea (IBDU), crotonylidene diurea (CDU) and urea formaldehyde (UF), urea-acetaldehyde, urea-gly-oxal condensates, complex NPK fertilizer with urea as nitrogen source, physical blend of NPK fertilizer with urea as one mixing component.

[0154] In customary commercial fertilizer quality, the urea has a purity of at least 90%, and may for example be in crystalline, granulated, compacted, prilled, ground or liquid form.

[0155] In another preferred embodiment, the urea is coated urea, sulfur-coated urea, polymer-coated urea, fully coated urea, or partly coated urea.

[0156] The combination of the composition (Q2), (Q3), (Q4), or (Q5) and the fertilizer (F) can be done in different ways:

• Incorporation during the fertilizer production process (composition is within the solid fertilizer granules, prills etc.)
• application of the composition after fertilizer production process (composition is on the surface of the solid fertilizer granules, prills etc.)
• Composition mixed with liquid fertilizer (tank mix).

[0157] If present, the fertilizer (F) can be contained in varying amounts in the composition (Q2), (Q3), (Q4), or (Q5). If present, the amount of (F) is preferably not more than 99.99 wt.% (wt.% stands for "percent by weight"), more preferably not more than 99.9 wt.%, most preferably not more than 99.5 wt.%, most particularly preferably not more than 99 wt.%, particularly not more than 98 wt.%, for example not more than 97 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5). If present, the amount of (F) is preferably at least 96 wt.%, more preferably at least 93 wt.%, most preferably at least 90 wt.%, most particularly preferably at least 82 wt.%, particularly at least 70 wt.%, for example at least 50 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5).

[0158] The properties of the composition (Q2), (Q3), (Q4), or (Q5) - such as stability, storage life, or stability when applied to or coated on nitrogen-containing fertilizers (F) such as urea - may depend on the pH of the corresponding composition. In general, the composition (Q2), (Q3), (Q4), or (Q5) can have any pH value. The pH value of the composition (Q2), (Q3), (Q4), or (Q5) is preferably not more than 14, more preferably not more than 13, most preferably not more than 12, particularly preferably not more than 11.6, particularly most preferably not more than 11.3, particularly not more than 11, for example not more than 10.7. The pH value of the composition (Q2), (Q3), (Q4), or (Q5) is preferably at least 6, more preferably at least 7, most preferably at least 7.5, particularly preferably at least 8.0, particularly most preferably at least 8.2, particularly at least 8.5, for example at least 8.7. The pH value of the composition (Q2), (Q3), (Q4), or (Q5) is preferably in the range of from 6 to 14, more preferably from 7 to 13, most preferably from 7.5 to 12, particularly preferably from 8 to 11.6, particularly most preferably from 8.2 to 11.3, particularly from 8.5 to 11, for example from 8.7 to 10.7.

[0159] The composition (Q2), (Q3), (Q4), or (Q5) can further optionally contain at least one pH adjusting agent (G). The pH adjusting agent (G) is different from the components (A), (L1), (L2), (C) and (D). In general, the pH adjusting agent (G) is a compound which is added to the composition (Q2), (Q3), (Q4), or (Q5) to have its pH value adjusted to the required value. Preferably, the composition (Q2), (Q3), (Q4), or (Q5) contains at least one pH adjusting agent (G). Preferred pH adjusting agents are inorganic acids, carboxylic acids, amine bases, alkali hydroxides, ammonium hydroxides, including tetraalkylammonium hydroxides. Particularly, the pH adjusting agent (G) is nitric acid, sulfuric acid, ammonia, sodium hydroxide, or potassium hydroxide. For example, the pH adjusting agent (G) is potassium hydroxide.

[0160] If present, the pH adjusting agent (G) can be contained in varying amounts in the composition (Q2), (Q3), (Q4), or (Q5). If present, the amount of (G) is preferably not more than 10 wt.%, more preferably not more than 2 wt.%, most preferably not more than 0.5 wt.%, particularly not more than 0.1 wt.%, for example not more than 0.05 wt.%, based on the total weight of the corresponding composition (Q2), (Q3), (Q4), or (Q5). If present, the amount of (G) is preferably at least 0.0005 wt.%, more preferably at least 0.005 wt.%, most preferably at least 0.025 wt.%, particularly at least 0.1 wt.%, for example at least 0.4 wt.%, based on the total weight of the corresponding composition (Q2), (Q3), (Q4), or (Q5).

[0161] The composition (Q2), (Q3), (Q4), or (Q5) can further optionally contain the compound (K) selected from the group consisting of
(K1) an amine selected from the group consisting of

(L211) methyldiethanolamine,

(L212) tetrahydroxypropylethylenediamine,

(L213) trimethylaminoethylethanolamine,

(L214) N,N,N',N'-tetramethyl-1,6-hexanediamine,

(L215) N,N',N"-tris(dimethylaminopropyl)hexahydrotriazine, and

(L216) 2,2'-dimorpholinyldiethyl ether,

(K2) an amine containing not more than one amino group and at least three alkoxy- or hydroxy-substituted C₂ to C₁₂ alkyl groups R⁴¹, wherein all groups R⁴¹ within said amine are identical, and

(K3) an amine containing not more than one amino group and at least two alkoxy- or hydroxy-substituted C₂ to C₁₂ alkyl groups R⁴², wherein at least one of the groups R⁴² bears the alkoxy or hydroxy substituent at a secondary or tertiary carbon atom and wherein all groups R⁴² with said amine are identical.

(K2) or (K3) are preferably

(L217) triethanolamine,

(L218) tripropanolamine,

(L219) diisopropanolamine,

(L220) triisopropanolamine,

(L221) diethanolamine, or

(L222) methyldipropanolamine.

[0162] If present, the compound (K) can generally be contained in varying amounts in the composition (Q2), (Q3), (Q4), or (Q5). If present, the amount of (K) is preferably not more than 40 wt.% (wt.% stands for "percent by weight"), more preferably not more than 30 wt.%, most preferably not more than 25 wt.%, most particularly preferably not more than 20 wt.%, particularly not more than 18 wt.%, for example not more than 15 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5).). If present, the amount of (K) is preferably at least 1 wt.%, more preferably at least 3 wt.%, most preferably at least 5 wt.%, most particularly preferably at least 8 wt.%, particularly at least 11 wt.%, for example at least 14 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5).

[0163] The composition (Q2), (Q3), (Q4), or (Q5) can further optionally contain a solvent or liquid carrier (M). (M) is preferably different from the components (A), (L1), (L2), (C) and (D).

[0164] Suitable solvents and liquid carriers are water and organic solvents, such as mineral oil fractions of medium to high boiling point, e.g. kerosene, diesel oil; oils of vegetable or animal origin; aliphatic, cyclic and aromatic hydrocarbons, e. g. toluene, paraffin, tetrahydronaphthalene, alkylated naphthalenes; alcohols, e.g. ethanol, propanol, butanol, cyclohexanol; glycols; DMSO; ketones, e.g. cyclohexanone; esters, e.g. lactates, carbonates, fatty acid esters, gamma-butyrolactone; fatty acids; phosphonates; amines; amides, e.g. N-methylpyrrolidone, fatty acid dime-thylamides; and mixtures thereof.

[0165] If present, the solvent or liquid carrier (M) can be contained in varying amounts in the composition (Q2), (Q3), (Q4), or (Q5). If present, the amount of (M) is preferably not more than 99 wt.%, more preferably not more than 93 wt.%, most preferably not more than 87 wt.%, particularly preferably not more than 80 wt.%, most particularly preferably not more than 72 wt.%, particularly not more than 62 wt.%, for example not more than 50 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5). If present, the amount of (M) is at least 15 wt.%, more preferably at least 25 wt.%, most preferably at least 35 wt.%, particularly preferably at least 45 wt.%, most particularly preferably at least 55 wt.%, particularly at least 65 wt.%, for example at least 74 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5).

[0166] Preferred solvents or liquid carriers (M) are

(L425) benzyl alcohol;

(L418) DMSO;

(L419) sulfolane (alternative name: tetramethylene sulfone);

(L420) N-Methylpyrrolidone;

(L426) a mixture of propane-1,2-diol (alpha-propylene glycol; CAS 57-55-6) and DMSO;

(L427) a mixture of propane-1,2-diol (alpha-propylene glycol; CAS 57-55-6) and N,N-dimethyl-lactamide;

(L428) a mixture of propane-1,2-diol (alpha-propylene glycol; CAS 57-55-6) and N-formylmorpholine;

(L429) a mixture of benzyl alcohol and DMSO;

(L430) a mixture of benzyl alcohol and N,N-dimethyllactamide; or

(L431) a mixture of benzyl alcohol and N-formylmorpholine.

[0167] If present, the amount of DMSO is preferably not more than 70 wt.%, more preferably not more than 60 wt.%, most preferably not more than 50 wt.%, particularly preferably not more than 40 wt.%, most particularly preferably not more than 30 wt.%, particularly not more than 26 wt.%, for example not more than 22 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5). If present, the amount of DMSO is at least 3 wt.%, more preferably at least 6 wt.%, most preferably at least 9 wt.%, particularly preferably at least 11 wt.%, most particularly preferably at least 13 wt.%, particularly at least 15 wt.%, for example at least 18 wt.%, based on the total weight of the composition (Q2), (Q3), (Q4), or (Q5).

[0168] The composition (Q2), (Q3), (Q4), or (Q5) can further optionally contain components (H) which are selected from the group consisting of auxiliaries, solid carriers, surfactants, adjuvants, thickeners, bactericides, anti-freezing agents, anti-foaming agents, colorants, tackifiers, binders, preservatives, antioxidants, and odorants. The component (H) is different from the components (A), (L1), (L2), (C) and (D).

[0169] Suitable auxiliaries are solid carriers or fillers, surfactants, dispersants, emulsifiers, wetters, adjuvants, solubilizers, penetration enhancers, protective colloids, adhesion agents, thickeners, humectants, repellents, attractants, feeding stimulants, compatibilizers, bactericides, anti-freezing agents, anti-foaming agents, colorants, tackifiers and binders. One of the preferred auxiliaries is Neem oil or an extract of the Neem plant or Neem seed.

[0170] Suitable solid carriers or fillers are mineral earths, e.g. silicates, silica gels, talc, kaolins, limestone, lime, chalk, clays, dolomite, diatomaceous earth, bentonite, calcium sulfate, magnesium sulfate, magnesium oxide; polysaccharides, e.g. cellulose, starch; fertilizers, e.g. ammonium sulfate, ammonium phosphate, ammonium nitrate, ureas; products of vegetable origin, e.g. cereal meal, tree bark meal, wood meal, nutshell meal, and mixtures thereof.

[0171] Suitable surfactants are surface-active compounds, such as anionic, cationic, nonionic and amphoteric surfactants, block polymers, polyelectrolytes, and mixtures thereof. Such surfactants can be used as emusifier, dispersant, solubilizer, wetter, penetration enhancer, protective colloid, or adjuvant. Examples of surfactants are listed in McCutcheon's, Vol.1: Emulsifiers & Detergents, McCutcheon's Directories, Glen Rock, USA, 2008 (International Ed. or North American Ed.).

[0172] Suitable anionic surfactants are alkali, alkaline earth or ammonium salts of sulfonates, sulfates, phosphates, carboxylates, and mixtures thereof. Examples of sulfonates are alkylarylsulfonates, diphenylsulfonates, alpha-olefin sulfonates, lignine sulfonates, sulfonates of fatty acids and oils, sulfonates of ethoxylated alkylphenols, sulfonates of alkoxylated arylphenols, sulfonates of condensed naphthalenes, sulfonates of dodecyl- and tridecylbenzenes, sulfonates of naphthalenes and alkylnaphthalenes, sulfosuccinates or sulfosuccinamates. Examples of sulfates are sulfates of fatty acids and oils, of ethoxylated alkylphenols, of alcohols, of ethoxylated alcohols, or of fatty acid esters. Examples of phosphates are phosphate esters. Examples of carboxylates are alkyl carboxylates, and carboxylated alcohol or alkylphenol ethoxylates.

[0173] Suitable nonionic surfactants are alkoxylates, N-subsituted fatty acid amides, amine oxides, esters, sugar-based surfactants, polymeric surfactants, and mixtures thereof. Examples of alkoxylates are compounds such as alcohols, alkylphenols, amines, amides, arylphenols, fatty acids or fatty acid esters which have been alkoxylated with 1 to 50 equivalents. Ethylene oxide and/or propylene oxide may be employed for the alkoxylation, preferably ethylene oxide. Examples of N-subsititued fatty acid amides are fatty acid glucamides or fatty acid alkanolamides. Examples of esters are fatty acid esters, glycerol esters or monoglycerides. Examples of sugar-based surfactants are sorbitans, ethoxylated sorbitans, sucrose and glucose esters or alkylpolygluco-sides. Examples of polymeric surfactants are home- or copolymers of vinylpyrrolidone, vinylal-cohols, or vinylacetate.

[0174] Suitable cationic surfactants are quaternary surfactants, for example quaternary ammonium compounds with one or two hydrophobic groups, or salts of long-chain primary amines. Suitable amphoteric surfactants are alkylbetains and imidazolines. Suitable block polymers are block polymers of the A-B or A-B-A type comprising blocks of polyethylene oxide and polypropylene oxide, or of the A-B-C type comprising alkanol, polyethylene oxide and polypropylene oxide. Suitable polyelectrolytes are polyacids or polybases. Examples of polyacids are alkali salts of polyacrylic acid or polyacid comb polymers. Examples of polybases are polyvinylamines or polyethyleneamines.

[0175] Suitable adjuvants are compounds, which have a neglectable or even no pesticidal activity themselves, and which improve the biological performance of the compound I on the target. Examples are surfactants, mineral or vegetable oils, and other auxilaries. Further examples are listed by Knowles, Adjuvants and additives, Agrow Reports DS256, T&F Informa UK, 2006, chapter 5.

[0176] Suitable thickeners are polysaccharides (e.g. xanthan gum, carboxymethylcellulose), anorganic clays (organically modified or unmodified), polycarboxylates, and silicates.
Suitable bactericides are bronopol and isothiazolinone derivatives such as alkylisothiazolinones and benzisothiazolinones.

[0177] Suitable anti-freezing agents are ethylene glycol, propylene glycol, urea and glycerin.

[0178] Suitable anti-foaming agents are silicones, long chain alcohols, and salts of fatty acids.

[0179] Suitable colorants (e.g. in red, blue, or green) are pigments of low water solubility and water-soluble dyes. Examples are

• inorganic colorants, such as iron oxide, titan oxide, iron hexacyanoferrate,
• metal-complex dyes such as chromium-complex dyes, for example Orasol Yellow 141,
• organic colorants such as alizarin-, azo- and phthalocyanine colorants.

Preferred colorants are metal-complex dyes, more preferably chromium-complex dyes, for example Orasol Yellow 141.
Suitable tackifiers or binders are polyvinylpyrrolidones, polyvinylacetates, polyvinyl alcohols, polyacrylates, biological or synthetic waxes, and cellulose ethers.
Suitable preservatives include e.g. sodium benzoate, benzoic acid, sorbic acid, and derivatives thereof.

[0180] Suitable antioxidants include sulfites, ascorbic acid, tocopherol, tocopherol acetate, tocotrienol, melatonin, carotene, beta-carotene, ubiquinol, and derivatives thereof. Tocophercol acetate is preferred as antioxidant.

[0181] Suitable odorants include perfume materials which are for example mentioned in US 7 182 537, including allo-ocimene, Allyl cyclohexanepropionate, Allyl heptanoate, trans-Anethole, Benzyl butyrate, Camphene, Cadinene, Carvacrol, cis-3-Hexenyl tiglate, Citronellol, Citronellyl acetate, Citronellyl nitrile, Citronellyl propionate, Cyclohexylethyl acetate, Decyl Aldehyde (Capraldehyde), Dihydromyrcenol, Dihydromyrcenyl acetate, 3,7-Dimethyl-1-octanol, Diphenyloxide, Fenchyl Acetate (1,3,3-Trimethyl-2-norbornanyl acetate), Geranyl acetate, Geranyl formate, Geranyl nitrile, cis-3-Hexenyl isobutyrate, Hexyl Neopentanoate, Hexyl tiglate, alpha-lonone, Ethyl Vanillin L80, Isoeugenol, Methyl cinnamate, Methyl dihydrojasmonate, Methyl beta-naphthyl ketone, Phenoxy ethyl isobutyrate, Vanillin L28, Isobornyl acetate, Isobutyl benzoate, Isononyl acetate, Isononyl alcohol (3,5,5-Trimethyl-1-hexanol), Isopulegyl acetate, Lauraldehyde, d-Limonene, Linalyl acetate, (-)-L-Menthyl acetate, Methyl Chavicol (Estragole), Methyl n-nonyl acetaldehyde, methyl octyl acetaldehyde, beta-Myrcene, Neryl acetate, Nonyl acetate, Nonaldehyde, p-Cymene, alpha-Pinene, beta-Pinene, alpha-Terpinene, gamma-Terpinene, alpha-Terpinyl acetate, Tetrahydrolinalool, Tetrahydromyrcenol, 2-Undecenal, Verdox (o-t-Butylcyclohexyl acetate), Vertenex (4-tert,Butylcyclohexyl acetate). Citronellyl nitrile is preferred as odorant.

[0182] According to one embodiment, individual components of the compositions (Q2), (Q3), (Q4), or (Q5) such as parts of a kit or parts of a binary or ternary mixture may be mixed by the user himself in a spray tank and further auxiliaries may be added, if appropriate.

[0183] If present, the component (H) can be contained in varying amounts in the composition (Q2), (Q3), (Q4), or (Q5). If present, the amount of (H) is preferably not more than 10 wt.%, more preferably not more than 4 wt.%, most preferably not more than 2 wt.%, particularly not more than 1 wt.%, for example not more than 0.5 wt.%, based on the total weight of the corresponding composition (Q2), (Q3), (Q4), or (Q5). If present, the amount of (H) is preferably at least 0.0005 wt.%, more preferably at least 0.005 wt.%, most preferably at least 0.025 wt.%, particularly at least 0.1 wt.%, for example at least 0.4 wt.%, based on the total weight of the corresponding composition (Q2), (Q3), (Q4), or (Q5).

[0184] With respect to the composition (Q2), (Q3), (Q4), or (Q5), the weight ratio of the mixture (A) to the amine (L1) - in case of (Q2), (Q3) or (Q5) only as far as (L1) is present - is preferably between 50:1 and 1:50, more preferably between 10:1 and 1:10, most preferably between 5:1 and 1:5, particularly preferably between 3:1 and 1:3, particularly most preferably between 2.5:1 and 1:2, particularly between 2:1 and 1:1, for example between 1.8:1 to 1.2:1

[0185] With respect to the composition (Q2), (Q3), (Q4), or (Q5), the weight ratio of the mixture (A) to the amine (C) - in case of (Q3), (Q4), or (Q5) only as far as (C) is present - is preferably between 100:1 and 1:20, more preferably between 40:1 and 1:8, most preferably between 30:1 and 1:6, particularly preferably between 20:1 and 1:5, particularly most preferably between 10:1 and 1:2, particularly between 5:1 and 1:1.2, for example between 2:1 to 1:1.

[0186] With respect to the composition (Q2), (Q3), (Q4), or (Q5), the weight ratio of the mixture (A) to the amide (D) - in case of (Q2), (Q4), or (Q5) only as far as (D) is present - is preferably between 50:1 and 1:50, more preferably between 10:1 and 1:10, most preferably between 5:1 and 1:5, particularly preferably between 3:1 and 1:3, particularly most preferably between 2.5:1 and 1:2, particularly between 2:1 and 1:1, for example between 1.8:1 to 1.2:1.

[0187] According to the invention, a process for treating the soil comprising applying the compositions (Q2), (Q3), (Q4), or (Q5) into the soil in-furrow and/or as side-dress and/or as broadcast was found.

[0188] Preferably, said process comprises: applying the compositions (Q2), (Q3), (Q4), or (Q5) by spraying it onto the soil. More preferably, said process are conducted in a way wherein the compositions (Q2), (Q3), (Q4), or (Q5) are - either at the same time (i.e. simultaneously) or with a time difference (i.e. separately) - applied together with at least one nitrogen-containing fertilizer (F) into the soil in-furrow and/or as side-dress and/or as broadcast.

[0189] According to the invention, the compositions (Q2), (Q3), (Q4), or (Q5) can be used as additive or as coating material for nitrogen-containing fertilizers (F), particularly for urea-containing fertilizer (F1), for example for urea. According to one preferred embodiment, the compositions (Q2), (Q3), (Q4), or (Q5) are used as coating material for nitrogen-containing fertilizers (F), particularly for urea-containing fertilizer (F1), for example for urea. The nitrogen-containing fertilizer (F) cam be in crystalline, granulated, compacted, prilled or ground form, and is preferably in granulated from.

[0190] The compositions (Q2), (Q3), (Q4), or (Q5) can be applied to or on nitrogen-containing fertilizers (F) by either mixing the (Q2), (Q3), (Q4), or (Q5), in either liquid or solid form, with the nitrogen-containing fertilizer (F), or incorporating them into (F) by granulation, compacting or prilling, by addition to a corresponding fertilizer mixture or to a mash or melt. Preferably, the compositions (Q2), (Q3), (Q4), or (Q5) are applied to the surface of existing granules, compacts or prills of the nitrogen-containing fertilizer (F) - particularly of the urea-containing fertilizer (F1) - by means of spraying, powder application or impregnating, for example. This can also be done using further auxiliaries such as adhesive promoters or encasing materials. Examples of apparatuses suitable for performing such application include plates, drums, mixers or fluidized-bed apparatus, although application may also take place on conveyor belts or their discharge points or by means of pneumatic conveyors for solids. A concluding treatment with anticaking agents and/or anti-dust agents is likewise possible. The compositions (Q2), (Q3), (Q4), or (Q5) are used in the context of fertilization with nitrogen-containing fertilizer (F), particularly with urea-containing fertilizer (F1). Application takes place preferably to an agriculturally or horticulturally exploited plot. In parallel with the improvement of the utilization of nitrogen in the urea-containing, mineral and organic fertilizers, the use of the compositions (Q2), (Q3), (Q4), or (Q5) has the effect that there is an increase - in some cases considerably - in the yields or production of biomass of crop plants.

[0191] The compositions (Q2), (Q3), (Q4), or (Q5) may be added to organic fertilizers, such as liquid manure, for example, during the actual storage of such fertilizers, in order thus to prevent nitrogen nutrient losses, by virtue of decelerated conversion of the individual forms of nitrogen into gaseous nitrogen compounds, which are therefore volatile, and in order as a result, at the same time, to contribute to a lowering of the ammonia load in animal stables.

[0192] In this context it is immaterial whether the compositions (Q2), (Q3), (Q4), or (Q5) are incorporated, by melting, for example, into the nitrogen-containing fertilizer (F), or else are applied to the fertilizer surface or applied separately from the spreading of the fertilizer, in the form, for example, of a (suspension) concentrate, a solution or a formulation.

[0193] For the below examples, the following abbreviations have been used:

"A" in the table header stands for mixture (A).

"(A1)" = technical mixture (with a 84.27% concentration of NxPT based on the total amount of the technical mixture) containing 23.7% NPPT and 76.3% NBPT, based on the total amount of NxPT within the technical mixture

"AD25 formulation" stands for a composition comprising approx. 12-18 wt.% N,N-dimethyllactamide, approx. 30-35 wt.% benzyl alcohol, approx. 17-23 wt.% polyethyleneimine and approx. 27-33 wt.% (A1).

"i#" stands for the serial number of the composition.

"L#" stands for (L#) as listed above [for example, L101 stands for (L101) = ethylenediamine as listed above]

"(L)i" = first component [except mixture (A)] of the composition

"(L)ii" = second component [except mixture (A)] of the composition

"(L)iii" = third component [except mixture (A)] of the composition

"NBPT" = N-(n-butyl)thiophosphoric acid triamide

"NPPT" = N-(n-propyl)thiophosphoric acid triamide

"NxPT" = Mixture (A) comprising NBPT and NPPT (the content of NxPT is the sum of the content of NBPT and NPPT)

"Y" = Mixture (A) comprising NBPT and/or NPPT

[0194] For the preferred embodiments as listed in Table 1, the following abbreviations are used in addition to the abbreviations listed above:

(C1) = (L572) is a polymeric polyamine;

(C2) = (L25) is an amine containing not more than one amino group and at least three alkoxy- or hydroxy-substituted C₂ to C₁₂ alkyl groups R²¹, wherein at least one of the groups R²¹ is different to the other groups R²¹;

(C3) = (L26) is an amine containing not more than one amino group and at least two alkoxy- or hydroxy-substituted C₂ to C₁₂ alkyl groups R²², wherein at least one of the groups R²² bears the alkoxy or hydroxy substituent at a secondary or tertiary carbon atom and wherein at least one of the groups R²² is different to the other group(s) R²²;

(C4) = (L27) is an amine containing at least one saturated or unsaturated C₈ to C₄₀ alkyl group R²³, and

(C5) = (L28) is a saturated or unsaturated heterocyclic amine which contains at least one oxygen atom as ring atom and which does not contain a further alkoxy group.

(D1) = (L413) is an amide according to the general formula (VI)

         R³¹CO-NR³²R³³

wherein

R³¹CO is a hydroxysubstituted acyl radical having 1 to 22 carbon atoms;

R³² is H or C₁ to C₄ alkyl, and

R³³ is H or C₁ to C₄ alkyl.

(D2) = (L414) is an amide according to the general formula (VI)

         R³¹CO-NR³²R³³

wherein

R³¹CO is a is an acyl radical having 1 to 22 carbon atoms which do not contain a hydroxyl group;

R³² is H or C₁ to C₄ alkyl, and

R³³ is H or C₁ to C₄ alkyl.

(D3) = (L415) is an amide according to the general formula (VI)

         R³¹CO-NR³²R³³

wherein

R³¹CO is an acyl radical having 1 to 22 carbon atoms;

R³² and R³³ together with the nitrogen atom linking them define a 6-membered saturated heterocyclic radical which comprises one further oxygen heteroatom.

(D4) = (L416) is an amide according to the general formula (VI)

         R³¹CO-NR³²R³³

wherein

R³¹CO is an acyl radical having 1 to 22 carbon atoms;

R³² and R³³ together with the nitrogen atom linking them define a 5-membered saturated heterocyclic radical which comprises one further nitrogen heteroatom.

(D5) = (L417) is an amide according to the general formula (VI)

         R³¹CO-NR³²R³³

wherein

R³¹CO is an acyl radical having 1 to 22 carbon atoms;

R³² is an acyloxy substituted alkyl group, and

R³³ is H or alkyl.

[0195] The most preferred composition (Q2), (Q3), or (Q4) is the AD25 formulation comprising approx. 13-17 wt.% N,N-dimethyllactamide, approx. 30-35 wt.% benzyl alcohol, approx. 18-22 wt.% polyethyleneimine and approx. 28-32 wt.% (A1). The most preferred polyethyleneimine is branched polyethyleneimine having a molecular weight of approx. 800 (GPC) and a charge density of approx.. 16 meq/g of dry substance, determined at pH 4.5, and having a ratio primary/secondary/tertiary amino (as determined by 13C-NMR) of 1/0.9/0.5.

[0196] A particularly preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) propylene glycol (L422), and (c) polytriethanolamine (L619).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) propylene glycol (L422), and (c) a polytriethanolamine with a weight average molecular weight in the range of from 1,000 to 10,000 g/mol (L620).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) propylene glycol (L422), and (c) linear polyethyleneimine (L610).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) propylene glycol (L422), and (c) linear polyethyleneimine (L611).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) propylene glycol (L422), and (c) polyethyleneimine with 0.75 to 0.99 EO (ethylene oxide) per NH unit (L613).

[0197] A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) propylene glycol (L422), and (c) polyethyleneimine with 0.75 to 0.99 PO (propylene oxide) per NH unit (L614).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) propylene glycol (L422), and (c) a polymeric polyamine (L572).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) propylene glycol (L422), and (c) polyalkyleneimine (L568).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) propylene glycol (L422), and (c) polyethyleneimine (L569).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) propylene glycol (L422), and (c) homo- or copolymer of lysine (L587).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) propylene glycol (L422), and (c) a polylysin prepared by the above-specified process (L587P1) (L607).

[0198] A particularly preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) DMSO (L418), and (c) polytriethanolamine (L619).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) DMSO (L418), and (c) a polytriethanolamine with a weight average molecular weight in the range of from 1,000 to 10,000 g/mol (L620).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) DMSO (L418), and (c) linear polyethyleneimine (L610).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) DMSO (L418), and (c) linear polyethyleneimine (L611).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) DMSO (L418), and (c) polyethyleneimine with 0.75 to 0.99 EO (ethylene oxide) per NH unit (L613).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) DMSO (L418), and (c) polyethyleneimine with 0.75 to 0.99 PO (propylene oxide) per NH unit (L614).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) DMSO (L418), and (c) polymeric polyamine (L572).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) DMSO (L418), and (c) polyalkyleneimine (L568).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) DMSO (L418), and (c) polyethyleneimine (L569).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) DMSO (L418), and (c) homo- or copolymer of lysine (L587).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) DMSO (L418), and (c) a polylysin prepared by the above-specified process (L587P1) (L607).

[0199] A particularly preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) N,N-dimethyllactamide (L427), and (c) polytriethanolamine (L619).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) N,N-dimethyllactamide (L427), and (c) a polytriethanolamine with a weight average molecular weight in the range of from 1,000 to 10,000 g/mol (L620).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) N,N-dimethyllactamide (L427), and (c) linear polyethyleneimine (L610).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) N,N-dimethyllactamide (L427), and (c) linear polyethyleneimine (L611).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) N,N-dimethyllactamide (L427), and (c) polyethyleneimine with 0.75 to 0.99 EO (ethylene oxide) per NH unit (L613).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) N,N-dimethyllactamide (L427), and (c) polyethyleneimine with 0.75 to 0.99 PO (propylene oxide) per NH unit (L614).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) N,N-dimethyllactamide (L427), and (c) polymeric polyamine (L572).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) N,N-dimethyllactamide (L427), and (c) polyalkyleneimine (L568).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) N,N-dimethyllactamide (L427), and (c) polyethyleneimine (L569).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) N,N-dimethyllactamide (L427), and (c) homo- or copolymer of lysine (L587).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) N,N-dimethyllactamide (L427), and (c) a polylysin prepared by the above-specified process (L587P1) (L607).

[0200] A particularly preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and N,N-dimethyllactamide (L427), and (c) polytriethanolamine (L619).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and N,N-dimethyllactamide (L427), and (c) a polytriethanolamine with a weight average molecular weight in the range of from 1,000 to 10,000 g/mol (L620).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and N,N-dimethyllactamide (L427), and (c) linear polyethyleneimine (L610).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and N,N-dimethyllactamide (L427), and (c) linear polyethyleneimine (L611).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and N,N-dimethyllactamide (L427), and (c) polyethyleneimine with 0.75 to 0.99 EO (ethylene oxide) per NH unit (L613).

[0201] A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and N,N-dimethyllactamide (L427), and (c) polyethyleneimine with 0.75 to 0.99 PO (propylene oxide) per NH unit (L614).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and N,N-dimethyllactamide (L427), and (c) polymeric polyamine (L572).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and N,N-dimethyllactamide (L427), and (c) polyalkyleneimine (L568).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and N,N-dimethyllactamide (L427), and (c) polyethyleneimine (L569).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and N,N-dimethyllactamide (L427), and (c) homo- or copolymer of lysine (L587).
A further preferred composition (Q2), (Q3) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and N,N-dimethyllactamide (L427), and (c) a polylysin prepared by the above-specified process (L587P1) (L607).

[0202] A particularly preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and DMSO (L426), and (c) polytriethanolamine (L619).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and DMSO (L426), and (c) a polytriethanolamine with a weight average molecular weight in the range of from 1,000 to 10,000 g/mol (L620).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and DMSO (L426), and (c) linear polyethyleneimine (L610).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and DMSO (L426), and (c) linear polyethyleneimine (L611).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and DMSO (L426), and (c) polyethyleneimine with 0.75 to 0.99 EO (ethylene oxide) per NH unit (L613).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and DMSO (L426), and (c) polyethyleneimine with 0.75 to 0.99 PO (propylene oxide) per NH unit (L614).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and DMSO (L426), and (c) polymeric polyamine (L572).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and DMSO (L426), and (c) polyalkyleneimine (L568).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and DMSO (L426), and (c) polyethyleneimine (L569). A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and DMSO (L426), and (c) homo- or copolymer of lysine (L587).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and DMSO (L426), and (c) a polylysin prepared by the above-specified process (L587P1) (L607).

[0203] A particularly preferred composition (Q2) or (Q4) is a composition comprising (a) 10-40 wt.%, preferably 20-30 wt.% NBPT and/or NPPT, (b) a mixture of 30-65 wt.%, preferably 40-55 wt.% propylene glycol and of 10-30 wt.%, preferably 15-25 wt.% DMSO (L426), and (c) 1-15 wt.%, preferably 4-11 wt.% polytriethanolamine (L619).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) 10-40 wt.%, preferably 20-30 wt.% NBPT and/or NPPT, (b) a mixture of 30-65 wt.%, preferably 40-55 wt.% propylene glycol and of 10-30 wt.%, preferably 15-25 wt.% DMSO (L426), and (c) 1-15 wt.%, preferably 4-11 wt.% of a polytriethanolamine with a weight average molecular weight in the range of from 1,000 to 10,000 g/mol (L620).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) 10-40 wt.%, preferably 20-30 wt.% NBPT and/or NPPT, (b) a mixture of 30-65 wt.%, preferably 40-55 wt.% propylene glycol and of 10-30 wt.%, preferably 15-25 wt.% DMSO (L426), and (c) 1-15 wt.%, preferably 4-11 wt.% linear polyethyleneimine (L610).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) 10-40 wt.%, preferably 20-30 wt.% NBPT and/or NPPT, (b) a mixture of 30-65 wt.%, preferably 40-55 wt.% propylene glycol and of 10-30 wt.%, preferably 15-25 wt.% DMSO (L426), and (c) 1-15 wt.%, preferably 4-11 wt.% linear polyethyleneimine (L611).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) 10-40 wt.%, preferably 20-30 wt.% NBPT and/or NPPT, (b) a mixture of 30-65 wt.%, preferably 40-55 wt.% propylene glycol and of 10-30 wt.%, preferably 15-25 wt.% DMSO (L426), and (c) 1-15 wt.%, preferably 4-11 wt.% polyethyleneimine with 0.75 to 0.99 EO (ethylene oxide) per NH unit (L613).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) 10-40 wt.%, preferably 20-30 wt.% NBPT and/or NPPT, (b) a mixture of 30-65 wt.%, preferably 40-55 wt.% propylene glycol and of 10-30 wt.%, preferably 15-25 wt.% DMSO (L426), and (c) 1-15 wt.%, preferably 4-11 wt.% polyethyleneimine with 0.75 to 0.99 PO (propylene oxide) per NH unit (L614).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) 10-40 wt.%, preferably 20-30 wt.% NBPT and/or NPPT, (b) a mixture of 30-65 wt.%, preferably 40-55 wt.% propylene glycol and of 10-30 wt.%, preferably 15-25 wt.% DMSO (L426), and (c) 1-15 wt.%, preferably 4-11 wt.% polymeric polyamine (L572).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) 10-40 wt.%, preferably 20-30 wt.% NBPT and/or NPPT, (b) a mixture of 30-65 wt.%, preferably 40-55 wt.% propylene glycol and of 10-30 wt.%, preferably 15-25 wt.% DMSO (L426), and (c) 1-15 wt.%, preferably 4-11 wt.% polyalkyleneimine (L568).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) 10-40 wt.%, preferably 20-30 wt.% NBPT and/or NPPT, (b) a mixture of 30-65 wt.%, preferably 40-55 wt.% propylene glycol and of 10-30 wt.%, preferably 15-25 wt.% DMSO (L426), and (c) 1-15 wt.%, preferably 4-11 wt.% polyethyleneimine (L569).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) 10-40 wt.%, preferably 20-30 wt.% NBPT and/or NPPT, (b) a mixture of 30-65 wt.%, preferably 40-55 wt.% propylene glycol and of 10-30 wt.%, preferably 15-25 wt.% DMSO (L426), and (c) 1-15 wt.%, preferably 4-11 wt.% homo- or copolymer of lysine (L587).
A further preferred composition (Q2) or (Q4) is a composition comprising (a) 10-40 wt.%, preferably 20-30 wt.% NBPT and/or NPPT, (b) a mixture of 30-65 wt.%, preferably 40-55 wt.% propylene glycol and of 10-30 wt.%, preferably 15-25 wt.% DMSO (L426), and (c) 1-15 wt.%, preferably 4-11 wt.% of a polylysin prepared by the above-specified process (L587P1) (L607).

[0204] The above compositions comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and N,N-dimethyllactamide (L427), and (c) an amine are preferably prepared by

(i) first dissolving NBPT and/or NPPT completely in propylene glycol, preferably under heating, and

(ii) then adding N,N-dimethyllactamide and the amine and optionally further components such as the colorant to the mixture obtained in step (i).

[0205] The above compositions comprising (a) NBPT and/or NPPT, (b) a mixture of propylene glycol and DMSO (L426) and (c) an amine are preferably prepared by

(i) first dissolving NBPT and/or NPPT completely in propylene glycol, preferably under heating, and

(ii) then adding DMSO and the amine and optionally further components such as the colorant to the mixture obtained in step (i).

[0206] The following compositions as listed in Table 1 are preferred embodiments of the present invention. The compositions "i1" to "i7840" as listed in Table 1 comprise the components (A), (L)i and (L)ii. The compositions "i7841" to "i9919" comprise the components (A), (L)i, (L)ii, and (L)iii.

Table 1: Compositions "i1" to "i9919"

i#	A	(L)i	(L)ii	i#	A	(L)i	(L)ii	i#	A	(L)i	(L)ii	i#	A	(L)i	(L)ii
i1	Y	L10	-	i2	Y	L10	L422	i3	Y	L10	L425	i4	Y	L10	L418
i5	Y	L11	-	i6	Y	L11	L422	i7	Y	L11	L425	i8	Y	L11	L418
i9	Y	L20	-	i10	Y	L20	L422	i11	Y	L20	L425	i12	Y	L20	L418
i13	Y	L21	-	i14	Y	L21	L422	i15	Y	L21	L425	i16	Y	L21	L418
i17	Y	L22	-	i18	Y	L22	L422	i19	Y	L22	L425	i20	Y	L22	L418
i21	Y	L23	-	i22	Y	L23	L422	i23	Y	L23	L425	i24	Y	L23	L418
i25	Y	L24	-	i26	Y	L24	L422	i27	Y	L24	L425	i28	Y	L24	L418
i29	Y	L25	-	i30	Y	L25	L422	i31	Y	L25	L425	i32	Y	L25	L418
i33	Y	L26	-	i34	Y	L26	L422	i35	Y	L26	L425	i36	Y	L26	L418
i37	Y	L27	-	i38	Y	L27	L422	i39	Y	L27	L425	i40	Y	L27	L418
i41	Y	L28	-	i42	Y	L28	L422	i43	Y	L28	L425	i44	Y	L28	L418
i45	Y	L12	-	i46	Y	L12	L422	i47	Y	L12	L425	i48	Y	L12	L418
i49	Y	L13	-	i50	Y	L13	L422	i51	Y	L13	L425	i52	Y	L13	L418
i53	Y	L14	-	i54	Y	L14	L422	i55	Y	L14	L425	i56	Y	L14	L418
i57	Y	L15	-	i58	Y	L15	L422	i59	Y	L15	L425	i60	Y	L15	L418
i61	Y	L16	-	i62	Y	L16	L422	i63	Y	L16	L425	i64	Y	L16	L418
i65	Y	L17	-	i66	Y	L17	L422	i67	Y	L17	L425	i68	Y	L17	L418
i69	Y	L18	-	i70	Y	L18	L422	i71	Y	L18	L425	i72	Y	L18	L418
i73	Y	L19	-	i74	Y	L19	L422	i75	Y	L19	L425	i76	Y	L19	L418
i77	Y	L2	-	i78	Y	L2	L422	i79	Y	L2	L425	i80	Y	L2	L418
i81	Y	L101	-	i82	Y	L101	L422	i83	Y	L101	L425	i84	Y	L101	L418
i85	Y	L102	-	i86	Y	L102	L422	i87	Y	L102	L425	i88	Y	L102	L418
i89	Y	L103	-	i90	Y	L103	L422	i91	Y	L103	L425	i92	Y	L103	L418
i93	Y	L104	-	i94	Y	L104	L422	i95	Y	L104	L425	i96	Y	L104	L418
i97	Y	L105	-	i98	Y	L105	L422	i99	Y	L105	L425	i100	Y	L105	L418
i101	Y	L106	-	i102	Y	L106	L422	i103	Y	L106	L425	i104	Y	L106	L418
i105	Y	L107	-	i106	Y	L107	L422	i107	Y	L107	L425	i108	Y	L107	L418
i109	Y	L108	-	i110	Y	L108	L422	i111	Y	L108	L425	i112	Y	L108	L418
i113	Y	L109	-	i114	Y	L109	L422	i115	Y	L109	L425	i116	Y	L109	L418
i117	Y	L110	-	i118	Y	L110	L422	i119	Y	L110	L425	i120	Y	L110	L418
i121	Y	L111	-	i122	Y	L111	L422	i123	Y	L111	L425	i124	Y	L111	L418
i125	Y	L112	-	i126	Y	L112	L422	i127	Y	L112	L425	i128	Y	L112	L418
i129	Y	L113	-	i130	Y	L113	L422	i131	Y	L113	L425	i132	Y	L113	L418
i133	Y	L114	-	i134	Y	L114	L422	i135	Y	L114	L425	i136	Y	L114	L418
i137	Y	L115	-	i138	Y	L115	L422	i139	Y	L115	L425	i140	Y	L115	L418
i141	Y	L116	-	i142	Y	L116	L422	i143	Y	L116	L425	i144	Y	L116	L418
i145	Y	L117	-	i146	Y	L117	L422	i147	Y	L117	L425	i148	Y	L117	L418
i149	Y	L118	-	i150	Y	L118	L422	i151	Y	L118	L425	i152	Y	L118	L418
i153	Y	L119	-	i154	Y	L119	L422	i155	Y	L119	L425	i156	Y	L119	L418
i157	Y	L120	-	i158	Y	L120	L422	i159	Y	L120	L425	i160	Y	L120	L418
i161	Y	L121	-	i162	Y	L121	L422	i163	Y	L121	L425	i164	Y	L121	L418
i165	Y	L122	-	i166	Y	L122	L422	i167	Y	L122	L425	i168	Y	L122	L418
i169	Y	L123	-	i170	Y	L123	L422	i171	Y	L123	L425	i172	Y	L123	L418
i173	Y	L124	-	i174	Y	L124	L422	i175	Y	L124	L425	i176	Y	L124	L418
i177	Y	L125	-	i178	Y	L125	L422	i179	Y	L125	L425	i180	Y	L125	L418
i181	Y	L126	-	i182	Y	L126	L422	i183	Y	L126	L425	i184	Y	L126	L418
i185	Y	L127	-	i186	Y	L127	L422	i187	Y	L127	L425	i188	Y	L127	L418
i189	Y	L128	-	i190	Y	L128	L422	i191	Y	L128	L425	i192	Y	L128	L418
i193	Y	L129	-	i194	Y	L129	L422	i195	Y	L129	L425	i196	Y	L129	L418
i197	Y	L130	-	i198	Y	L130	L422	i199	Y	L130	L425	i200	Y	L130	L418
i201	Y	L131	-	i202	Y	L131	L422	i203	Y	L131	L425	i204	Y	L131	L418
i205	Y	L132	-	i206	Y	L132	L422	i207	Y	L132	L425	i208	Y	L132	L418
i209	Y	L133	-	i210	Y	L133	L422	i211	Y	L133	L425	i212	Y	L133	L418
i213	Y	L134	-	i214	Y	L134	L422	i215	Y	L134	L425	i216	Y	L134	L418
i217	Y	L135	-	i218	Y	L135	L422	i219	Y	L135	L425	i220	Y	L135	L418
i221	Y	L136	-	i222	Y	L136	L422	i223	Y	L136	L425	i224	Y	L136	L418
i225	Y	L137	-	i226	Y	L137	L422	i227	Y	L137	L425	i228	Y	L137	L418
i229	Y	L138	-	i230	Y	L138	L422	i231	Y	L138	L425	i232	Y	L138	L418
i233	Y	L139	-	i234	Y	L139	L422	i235	Y	L139	L425	i236	Y	L139	L418
i237	Y	L140	-	i238	Y	L140	L422	i239	Y	L140	L425	i240	Y	L140	L418
i241	Y	L141	-	i242	Y	L141	L422	i243	Y	L141	L425	i244	Y	L141	L418
i245	Y	L142	-	i246	Y	L142	L422	i247	Y	L142	L425	i248	Y	L142	L418
i249	Y	L143	-	i250	Y	L143	L422	i251	Y	L143	L425	i252	Y	L143	L418
i253	Y	L144	-	i254	Y	L144	L422	i255	Y	L144	L425	i256	Y	L144	L418
i257	Y	L145	-	i258	Y	L145	L422	i259	Y	L145	L425	i260	Y	L145	L418
i261	Y	L146	-	i262	Y	L146	L422	i263	Y	L146	L425	i264	Y	L146	L418
i265	Y	L147	-	i266	Y	L147	L422	i267	Y	L147	L425	i268	Y	L147	L418
i269	Y	L148	-	i270	Y	L148	L422	i271	Y	L148	L425	i272	Y	L148	L418
i273	Y	L149	-	i274	Y	L149	L422	i275	Y	L149	L425	i276	Y	L149	L418
i277	Y	L150	-	i278	Y	L150	L422	i279	Y	L150	L425	i280	Y	L150	L418
i281	Y	L151	-	i282	Y	L151	L422	i283	Y	L151	L425	i284	Y	L151	L418
i285	Y	L152	-	i286	Y	L152	L422	i287	Y	L152	L425	i288	Y	L152	L418
i289	Y	L153	-	i290	Y	L153	L422	i291	Y	L153	L425	i292	Y	L153	L418
i293	Y	L154	-	i294	Y	L154	L422	i295	Y	L154	L425	i296	Y	L154	L418
i297	Y	L155	-	i298	Y	L155	L422	i299	Y	L155	L425	i300	Y	L155	L418
i301	Y	L156	-	i302	Y	L156	L422	i303	Y	L156	L425	i304	Y	L156	L418
i305	Y	L157	-	i306	Y	L157	L422	i307	Y	L157	L425	i308	Y	L157	L418
i309	Y	L158	-	i310	Y	L158	L422	i311	Y	L158	L425	i312	Y	L158	L418
i313	Y	L159	-	i314	Y	L159	L422	i315	Y	L159	L425	i316	Y	L159	L418
i317	Y	L160	-	i318	Y	L160	L422	i319	Y	L160	L425	i320	Y	L160	L418
i321	Y	L161	-	i322	Y	L161	L422	i323	Y	L161	L425	i324	Y	L161	L418
i325	Y	L162	-	i326	Y	L162	L422	i327	Y	L162	L425	i328	Y	L162	L418
i329	Y	L163	-	i330	Y	L163	L422	i331	Y	L163	L425	i332	Y	L163	L418
i333	Y	L164	-	i334	Y	L164	L422	i335	Y	L164	L425	i336	Y	L164	L418
i337	Y	L165	-	i338	Y	L165	L422	i339	Y	L165	L425	i340	Y	L165	L418
i341	Y	L166	-	i342	Y	L166	L422	i343	Y	L166	L425	i344	Y	L166	L418
i345	Y	L167	-	i346	Y	L167	L422	i347	Y	L167	L425	i348	Y	L167	L418
i349	Y	L168	-	i350	Y	L168	L422	i351	Y	L168	L425	i352	Y	L168	L418
i353	Y	L169	-	i354	Y	L169	L422	i355	Y	L169	L425	i356	Y	L169	L418
i357	Y	L170	-	i358	Y	L170	L422	i359	Y	L170	L425	i360	Y	L170	L418
i361	Y	L171	-	i362	Y	L171	L422	i363	Y	L171	L425	i364	Y	L171	L418
i365	Y	L172	-	i366	Y	L172	L422	i367	Y	L172	L425	i368	Y	L172	L418
i369	Y	L173	-	i370	Y	L173	L422	i371	Y	L173	L425	i372	Y	L173	L418
i373	Y	L174	-	i374	Y	L174	L422	i375	Y	L174	L425	i376	Y	L174	L418
i377	Y	L175	-	i378	Y	L175	L422	i379	Y	L175	L425	i380	Y	L175	L418
i381	Y	L176	-	i382	Y	L176	L422	i383	Y	L176	L425	i384	Y	L176	L418
i385	Y	L177	-	i386	Y	L177	L422	i387	Y	L177	L425	i388	Y	L177	L418
i389	Y	L178	-	i390	Y	L178	L422	i391	Y	L178	L425	i392	Y	L178	L418
i393	Y	L179	-	i394	Y	L179	L422	i395	Y	L179	L425	i396	Y	L179	L418
i397	Y	L180	-	i398	Y	L180	L422	i399	Y	L180	L425	i400	Y	L180	L418
i401	Y	L181	-	i402	Y	L181	L422	i403	Y	L181	L425	i404	Y	L181	L418
i405	Y	L182	-	i406	Y	L182	L422	i407	Y	L182	L425	i408	Y	L182	L418
i409	Y	L183	-	i410	Y	L183	L422	i411	Y	L183	L425	i412	Y	L183	L418
i413	Y	L184	-	i414	Y	L184	L422	i415	Y	L184	L425	i416	Y	L184	L418
i417	Y	L185	-	i418	Y	L185	L422	i419	Y	L185	L425	i420	Y	L185	L418
i421	Y	L186	-	i422	Y	L186	L422	i423	Y	L186	L425	i424	Y	L186	L418
i425	Y	L187	-	i426	Y	L187	L422	i427	Y	L187	L425	i428	Y	L187	L418
i429	Y	L188	-	i430	Y	L188	L422	i431	Y	L188	L425	i432	Y	L188	L418
i433	Y	L189	-	i434	Y	L189	L422	i435	Y	L189	L425	i436	Y	L189	L418
i437	Y	L190	-	i438	Y	L190	L422	i439	Y	L190	L425	i440	Y	L190	L418
i441	Y	L191	-	i442	Y	L191	L422	i443	Y	L191	L425	i444	Y	L191	L418
i445	Y	L192	-	i446	Y	L192	L422	i447	Y	L192	L425	i448	Y	L192	L418
i449	Y	L193	-	i450	Y	L193	L422	i451	Y	L193	L425	i452	Y	L193	L418
i453	Y	L194	-	i454	Y	L194	L422	i455	Y	L194	L425	i456	Y	L194	L418
i457	Y	L195	-	i458	Y	L195	L422	i459	Y	L195	L425	i460	Y	L195	L418
i461	Y	L196	-	i462	Y	L196	L422	i463	Y	L196	L425	i464	Y	L196	L418
i465	Y	L197	-	i466	Y	L197	L422	i467	Y	L197	L425	i468	Y	L197	L418
i469	Y	L198	-	i470	Y	L198	L422	i471	Y	L198	L425	i472	Y	L198	L418
i473	Y	L199	-	i474	Y	L199	L422	i475	Y	L199	L425	i476	Y	L199	L418
i477	Y	L200	-	i478	Y	L200	L422	i479	Y	L200	L425	i480	Y	L200	L418
i481	Y	L201	-	i482	Y	L201	L422	i483	Y	L201	L425	i484	Y	L201	L418
i485	Y	L202	-	i486	Y	L202	L422	i487	Y	L202	L425	i488	Y	L202	L418
i489	Y	L203	-	i490	Y	L203	L422	i491	Y	L203	L425	i492	Y	L203	L418
i493	Y	L204	-	i494	Y	L204	L422	i495	Y	L204	L425	i496	Y	L204	L418
i497	Y	L205	-	i498	Y	L205	L422	i499	Y	L205	L425	i500	Y	L205	L418
i501	Y	L206	-	i502	Y	L206	L422	i503	Y	L206	L425	i504	Y	L206	L418
i505	Y	L207	-	i506	Y	L207	L422	i507	Y	L207	L425	i508	Y	L207	L418
i509	Y	L208	-	i510	Y	L208	L422	i511	Y	L208	L425	i512	Y	L208	L418
i513	Y	L209	-	i514	Y	L209	L422	i515	Y	L209	L425	i516	Y	L209	L418
i517	Y	L210	-	i518	Y	L210	L422	i519	Y	L210	L425	i520	Y	L210	L418
i521	Y	L211	-	i522	Y	L211	L422	i523	Y	L211	L425	i524	Y	L211	L418
i525	Y	L212	-	i526	Y	L212	L422	i527	Y	L212	L425	i528	Y	L212	L418
i529	Y	L213	-	i530	Y	L213	L422	i531	Y	L213	L425	i532	Y	L213	L418
i533	Y	L214	-	i534	Y	L214	L422	i535	Y	L214	L425	i536	Y	L214	L418
i537	Y	L215	-	i538	Y	L215	L422	i539	Y	L215	L425	i540	Y	L215	L418
i541	Y	L216	-	i542	Y	L216	L422	i543	Y	L216	L425	i544	Y	L216	L418
i545	Y	L217	-	i546	Y	L217	L422	i547	Y	L217	L425	i548	Y	L217	L418
i549	Y	L218	-	i550	Y	L218	L422	i551	Y	L218	L425	i552	Y	L218	L418
i553	Y	L219	-	i554	Y	L219	L422	i555	Y	L219	L425	i556	Y	L219	L418
i557	Y	L220	-	i558	Y	L220	L422	i559	Y	L220	L425	i560	Y	L220	L418
i561	Y	L221	-	i562	Y	L221	L422	i563	Y	L221	L425	i564	Y	L221	L418
i565	Y	L222	-	i566	Y	L222	L422	i567	Y	L222	L425	i568	Y	L222	L418
i569	Y	L401	-	i570	Y	L401	L422	i571	Y	L401	L425	i572	Y	L401	L418
i573	Y	L402	-	i574	Y	L402	L422	i575	Y	L402	L425	i576	Y	L402	L418
i577	Y	L403	-	i578	Y	L403	L422	i579	Y	L403	L425	i580	Y	L403	L418
i581	Y	L404	-	i582	Y	L404	L422	i583	Y	L404	L425	i584	Y	L404	L418
i585	Y	L405	-	i586	Y	L405	L422	i587	Y	L405	L425	i588	Y	L405	L418
i589	Y	L406	-	i590	Y	L406	L422	i591	Y	L406	L425	i592	Y	L406	L418
i593	Y	L407	-	i594	Y	L407	L422	i595	Y	L407	L425	i596	Y	L407	L418
i597	Y	L408	-	i598	Y	L408	L422	i599	Y	L408	L425	i600	Y	L408	L418
i601	Y	L409	-	i602	Y	L409	L422	i603	Y	L409	L425	i604	Y	L409	L418
i605	Y	L410	-	i606	Y	L410	L422	i607	Y	L410	L425	i608	Y	L410	L418
i609	Y	L411	-	i610	Y	L411	L422	i611	Y	L411	L425	i612	Y	L411	L418
i613	Y	L412	-	i614	Y	L412	L422	i615	Y	L412	L425	i616	Y	L412	L418
i617	Y	L413	-	i618	Y	L413	L422	i619	Y	L413	L425	i620	Y	L413	L418
i621	Y	L414	-	i622	Y	L414	L422	i623	Y	L414	L425	i624	Y	L414	L418
i625	Y	L415	-	i626	Y	L415	L422	i627	Y	L415	L425	i628	Y	L415	L418
i629	Y	L416	-	i630	Y	L416	L422	i631	Y	L416	L425	i632	Y	L416	L418
i633	Y	L417	-	i634	Y	L417	L422	i635	Y	L417	L425	i636	Y	L417	L418
i637	Y	L418	-	i638	Y	L418	L422	i639	Y	L418	L425	i640	Y	L418	L418
i641	Y	L419	-	i642	Y	L419	L422	i643	Y	L419	L425	i644	Y	L419	L418
i645	Y	L420	-	i646	Y	L420	L422	i647	Y	L420	L425	i648	Y	L420	L418
i649	Y	L421	-	i650	Y	L421	L422	i651	Y	L421	L425	i652	Y	L421	L418
i653	Y	L422	-	i654	Y	L422	L422	i655	Y	L422	L425	i656	Y	L422	L418
i657	Y	L423	-	i658	Y	L423	L422	i659	Y	L423	L425	i660	Y	L423	L418
i661	Y	L424	-	i662	Y	L424	L422	i663	Y	L424	L425	i664	Y	L424	L418
i665	Y	L425	-	i666	Y	L425	L422	i667	Y	L425	L425	i668	Y	L425	L418
i669	Y	L501	-	i670	Y	L501	L422	i671	Y	L501	L425	i672	Y	L501	L418
i673	Y	L502	-	i674	Y	L502	L422	i675	Y	L502	L425	i676	Y	L502	L418
i677	Y	L503	-	i678	Y	L503	L422	i679	Y	L503	L425	i680	Y	L503	L418
i681	Y	L504	-	i682	Y	L504	L422	i683	Y	L504	L425	i684	Y	L504	L418
i685	Y	L505	-	i686	Y	L505	L422	i687	Y	L505	L425	i688	Y	L505	L418
i689	Y	L506	-	i690	Y	L506	L422	i691	Y	L506	L425	i692	Y	L506	L418
i693	Y	L507	-	i694	Y	L507	L422	i695	Y	L507	L425	i696	Y	L507	L418
i697	Y	L508	-	i698	Y	L508	L422	i699	Y	L508	L425	i700	Y	L508	L418
i701	Y	L509	-	i702	Y	L509	L422	i703	Y	L509	L425	i704	Y	L509	L418
i705	Y	L510	-	i706	Y	L510	L422	i707	Y	L510	L425	i708	Y	L510	L418
i709	Y	L511	-	i710	Y	L511	L422	i711	Y	L511	L425	i712	Y	L511	L418
i713	Y	L512	-	i714	Y	L512	L422	i715	Y	L512	L425	i716	Y	L512	L418
i717	Y	L513	-	i718	Y	L513	L422	i719	Y	L513	L425	i720	Y	L513	L418
i721	Y	L514	-	i722	Y	L514	L422	i723	Y	L514	L425	i724	Y	L514	L418
i725	Y	L515	-	i726	Y	L515	L422	i727	Y	L515	L425	i728	Y	L515	L418
i729	Y	L516	-	i730	Y	L516	L422	i731	Y	L516	L425	i732	Y	L516	L418
i733	Y	L517	-	i734	Y	L517	L422	i735	Y	L517	L425	i736	Y	L517	L418
i737	Y	L518	-	i738	Y	L518	L422	i739	Y	L518	L425	i740	Y	L518	L418
i741	Y	L519	-	i742	Y	L519	L422	i743	Y	L519	L425	i744	Y	L519	L418
i745	Y	L520	-	i746	Y	L520	L422	i747	Y	L520	L425	i748	Y	L520	L418
i749	Y	L521	-	i750	Y	L521	L422	i751	Y	L521	L425	i752	Y	L521	L418
i753	Y	L522	-	i754	Y	L522	L422	i755	Y	L522	L425	i756	Y	L522	L418
i757	Y	L523	-	i758	Y	L523	L422	i759	Y	L523	L425	i760	Y	L523	L418
i761	Y	L524	-	i762	Y	L524	L422	i763	Y	L524	L425	i764	Y	L524	L418
i765	Y	L525	-	i766	Y	L525	L422	i767	Y	L525	L425	i768	Y	L525	L418
i769	Y	L526	-	i770	Y	L526	L422	i771	Y	L526	L425	i772	Y	L526	L418
i773	Y	L527	-	i774	Y	L527	L422	i775	Y	L527	L425	i776	Y	L527	L418
i777	Y	L528	-	i778	Y	L528	L422	i779	Y	L528	L425	i780	Y	L528	L418
i781	Y	L529	-	i782	Y	L529	L422	i783	Y	L529	L425	i784	Y	L529	L418
i785	Y	L530	-	i786	Y	L530	L422	i787	Y	L530	L425	i788	Y	L530	L418
i789	Y	L531	-	i790	Y	L531	L422	i791	Y	L531	L425	i792	Y	L531	L418
i793	Y	L532	-	i794	Y	L532	L422	i795	Y	L532	L425	i796	Y	L532	L418
i797	Y	L533	-	i798	Y	L533	L422	i799	Y	L533	L425	i800	Y	L533	L418
i801	Y	L534	-	i802	Y	L534	L422	i803	Y	L534	L425	i804	Y	L534	L418
i805	Y	L535	-	i806	Y	L535	L422	i807	Y	L535	L425	i808	Y	L535	L418
i809	Y	L536	-	i810	Y	L536	L422	i811	Y	L536	L425	i812	Y	L536	L418
i813	Y	L537	-	i814	Y	L537	L422	i815	Y	L537	L425	i816	Y	L537	L418
i817	Y	L538	-	i818	Y	L538	L422	i819	Y	L538	L425	i820	Y	L538	L418
i821	Y	L539	-	i822	Y	L539	L422	i823	Y	L539	L425	i824	Y	L539	L418
i825	Y	L540	-	i826	Y	L540	L422	i827	Y	L540	L425	i828	Y	L540	L418
i829	Y	L541	-	i830	Y	L541	L422	i831	Y	L541	L425	i832	Y	L541	L418
i833	Y	L542	-	i834	Y	L542	L422	i835	Y	L542	L425	i836	Y	L542	L418
i837	Y	L543	-	i838	Y	L543	L422	i839	Y	L543	L425	i840	Y	L543	L418
i841	Y	L544	-	i842	Y	L544	L422	i843	Y	L544	L425	i844	Y	L544	L418
i845	Y	L545	-	i846	Y	L545	L422	i847	Y	L545	L425	i848	Y	L545	L418
i849	Y	L546	-	i850	Y	L546	L422	i851	Y	L546	L425	i852	Y	L546	L418
i853	Y	L547	-	i854	Y	L547	L422	i855	Y	L547	L425	i856	Y	L547	L418
i857	Y	L548	-	i858	Y	L548	L422	i859	Y	L548	L425	i860	Y	L548	L418
i861	Y	L549	-	i862	Y	L549	L422	i863	Y	L549	L425	i864	Y	L549	L418
i865	Y	L550	-	i866	Y	L550	L422	i867	Y	L550	L425	i868	Y	L550	L418
i869	Y	L551	-	i870	Y	L551	L422	i871	Y	L551	L425	i872	Y	L551	L418
i873	Y	L552	-	i874	Y	L552	L422	i875	Y	L552	L425	i876	Y	L552	L418
i877	Y	L553	-	i878	Y	L553	L422	i879	Y	L553	L425	i880	Y	L553	L418
i881	Y	L554	-	i882	Y	L554	L422	i883	Y	L554	L425	i884	Y	L554	L418
i885	Y	L555	-	i886	Y	L555	L422	i887	Y	L555	L425	i888	Y	L555	L418
i889	Y	L556	-	i890	Y	L556	L422	i891	Y	L556	L425	i892	Y	L556	L418
i893	Y	L557	-	i894	Y	L557	L422	i895	Y	L557	L425	i896	Y	L557	L418
i897	Y	L558	-	i898	Y	L558	L422	i899	Y	L558	L425	i900	Y	L558	L418
i901	Y	L559	-	i902	Y	L559	L422	i903	Y	L559	L425	i904	Y	L559	L418
i905	Y	L560	-	i906	Y	L560	L422	i907	Y	L560	L425	i908	Y	L560	L418
i909	Y	L561	-	i910	Y	L561	L422	i911	Y	L561	L425	i912	Y	L561	L418
i913	Y	L562	-	i914	Y	L562	L422	i915	Y	L562	L425	i916	Y	L562	L418
i917	Y	L563	-	i918	Y	L563	L422	i919	Y	L563	L425	i920	Y	L563	L418
i921	Y	L564	-	i922	Y	L564	L422	i923	Y	L564	L425	i924	Y	L564	L418
i925	Y	L565	-	i926	Y	L565	L422	i927	Y	L565	L425	i928	Y	L565	L418
i929	Y	L566	-	i930	Y	L566	L422	i931	Y	L566	L425	i932	Y	L566	L418
i933	Y	L567	-	i934	Y	L567	L422	i935	Y	L567	L425	i936	Y	L567	L418
i937	Y	L568	-	i938	Y	L568	L422	i939	Y	L568	L425	i940	Y	L568	L418
i941	Y	L569	-	i942	Y	L569	L422	i943	Y	L569	L425	i944	Y	L569	L418
i945	Y	L570	-	i946	Y	L570	L422	i947	Y	L570	L425	i948	Y	L570	L418
i949	Y	L571	-	i950	Y	L571	L422	i951	Y	L571	L425	i952	Y	L571	L418
i953	Y	L572	-	i954	Y	L572	L422	i955	Y	L572	L425	i956	Y	L572	L418
i957	Y	L843	-	i958	Y	L843	L422	i959	Y	L843	L425	i960	Y	L843	L418
i961	Y	L844	-	i962	Y	L844	L422	i963	Y	L844	L425	i964	Y	L844	L418
i965	Y	L845	-	i966	Y	L845	L422	i967	Y	L845	L425	i968	Y	L845	L418
i969	Y	L846	-	i970	Y	L846	L422	i971	Y	L846	L425	i972	Y	L846	L418
i973	Y	L847	-	i974	Y	L847	L422	i975	Y	L847	L425	i976	Y	L847	L418
i977	Y	L848	-	i978	Y	L848	L422	i979	Y	L848	L425	i980	Y	L848	L418
i981	Y	L10	L423	i982	Y	L10	L424	i983	Y	L10	L419	i984	Y	L10	L410
i985	Y	L11	L423	i986	Y	L11	L424	i987	Y	L11	L419	i988	Y	L11	L410
i989	Y	L20	L423	i990	Y	L20	L424	i991	Y	L20	L419	i992	Y	L20	L410
i993	Y	L21	L423	i994	Y	L21	L424	i995	Y	L21	L419	i996	Y	L21	L410
i997	Y	L22	L423	i998	Y	L22	L424	i999	Y	L22	L419	i1000	Y	L22	L410
i1001	Y	L23	L423	i1002	Y	L23	L424	i1003	Y	L23	L419	i1004	Y	L23	L410
i1005	Y	L24	L423	i1006	Y	L24	L424	i1007	Y	L24	L419	i1008	Y	L24	L410
i1009	Y	L25	L423	i1010	Y	L25	L424	i1011	Y	L25	L419	i1012	Y	L25	L410
i1013	Y	L26	L423	i1014	Y	L26	L424	i1015	Y	L26	L419	i1016	Y	L26	L410
i1017	Y	L27	L423	i1018	Y	L27	L424	i1019	Y	L27	L419	i1020	Y	L27	L410
i1021	Y	L28	L423	i1022	Y	L28	L424	i1023	Y	L28	L419	i1024	Y	L28	L410
i1025	Y	L12	L423	i1026	Y	L12	L424	i1027	Y	L12	L419	i1028	Y	L12	L410
i1029	Y	L13	L423	i1030	Y	L13	L424	i1031	Y	L13	L419	i1032	Y	L13	L410
i1033	Y	L14	L423	i1034	Y	L14	L424	i1035	Y	L14	L419	i1036	Y	L14	L410
i1037	Y	L15	L423	i1038	Y	L15	L424	i1039	Y	L15	L419	i1040	Y	L15	L410
i1041	Y	L16	L423	i1042	Y	L16	L424	i1043	Y	L16	L419	i1044	Y	L16	L410
i1045	Y	L17	L423	i1046	Y	L17	L424	i1047	Y	L17	L419	i1048	Y	L17	L410
i1049	Y	L18	L423	i1050	Y	L18	L424	i1051	Y	L18	L419	i1052	Y	L18	L410
i1053	Y	L19	L423	i1054	Y	L19	L424	i1055	Y	L19	L419	i1056	Y	L19	L410
i1057	Y	L2	L423	i1058	Y	L2	L424	i1059	Y	L2	L419	i1060	Y	L2	L410
i1061	Y	L101	L423	i1062	Y	L101	L424	i1063	Y	L101	L419	i1064	Y	L101	L410
i1065	Y	L102	L423	i1066	Y	L102	L424	i1067	Y	L102	L419	i1068	Y	L102	L410
i1069	Y	L103	L423	i1070	Y	L103	L424	i1071	Y	L103	L419	i1072	Y	L103	L410
i1073	Y	L104	L423	i1074	Y	L104	L424	i1075	Y	L104	L419	i1076	Y	L104	L410
i1077	Y	L105	L423	i1078	Y	L105	L424	i1079	Y	L105	L419	i1080	Y	L105	L410
i1081	Y	L106	L423	i1082	Y	L106	L424	i1083	Y	L106	L419	i1084	Y	L106	L410
i1085	Y	L107	L423	i1086	Y	L107	L424	i1087	Y	L107	L419	i1088	Y	L107	L410
i1089	Y	L108	L423	i1090	Y	L108	L424	i1091	Y	L108	L419	i1092	Y	L108	L410
i1093	Y	L109	L423	i1094	Y	L109	L424	i1095	Y	L109	L419	i1096	Y	L109	L410
i1097	Y	L110	L423	i1098	Y	L110	L424	i1099	Y	L110	L419	i1100	Y	L110	L410
i1101	Y	L111	L423	i1102	Y	L111	L424	i1103	Y	L111	L419	i1104	Y	L111	L410
i1105	Y	L112	L423	i1106	Y	L112	L424	i1107	Y	L112	L419	i1108	Y	L112	L410
i1109	Y	L113	L423	i1110	Y	L113	L424	i1111	Y	L113	L419	i1112	Y	L113	L410
i1113	Y	L114	L423	i1114	Y	L114	L424	i1115	Y	L114	L419	i1116	Y	L114	L410
i1117	Y	L115	L423	i1118	Y	L115	L424	i1119	Y	L115	L419	i1120	Y	L115	L410
i1121	Y	L116	L423	i1122	Y	L116	L424	i1123	Y	L116	L419	i1124	Y	L116	L410
i1125	Y	L117	L423	i1126	Y	L117	L424	i1127	Y	L117	L419	i1128	Y	L117	L410
i1129	Y	L118	L423	i1130	Y	L118	L424	i1131	Y	L118	L419	i1132	Y	L118	L410
i1133	Y	L119	L423	i1134	Y	L119	L424	i1135	Y	L119	L419	i1136	Y	L119	L410
i1137	Y	L120	L423	i1138	Y	L120	L424	i1139	Y	L120	L419	i1140	Y	L120	L410
i1141	Y	L121	L423	i1142	Y	L121	L424	i1143	Y	L121	L419	i1144	Y	L121	L410
i1145	Y	L122	L423	i1146	Y	L122	L424	i1147	Y	L122	L419	i1148	Y	L122	L410
i1149	Y	L123	L423	i1150	Y	L123	L424	i1151	Y	L123	L419	i1152	Y	L123	L410
i1153	Y	L124	L423	i1154	Y	L124	L424	i1155	Y	L124	L419	i1156	Y	L124	L410
i1157	Y	L125	L423	i1158	Y	L125	L424	i1159	Y	L125	L419	i1160	Y	L125	L410
i1161	Y	L126	L423	i1162	Y	L126	L424	i1163	Y	L126	L419	i1164	Y	L126	L410
i1165	Y	L127	L423	i1166	Y	L127	L424	i1167	Y	L127	L419	i1168	Y	L127	L410
i1169	Y	L128	L423	i1170	Y	L128	L424	i1171	Y	L128	L419	i1172	Y	L128	L410
i1173	Y	L129	L423	i1174	Y	L129	L424	i1175	Y	L129	L419	i1176	Y	L129	L410
i1177	Y	L130	L423	i1178	Y	L130	L424	i1179	Y	L130	L419	i1180	Y	L130	L410
i1181	Y	L131	L423	i1182	Y	L131	L424	i1183	Y	L131	L419	i1184	Y	L131	L410
i1185	Y	L132	L423	i1186	Y	L132	L424	i1187	Y	L132	L419	i1188	Y	L132	L410
i1189	Y	L133	L423	i1190	Y	L133	L424	i1191	Y	L133	L419	i1192	Y	L133	L410
i1193	Y	L134	L423	i1194	Y	L134	L424	i1195	Y	L134	L419	i1196	Y	L134	L410
i1197	Y	L135	L423	i1198	Y	L135	L424	i1199	Y	L135	L419	i1200	Y	L135	L410
i1201	Y	L136	L423	i1202	Y	L136	L424	i1203	Y	L136	L419	i1204	Y	L136	L410
i1205	Y	L137	L423	i1206	Y	L137	L424	i1207	Y	L137	L419	i1208	Y	L137	L410
i1209	Y	L138	L423	i1210	Y	L138	L424	i1211	Y	L138	L419	i1212	Y	L138	L410
i1213	Y	L139	L423	i1214	Y	L139	L424	i1215	Y	L139	L419	i1216	Y	L139	L410
i1217	Y	L140	L423	i1218	Y	L140	L424	i1219	Y	L140	L419	i1220	Y	L140	L410
i1221	Y	L141	L423	i1222	Y	L141	L424	i1223	Y	L141	L419	i1224	Y	L141	L410
i1225	Y	L142	L423	i1226	Y	L142	L424	i1227	Y	L142	L419	i1228	Y	L142	L410
i1229	Y	L143	L423	i1230	Y	L143	L424	i1231	Y	L143	L419	i1232	Y	L143	L410
i1233	Y	L144	L423	i1234	Y	L144	L424	i1235	Y	L144	L419	i1236	Y	L144	L410
i1237	Y	L145	L423	i1238	Y	L145	L424	i1239	Y	L145	L419	i1240	Y	L145	L410
i1241	Y	L146	L423	i1242	Y	L146	L424	i1243	Y	L146	L419	i1244	Y	L146	L410
i1245	Y	L147	L423	i1246	Y	L147	L424	i1247	Y	L147	L419	i1248	Y	L147	L410
i1249	Y	L148	L423	i1250	Y	L148	L424	i1251	Y	L148	L419	i1252	Y	L148	L410
i1253	Y	L149	L423	i1254	Y	L149	L424	i1255	Y	L149	L419	i1256	Y	L149	L410
i1257	Y	L150	L423	i1258	Y	L150	L424	i1259	Y	L150	L419	i1260	Y	L150	L410
i1261	Y	L151	L423	i1262	Y	L151	L424	i1263	Y	L151	L419	i1264	Y	L151	L410
i1265	Y	L152	L423	i1266	Y	L152	L424	i1267	Y	L152	L419	i1268	Y	L152	L410
i1269	Y	L153	L423	i1270	Y	L153	L424	i1271	Y	L153	L419	i1272	Y	L153	L410
i1273	Y	L154	L423	i1274	Y	L154	L424	i1275	Y	L154	L419	i1276	Y	L154	L410
i1277	Y	L155	L423	i1278	Y	L155	L424	i1279	Y	L155	L419	i1280	Y	L155	L410
i1281	Y	L156	L423	i1282	Y	L156	L424	i1283	Y	L156	L419	i1284	Y	L156	L410
i1285	Y	L157	L423	i1286	Y	L157	L424	i1287	Y	L157	L419	i1288	Y	L157	L410
i1289	Y	L158	L423	i1290	Y	L158	L424	i1291	Y	L158	L419	i1292	Y	L158	L410
i1293	Y	L159	L423	i1294	Y	L159	L424	i1295	Y	L159	L419	i1296	Y	L159	L410
i1297	Y	L160	L423	i1298	Y	L160	L424	i1299	Y	L160	L419	i1300	Y	L160	L410
i1301	Y	L161	L423	i1302	Y	L161	L424	i1303	Y	L161	L419	i1304	Y	L161	L410
i1305	Y	L162	L423	i1306	Y	L162	L424	i1307	Y	L162	L419	i1308	Y	L162	L410
i1309	Y	L163	L423	i1310	Y	L163	L424	i1311	Y	L163	L419	i1312	Y	L163	L410
i1313	Y	L164	L423	i1314	Y	L164	L424	i1315	Y	L164	L419	i1316	Y	L164	L410
i1317	Y	L165	L423	i1318	Y	L165	L424	i1319	Y	L165	L419	i1320	Y	L165	L410
i1321	Y	L166	L423	i1322	Y	L166	L424	i1323	Y	L166	L419	i1324	Y	L166	L410
i1325	Y	L167	L423	i1326	Y	L167	L424	i1327	Y	L167	L419	i1328	Y	L167	L410
i1329	Y	L168	L423	i1330	Y	L168	L424	i1331	Y	L168	L419	i1332	Y	L168	L410
i1333	Y	L169	L423	i1334	Y	L169	L424	i1335	Y	L169	L419	i1336	Y	L169	L410
i1337	Y	L170	L423	i1338	Y	L170	L424	i1339	Y	L170	L419	i1340	Y	L170	L410
i1341	Y	L171	L423	i1342	Y	L171	L424	i1343	Y	L171	L419	i1344	Y	L171	L410
i1345	Y	L172	L423	i1346	Y	L172	L424	i1347	Y	L172	L419	i1348	Y	L172	L410
i1349	Y	L173	L423	i1350	Y	L173	L424	i1351	Y	L173	L419	i1352	Y	L173	L410
i1353	Y	L174	L423	i1354	Y	L174	L424	i1355	Y	L174	L419	i1356	Y	L174	L410
i1357	Y	L175	L423	i1358	Y	L175	L424	i1359	Y	L175	L419	i1360	Y	L175	L410
i1361	Y	L176	L423	i1362	Y	L176	L424	i1363	Y	L176	L419	i1364	Y	L176	L410
i1365	Y	L177	L423	i1366	Y	L177	L424	i1367	Y	L177	L419	i1368	Y	L177	L410
i1369	Y	L178	L423	i1370	Y	L178	L424	i1371	Y	L178	L419	i1372	Y	L178	L410
i1373	Y	L179	L423	i1374	Y	L179	L424	i1375	Y	L179	L419	i1376	Y	L179	L410
i1377	Y	L180	L423	i1378	Y	L180	L424	i1379	Y	L180	L419	i1380	Y	L180	L410
i1381	Y	L181	L423	i1382	Y	L181	L424	i1383	Y	L181	L419	i1384	Y	L181	L410
i1385	Y	L182	L423	i1386	Y	L182	L424	i1387	Y	L182	L419	i1388	Y	L182	L410
i1389	Y	L183	L423	i1390	Y	L183	L424	i1391	Y	L183	L419	i1392	Y	L183	L410
i1393	Y	L184	L423	i1394	Y	L184	L424	i1395	Y	L184	L419	i1396	Y	L184	L410
i1397	Y	L185	L423	i1398	Y	L185	L424	i1399	Y	L185	L419	i1400	Y	L185	L410
i1401	Y	L186	L423	i1402	Y	L186	L424	i1403	Y	L186	L419	i1404	Y	L186	L410
i1405	Y	L187	L423	i1406	Y	L187	L424	i1407	Y	L187	L419	i1408	Y	L187	L410
i1409	Y	L188	L423	i1410	Y	L188	L424	i1411	Y	L188	L419	i1412	Y	L188	L410
i1413	Y	L189	L423	i1414	Y	L189	L424	i1415	Y	L189	L419	i1416	Y	L189	L410
i1417	Y	L190	L423	i1418	Y	L190	L424	i1419	Y	L190	L419	i1420	Y	L190	L410
i1421	Y	L191	L423	i1422	Y	L191	L424	i1423	Y	L191	L419	i1424	Y	L191	L410
i1425	Y	L192	L423	i1426	Y	L192	L424	i1427	Y	L192	L419	i1428	Y	L192	L410
i1429	Y	L193	L423	i1430	Y	L193	L424	i1431	Y	L193	L419	i1432	Y	L193	L410
i1433	Y	L194	L423	i1434	Y	L194	L424	i1435	Y	L194	L419	i1436	Y	L194	L410
i1437	Y	L195	L423	i1438	Y	L195	L424	i1439	Y	L195	L419	i1440	Y	L195	L410
i1441	Y	L196	L423	i1442	Y	L196	L424	i1443	Y	L196	L419	i1444	Y	L196	L410
i1445	Y	L197	L423	i1446	Y	L197	L424	i1447	Y	L197	L419	i1448	Y	L197	L410
i1449	Y	L198	L423	i1450	Y	L198	L424	i1451	Y	L198	L419	i1452	Y	L198	L410
i1453	Y	L199	L423	i1454	Y	L199	L424	i1455	Y	L199	L419	i1456	Y	L199	L410
i1457	Y	L200	L423	i1458	Y	L200	L424	i1459	Y	L200	L419	i1460	Y	L200	L410
i1461	Y	L201	L423	i1462	Y	L201	L424	i1463	Y	L201	L419	i1464	Y	L201	L410
i1465	Y	L202	L423	i1466	Y	L202	L424	i1467	Y	L202	L419	i1468	Y	L202	L410
i1469	Y	L203	L423	i1470	Y	L203	L424	i1471	Y	L203	L419	i1472	Y	L203	L410
i1473	Y	L204	L423	i1474	Y	L204	L424	i1475	Y	L204	L419	i1476	Y	L204	L410
i1477	Y	L205	L423	i1478	Y	L205	L424	i1479	Y	L205	L419	i1480	Y	L205	L410
i1481	Y	L206	L423	i1482	Y	L206	L424	i1483	Y	L206	L419	i1484	Y	L206	L410
i1485	Y	L207	L423	i1486	Y	L207	L424	i1487	Y	L207	L419	i1488	Y	L207	L410
i1489	Y	L208	L423	i1490	Y	L208	L424	i1491	Y	L208	L419	i1492	Y	L208	L410
i1493	Y	L209	L423	i1494	Y	L209	L424	i1495	Y	L209	L419	i1496	Y	L209	L410
i1497	Y	L210	L423	i1498	Y	L210	L424	i1499	Y	L210	L419	i1500	Y	L210	L410
i1501	Y	L211	L423	i1502	Y	L211	L424	i1503	Y	L211	L419	i1504	Y	L211	L410
i1505	Y	L212	L423	i1506	Y	L212	L424	i1507	Y	L212	L419	i1508	Y	L212	L410
i1509	Y	L213	L423	i1510	Y	L213	L424	i1511	Y	L213	L419	i1512	Y	L213	L410
i1513	Y	L214	L423	i1514	Y	L214	L424	i1515	Y	L214	L419	i1516	Y	L214	L410
i1517	Y	L215	L423	i1518	Y	L215	L424	i1519	Y	L215	L419	i1520	Y	L215	L410
i1521	Y	L216	L423	i1522	Y	L216	L424	i1523	Y	L216	L419	i1524	Y	L216	L410
i1525	Y	L217	L423	i1526	Y	L217	L424	i1527	Y	L217	L419	i1528	Y	L217	L410
i1529	Y	L218	L423	i1530	Y	L218	L424	i1531	Y	L218	L419	i1532	Y	L218	L410
i1533	Y	L219	L423	i1534	Y	L219	L424	i1535	Y	L219	L419	i1536	Y	L219	L410
i1537	Y	L220	L423	i1538	Y	L220	L424	i1539	Y	L220	L419	i1540	Y	L220	L410
i1541	Y	L221	L423	i1542	Y	L221	L424	i1543	Y	L221	L419	i1544	Y	L221	L410
i1545	Y	L222	L423	i1546	Y	L222	L424	i1547	Y	L222	L419	i1548	Y	L222	L410
i1549	Y	L401	L423	i1550	Y	L401	L424	i1551	Y	L401	L419	i1552	Y	L401	L410
i1553	Y	L402	L423	i1554	Y	L402	L424	i1555	Y	L402	L419	i1556	Y	L402	L410
i1557	Y	L403	L423	i1558	Y	L403	L424	i1559	Y	L403	L419	i1560	Y	L403	L410
i1561	Y	L404	L423	i1562	Y	L404	L424	i1563	Y	L404	L419	i1564	Y	L404	L410
i1565	Y	L405	L423	i1566	Y	L405	L424	i1567	Y	L405	L419	i1568	Y	L405	L410
i1569	Y	L406	L423	i1570	Y	L406	L424	i1571	Y	L406	L419	i1572	Y	L406	L410
i1573	Y	L407	L423	i1574	Y	L407	L424	i1575	Y	L407	L419	i1576	Y	L407	L410
i1577	Y	L408	L423	i1578	Y	L408	L424	i1579	Y	L408	L419	i1580	Y	L408	L410
i1581	Y	L409	L423	i1582	Y	L409	L424	i1583	Y	L409	L419	i1584	Y	L409	L410
i1585	Y	L410	L423	i1586	Y	L410	L424	i1587	Y	L410	L419	i1588	Y	L410	L410
i1589	Y	L411	L423	i1590	Y	L411	L424	i1591	Y	L411	L419	i1592	Y	L411	L410
i1593	Y	L412	L423	i1594	Y	L412	L424	i1595	Y	L412	L419	i1596	Y	L412	L410
i1597	Y	L413	L423	i1598	Y	L413	L424	i1599	Y	L413	L419	i1600	Y	L413	L410
i1601	Y	L414	L423	i1602	Y	L414	L424	i1603	Y	L414	L419	i1604	Y	L414	L410
i1605	Y	L415	L423	i1606	Y	L415	L424	i1607	Y	L415	L419	i1608	Y	L415	L410
i1609	Y	L416	L423	i1610	Y	L416	L424	i1611	Y	L416	L419	i1612	Y	L416	L410
i1613	Y	L417	L423	i1614	Y	L417	L424	i1615	Y	L417	L419	i1616	Y	L417	L410
i1617	Y	L418	L423	i1618	Y	L418	L424	i1619	Y	L418	L419	i1620	Y	L418	L410
i1621	Y	L419	L423	i1622	Y	L419	L424	i1623	Y	L419	L419	i1624	Y	L419	L410
i1625	Y	L420	L423	i1626	Y	L420	L424	i1627	Y	L420	L419	i1628	Y	L420	L410
i1629	Y	L421	L423	i1630	Y	L421	L424	i1631	Y	L421	L419	i1632	Y	L421	L410
i1633	Y	L422	L423	i1634	Y	L422	L424	i1635	Y	L422	L419	i1636	Y	L422	L410
i1637	Y	L423	L423	i1638	Y	L423	L424	i1639	Y	L423	L419	i1640	Y	L423	L410
i1641	Y	L424	L423	i1642	Y	L424	L424	i1643	Y	L424	L419	i1644	Y	L424	L410
i1645	Y	L425	L423	i1646	Y	L425	L424	i1647	Y	L425	L419	i1648	Y	L425	L410
i1649	Y	L501	L423	i1650	Y	L501	L424	i1651	Y	L501	L419	i1652	Y	L501	L410
i1653	Y	L502	L423	i1654	Y	L502	L424	i1655	Y	L502	L419	i1656	Y	L502	L410
i1657	Y	L503	L423	i1658	Y	L503	L424	i1659	Y	L503	L419	i1660	Y	L503	L410
i1661	Y	L504	L423	i1662	Y	L504	L424	i1663	Y	L504	L419	i1664	Y	L504	L410
i1665	Y	L505	L423	i1666	Y	L505	L424	i1667	Y	L505	L419	i1668	Y	L505	L410
i1669	Y	L506	L423	i1670	Y	L506	L424	i1671	Y	L506	L419	i1672	Y	L506	L410
i1673	Y	L507	L423	i1674	Y	L507	L424	i1675	Y	L507	L419	i1676	Y	L507	L410
i1677	Y	L508	L423	i1678	Y	L508	L424	i1679	Y	L508	L419	i1680	Y	L508	L410
i1681	Y	L509	L423	i1682	Y	L509	L424	i1683	Y	L509	L419	i1684	Y	L509	L410
i1685	Y	L510	L423	i1686	Y	L510	L424	i1687	Y	L510	L419	i1688	Y	L510	L410
i1689	Y	L511	L423	i1690	Y	L511	L424	i1691	Y	L511	L419	i1692	Y	L511	L410
i1693	Y	L512	L423	i1694	Y	L512	L424	i1695	Y	L512	L419	i1696	Y	L512	L410
i1697	Y	L513	L423	i1698	Y	L513	L424	i1699	Y	L513	L419	i1700	Y	L513	L410
i1701	Y	L514	L423	i1702	Y	L514	L424	i1703	Y	L514	L419	i1704	Y	L514	L410
i1705	Y	L515	L423	i1706	Y	L515	L424	i1707	Y	L515	L419	i1708	Y	L515	L410
i1709	Y	L516	L423	i1710	Y	L516	L424	i1711	Y	L516	L419	i1712	Y	L516	L410
i1713	Y	L517	L423	i1714	Y	L517	L424	i1715	Y	L517	L419	i1716	Y	L517	L410
i1717	Y	L518	L423	i1718	Y	L518	L424	i1719	Y	L518	L419	i1720	Y	L518	L410
i1721	Y	L519	L423	i1722	Y	L519	L424	i1723	Y	L519	L419	i1724	Y	L519	L410
i1725	Y	L520	L423	i1726	Y	L520	L424	i1727	Y	L520	L419	i1728	Y	L520	L410
i1729	Y	L521	L423	i1730	Y	L521	L424	i1731	Y	L521	L419	i1732	Y	L521	L410
i1733	Y	L522	L423	i1734	Y	L522	L424	i1735	Y	L522	L419	i1736	Y	L522	L410
i1737	Y	L523	L423	i1738	Y	L523	L424	i1739	Y	L523	L419	i1740	Y	L523	L410
i1741	Y	L524	L423	i1742	Y	L524	L424	i1743	Y	L524	L419	i1744	Y	L524	L410
i1745	Y	L525	L423	i1746	Y	L525	L424	i1747	Y	L525	L419	i1748	Y	L525	L410
i1749	Y	L526	L423	i1750	Y	L526	L424	i1751	Y	L526	L419	i1752	Y	L526	L410
i1753	Y	L527	L423	i1754	Y	L527	L424	i1755	Y	L527	L419	i1756	Y	L527	L410
i1757	Y	L528	L423	i1758	Y	L528	L424	i1759	Y	L528	L419	i1760	Y	L528	L410
i1761	Y	L529	L423	i1762	Y	L529	L424	i1763	Y	L529	L419	i1764	Y	L529	L410
i1765	Y	L530	L423	i1766	Y	L530	L424	i1767	Y	L530	L419	i1768	Y	L530	L410
i1769	Y	L531	L423	i1770	Y	L531	L424	i1771	Y	L531	L419	i1772	Y	L531	L410
i1773	Y	L532	L423	i1774	Y	L532	L424	i1775	Y	L532	L419	i1776	Y	L532	L410
i1777	Y	L533	L423	i1778	Y	L533	L424	i1779	Y	L533	L419	i1780	Y	L533	L410
i1781	Y	L534	L423	i1782	Y	L534	L424	i1783	Y	L534	L419	i1784	Y	L534	L410
i1785	Y	L535	L423	i1786	Y	L535	L424	i1787	Y	L535	L419	i1788	Y	L535	L410
i1789	Y	L536	L423	i1790	Y	L536	L424	i1791	Y	L536	L419	i1792	Y	L536	L410
i1793	Y	L537	L423	i1794	Y	L537	L424	i1795	Y	L537	L419	i1796	Y	L537	L410
i1797	Y	L538	L423	i1798	Y	L538	L424	i1799	Y	L538	L419	i1800	Y	L538	L410
i1801	Y	L539	L423	i1802	Y	L539	L424	i1803	Y	L539	L419	i1804	Y	L539	L410
i1805	Y	L540	L423	i1806	Y	L540	L424	i1807	Y	L540	L419	i1808	Y	L540	L410
i1809	Y	L541	L423	i1810	Y	L541	L424	i1811	Y	L541	L419	i1812	Y	L541	L410
i1813	Y	L542	L423	i1814	Y	L542	L424	i1815	Y	L542	L419	i1816	Y	L542	L410
i1817	Y	L543	L423	i1818	Y	L543	L424	i1819	Y	L543	L419	i1820	Y	L543	L410
i1821	Y	L544	L423	i1822	Y	L544	L424	i1823	Y	L544	L419	i1824	Y	L544	L410
i1825	Y	L545	L423	i1826	Y	L545	L424	i1827	Y	L545	L419	i1828	Y	L545	L410
i1829	Y	L546	L423	i1830	Y	L546	L424	i1831	Y	L546	L419	i1832	Y	L546	L410
i1833	Y	L547	L423	i1834	Y	L547	L424	i1835	Y	L547	L419	i1836	Y	L547	L410
i1837	Y	L548	L423	i1838	Y	L548	L424	i1839	Y	L548	L419	i1840	Y	L548	L410
i1841	Y	L549	L423	i1842	Y	L549	L424	i1843	Y	L549	L419	i1844	Y	L549	L410
i1845	Y	L550	L423	i1846	Y	L550	L424	i1847	Y	L550	L419	i1848	Y	L550	L410
i1849	Y	L551	L423	i1850	Y	L551	L424	i1851	Y	L551	L419	i1852	Y	L551	L410
i1853	Y	L552	L423	i1854	Y	L552	L424	i1855	Y	L552	L419	i1856	Y	L552	L410
i1857	Y	L553	L423	i1858	Y	L553	L424	i1859	Y	L553	L419	i1860	Y	L553	L410
i1861	Y	L554	L423	i1862	Y	L554	L424	i1863	Y	L554	L419	i1864	Y	L554	L410
i1865	Y	L555	L423	i1866	Y	L555	L424	i1867	Y	L555	L419	i1868	Y	L555	L410
i1869	Y	L556	L423	i1870	Y	L556	L424	i1871	Y	L556	L419	i1872	Y	L556	L410
i1873	Y	L557	L423	i1874	Y	L557	L424	i1875	Y	L557	L419	i1876	Y	L557	L410
i1877	Y	L558	L423	i1878	Y	L558	L424	i1879	Y	L558	L419	i1880	Y	L558	L410
i1881	Y	L559	L423	i1882	Y	L559	L424	i1883	Y	L559	L419	i1884	Y	L559	L410
i1885	Y	L560	L423	i1886	Y	L560	L424	i1887	Y	L560	L419	i1888	Y	L560	L410
i1889	Y	L561	L423	i1890	Y	L561	L424	i1891	Y	L561	L419	i1892	Y	L561	L410
i1893	Y	L562	L423	i1894	Y	L562	L424	i1895	Y	L562	L419	i1896	Y	L562	L410
i1897	Y	L563	L423	i1898	Y	L563	L424	i1899	Y	L563	L419	i1900	Y	L563	L410
i1901	Y	L564	L423	i1902	Y	L564	L424	i1903	Y	L564	L419	i1904	Y	L564	L410
i1905	Y	L565	L423	i1906	Y	L565	L424	i1907	Y	L565	L419	i1908	Y	L565	L410
i1909	Y	L566	L423	i1910	Y	L566	L424	i1911	Y	L566	L419	i1912	Y	L566	L410
i1913	Y	L567	L423	i1914	Y	L567	L424	i1915	Y	L567	L419	i1916	Y	L567	L410
i1917	Y	L568	L423	i1918	Y	L568	L424	i1919	Y	L568	L419	i1920	Y	L568	L410
i1921	Y	L569	L423	i1922	Y	L569	L424	i1923	Y	L569	L419	i1924	Y	L569	L410
i1925	Y	L570	L423	i1926	Y	L570	L424	i1927	Y	L570	L419	i1928	Y	L570	L410
i1929	Y	L571	L423	i1930	Y	L571	L424	i1931	Y	L571	L419	i1932	Y	L571	L410
i1933	Y	L572	L423	i1934	Y	L572	L424	i1935	Y	L572	L419	i1936	Y	L572	L410
i1937	Y	L843	L423	i1938	Y	L843	L424	i1939	Y	L843	L419	i1940	Y	L843	L410
i1941	Y	L844	L423	i1942	Y	L844	L424	i1943	Y	L844	L419	i1944	Y	L844	L410
i1945	Y	L845	L423	i1946	Y	L845	L424	i1947	Y	L845	L419	i1948	Y	L845	L410
i1949	Y	L846	L423	i1950	Y	L846	L424	i1951	Y	L846	L419	i1952	Y	L846	L410
i1953	Y	L847	L423	i1954	Y	L847	L424	i1955	Y	L847	L419	i1956	Y	L847	L410
i1957	Y	L848	L423	i1958	Y	L848	L424	i1959	Y	L848	L419	i1960	Y	L848	L410
i1961	Y	L10	L14	i1962	Y	L10	L572	i1963	Y	L10	L569	i1964	Y	L10	L528
i1965	Y	L11	L14	i1966	Y	L11	L572	i1967	Y	L11	L569	i1968	Y	L11	L528
i1969	Y	L20	L14	i1970	Y	L20	L572	i1971	Y	L20	L569	i1972	Y	L20	L528
i1973	Y	L21	L14	i1974	Y	L21	L572	i1975	Y	L21	L569	i1976	Y	L21	L528
i1977	Y	L22	L14	i1978	Y	L22	L572	i1979	Y	L22	L569	i1980	Y	L22	L528
i1981	Y	L23	L14	i1982	Y	L23	L572	i1983	Y	L23	L569	i1984	Y	L23	L528
i1985	Y	L24	L14	i1986	Y	L24	L572	i1987	Y	L24	L569	i1988	Y	L24	L528
i1989	Y	L25	L14	i1990	Y	L25	L572	i1991	Y	L25	L569	i1992	Y	L25	L528
i1993	Y	L26	L14	i1994	Y	L26	L572	i1995	Y	L26	L569	i1996	Y	L26	L528
i1997	Y	L27	L14	i1998	Y	L27	L572	i1999	Y	L27	L569	i2000	Y	L27	L528
i2001	Y	L28	L14	i2002	Y	L28	L572	i2003	Y	L28	L569	i2004	Y	L28	L528
i2005	Y	L12	L14	i2006	Y	L12	L572	i2007	Y	L12	L569	i2008	Y	L12	L528
i2009	Y	L13	L14	i2010	Y	L13	L572	i2011	Y	L13	L569	i2012	Y	L13	L528
i2013	Y	L14	L14	i2014	Y	L14	L572	i2015	Y	L14	L569	i2016	Y	L14	L528
i2017	Y	L15	L14	i2018	Y	L15	L572	i2019	Y	L15	L569	i2020	Y	L15	L528
i2021	Y	L16	L14	i2022	Y	L16	L572	i2023	Y	L16	L569	i2024	Y	L16	L528
i2025	Y	L17	L14	i2026	Y	L17	L572	i2027	Y	L17	L569	i2028	Y	L17	L528
i2029	Y	L18	L14	i2030	Y	L18	L572	i2031	Y	L18	L569	i2032	Y	L18	L528
i2033	Y	L19	L14	i2034	Y	L19	L572	i2035	Y	L19	L569	i2036	Y	L19	L528
i2037	Y	L2	L14	i2038	Y	L2	L572	i2039	Y	L2	L569	i2040	Y	L2	L528
i2041	Y	L101	L14	i2042	Y	L101	L572	i2043	Y	L101	L569	i2044	Y	L101	L528
i2045	Y	L102	L14	i2046	Y	L102	L572	i2047	Y	L102	L569	i2048	Y	L102	L528
i2049	Y	L103	L14	i2050	Y	L103	L572	i2051	Y	L103	L569	i2052	Y	L103	L528
i2053	Y	L104	L14	i2054	Y	L104	L572	i2055	Y	L104	L569	i2056	Y	L104	L528
i2057	Y	L105	L14	i2058	Y	L105	L572	i2059	Y	L105	L569	i2060	Y	L105	L528
i2061	Y	L106	L14	i2062	Y	L106	L572	i2063	Y	L106	L569	i2064	Y	L106	L528
i2065	Y	L107	L14	i2066	Y	L107	L572	i2067	Y	L107	L569	i2068	Y	L107	L528
i2069	Y	L108	L14	i2070	Y	L108	L572	i2071	Y	L108	L569	i2072	Y	L108	L528
i2073	Y	L109	L14	i2074	Y	L109	L572	i2075	Y	L109	L569	i2076	Y	L109	L528
i2077	Y	L110	L14	i2078	Y	L110	L572	i2079	Y	L110	L569	i2080	Y	L110	L528
i2081	Y	L111	L14	i2082	Y	L111	L572	i2083	Y	L111	L569	i2084	Y	L111	L528
i2085	Y	L112	L14	i2086	Y	L112	L572	i2087	Y	L112	L569	i2088	Y	L112	L528
i2089	Y	L113	L14	i2090	Y	L113	L572	i2091	Y	L113	L569	i2092	Y	L113	L528
i2093	Y	L114	L14	i2094	Y	L114	L572	i2095	Y	L114	L569	i2096	Y	L114	L528
i2097	Y	L115	L14	i2098	Y	L115	L572	i2099	Y	L115	L569	i2100	Y	L115	L528
i2101	Y	L116	L14	i2102	Y	L116	L572	i2103	Y	L116	L569	i2104	Y	L116	L528
i2105	Y	L117	L14	i2106	Y	L117	L572	i2107	Y	L117	L569	i2108	Y	L117	L528
i2109	Y	L118	L14	i2110	Y	L118	L572	i2111	Y	L118	L569	i2112	Y	L118	L528
i2113	Y	L119	L14	i2114	Y	L119	L572	i2115	Y	L119	L569	i2116	Y	L119	L528
i2117	Y	L120	L14	i2118	Y	L120	L572	i2119	Y	L120	L569	i2120	Y	L120	L528
i2121	Y	L121	L14	i2122	Y	L121	L572	i2123	Y	L121	L569	i2124	Y	L121	L528
i2125	Y	L122	L14	i2126	Y	L122	L572	i2127	Y	L122	L569	i2128	Y	L122	L528
i2129	Y	L123	L14	i2130	Y	L123	L572	i2131	Y	L123	L569	i2132	Y	L123	L528
i2133	Y	L124	L14	i2134	Y	L124	L572	i2135	Y	L124	L569	i2136	Y	L124	L528
i2137	Y	L125	L14	i2138	Y	L125	L572	i2139	Y	L125	L569	i2140	Y	L125	L528
i2141	Y	L126	L14	i2142	Y	L126	L572	i2143	Y	L126	L569	i2144	Y	L126	L528
i2145	Y	L127	L14	i2146	Y	L127	L572	i2147	Y	L127	L569	i2148	Y	L127	L528
i2149	Y	L128	L14	i2150	Y	L128	L572	i2151	Y	L128	L569	i2152	Y	L128	L528
i2153	Y	L129	L14	i2154	Y	L129	L572	i2155	Y	L129	L569	i2156	Y	L129	L528
i2157	Y	L130	L14	i2158	Y	L130	L572	i2159	Y	L130	L569	i2160	Y	L130	L528
i2161	Y	L131	L14	i2162	Y	L131	L572	i2163	Y	L131	L569	i2164	Y	L131	L528
i2165	Y	L132	L14	i2166	Y	L132	L572	i2167	Y	L132	L569	i2168	Y	L132	L528
i2169	Y	L133	L14	i2170	Y	L133	L572	i2171	Y	L133	L569	i2172	Y	L133	L528
i2173	Y	L134	L14	i2174	Y	L134	L572	i2175	Y	L134	L569	i2176	Y	L134	L528
i2177	Y	L135	L14	i2178	Y	L135	L572	i2179	Y	L135	L569	i2180	Y	L135	L528
i2181	Y	L136	L14	i2182	Y	L136	L572	i2183	Y	L136	L569	i2184	Y	L136	L528
i2185	Y	L137	L14	i2186	Y	L137	L572	i2187	Y	L137	L569	i2188	Y	L137	L528
i2189	Y	L138	L14	i2190	Y	L138	L572	i2191	Y	L138	L569	i2192	Y	L138	L528
i2193	Y	L139	L14	i2194	Y	L139	L572	i2195	Y	L139	L569	i2196	Y	L139	L528
i2197	Y	L140	L14	i2198	Y	L140	L572	i2199	Y	L140	L569	i2200	Y	L140	L528
i2201	Y	L141	L14	i2202	Y	L141	L572	i2203	Y	L141	L569	i2204	Y	L141	L528
i2205	Y	L142	L14	i2206	Y	L142	L572	i2207	Y	L142	L569	i2208	Y	L142	L528
i2209	Y	L143	L14	i2210	Y	L143	L572	i2211	Y	L143	L569	i2212	Y	L143	L528
i2213	Y	L144	L14	i2214	Y	L144	L572	i2215	Y	L144	L569	i2216	Y	L144	L528
i2217	Y	L145	L14	i2218	Y	L145	L572	i2219	Y	L145	L569	i2220	Y	L145	L528
i2221	Y	L146	L14	i2222	Y	L146	L572	i2223	Y	L146	L569	i2224	Y	L146	L528
i2225	Y	L147	L14	i2226	Y	L147	L572	i2227	Y	L147	L569	i2228	Y	L147	L528
i2229	Y	L148	L14	i2230	Y	L148	L572	i2231	Y	L148	L569	i2232	Y	L148	L528
i2233	Y	L149	L14	i2234	Y	L149	L572	i2235	Y	L149	L569	i2236	Y	L149	L528
i2237	Y	L150	L14	i2238	Y	L150	L572	i2239	Y	L150	L569	i2240	Y	L150	L528
i2241	Y	L151	L14	i2242	Y	L151	L572	i2243	Y	L151	L569	i2244	Y	L151	L528
i2245	Y	L152	L14	i2246	Y	L152	L572	i2247	Y	L152	L569	i2248	Y	L152	L528
i2249	Y	L153	L14	i2250	Y	L153	L572	i2251	Y	L153	L569	i2252	Y	L153	L528
i2253	Y	L154	L14	i2254	Y	L154	L572	i2255	Y	L154	L569	i2256	Y	L154	L528
i2257	Y	L155	L14	i2258	Y	L155	L572	i2259	Y	L155	L569	i2260	Y	L155	L528
i2261	Y	L156	L14	i2262	Y	L156	L572	i2263	Y	L156	L569	i2264	Y	L156	L528
i2265	Y	L157	L14	i2266	Y	L157	L572	i2267	Y	L157	L569	i2268	Y	L157	L528
i2269	Y	L158	L14	i2270	Y	L158	L572	i2271	Y	L158	L569	i2272	Y	L158	L528
i2273	Y	L159	L14	i2274	Y	L159	L572	i2275	Y	L159	L569	i2276	Y	L159	L528
i2277	Y	L160	L14	i2278	Y	L160	L572	i2279	Y	L160	L569	i2280	Y	L160	L528
i2281	Y	L161	L14	i2282	Y	L161	L572	i2283	Y	L161	L569	i2284	Y	L161	L528
i2285	Y	L162	L14	i2286	Y	L162	L572	i2287	Y	L162	L569	i2288	Y	L162	L528
i2289	Y	L163	L14	i2290	Y	L163	L572	i2291	Y	L163	L569	i2292	Y	L163	L528
i2293	Y	L164	L14	i2294	Y	L164	L572	i2295	Y	L164	L569	i2296	Y	L164	L528
i2297	Y	L165	L14	i2298	Y	L165	L572	i2299	Y	L165	L569	i2300	Y	L165	L528
i2301	Y	L166	L14	i2302	Y	L166	L572	i2303	Y	L166	L569	i2304	Y	L166	L528
i2305	Y	L167	L14	i2306	Y	L167	L572	i2307	Y	L167	L569	i2308	Y	L167	L528
i2309	Y	L168	L14	i2310	Y	L168	L572	i2311	Y	L168	L569	i2312	Y	L168	L528
i2313	Y	L169	L14	i2314	Y	L169	L572	i2315	Y	L169	L569	i2316	Y	L169	L528
i2317	Y	L170	L14	i2318	Y	L170	L572	i2319	Y	L170	L569	i2320	Y	L170	L528
i2321	Y	L171	L14	i2322	Y	L171	L572	i2323	Y	L171	L569	i2324	Y	L171	L528
i2325	Y	L172	L14	i2326	Y	L172	L572	i2327	Y	L172	L569	i2328	Y	L172	L528
i2329	Y	L173	L14	i2330	Y	L173	L572	i2331	Y	L173	L569	i2332	Y	L173	L528
i2333	Y	L174	L14	i2334	Y	L174	L572	i2335	Y	L174	L569	i2336	Y	L174	L528
i2337	Y	L175	L14	i2338	Y	L175	L572	i2339	Y	L175	L569	i2340	Y	L175	L528
i2341	Y	L176	L14	i2342	Y	L176	L572	i2343	Y	L176	L569	i2344	Y	L176	L528
i2345	Y	L177	L14	i2346	Y	L177	L572	i2347	Y	L177	L569	i2348	Y	L177	L528
i2349	Y	L178	L14	i2350	Y	L178	L572	i2351	Y	L178	L569	i2352	Y	L178	L528
i2353	Y	L179	L14	i2354	Y	L179	L572	i2355	Y	L179	L569	i2356	Y	L179	L528
i2357	Y	L180	L14	i2358	Y	L180	L572	i2359	Y	L180	L569	i2360	Y	L180	L528
i2361	Y	L181	L14	i2362	Y	L181	L572	i2363	Y	L181	L569	i2364	Y	L181	L528
i2365	Y	L182	L14	i2366	Y	L182	L572	i2367	Y	L182	L569	i2368	Y	L182	L528
i2369	Y	L183	L14	i2370	Y	L183	L572	i2371	Y	L183	L569	i2372	Y	L183	L528
i2373	Y	L184	L14	i2374	Y	L184	L572	i2375	Y	L184	L569	i2376	Y	L184	L528
i2377	Y	L185	L14	i2378	Y	L185	L572	i2379	Y	L185	L569	i2380	Y	L185	L528
i2381	Y	L186	L14	i2382	Y	L186	L572	i2383	Y	L186	L569	i2384	Y	L186	L528
i2385	Y	L187	L14	i2386	Y	L187	L572	i2387	Y	L187	L569	i2388	Y	L187	L528
i2389	Y	L188	L14	i2390	Y	L188	L572	i2391	Y	L188	L569	i2392	Y	L188	L528
i2393	Y	L189	L14	i2394	Y	L189	L572	i2395	Y	L189	L569	i2396	Y	L189	L528
i2397	Y	L190	L14	i2398	Y	L190	L572	i2399	Y	L190	L569	i2400	Y	L190	L528
i2401	Y	L191	L14	i2402	Y	L191	L572	i2403	Y	L191	L569	i2404	Y	L191	L528
i2405	Y	L192	L14	i2406	Y	L192	L572	i2407	Y	L192	L569	i2408	Y	L192	L528
i2409	Y	L193	L14	i2410	Y	L193	L572	i2411	Y	L193	L569	i2412	Y	L193	L528
i2413	Y	L194	L14	i2414	Y	L194	L572	i2415	Y	L194	L569	i2416	Y	L194	L528
i2417	Y	L195	L14	i2418	Y	L195	L572	i2419	Y	L195	L569	i2420	Y	L195	L528
i2421	Y	L196	L14	i2422	Y	L196	L572	i2423	Y	L196	L569	i2424	Y	L196	L528
i2425	Y	L197	L14	i2426	Y	L197	L572	i2427	Y	L197	L569	i2428	Y	L197	L528
i2429	Y	L198	L14	i2430	Y	L198	L572	i2431	Y	L198	L569	i2432	Y	L198	L528
i2433	Y	L199	L14	i2434	Y	L199	L572	i2435	Y	L199	L569	i2436	Y	L199	L528
i2437	Y	L200	L14	i2438	Y	L200	L572	i2439	Y	L200	L569	i2440	Y	L200	L528
i2441	Y	L201	L14	i2442	Y	L201	L572	i2443	Y	L201	L569	i2444	Y	L201	L528
i2445	Y	L202	L14	i2446	Y	L202	L572	i2447	Y	L202	L569	i2448	Y	L202	L528
i2449	Y	L203	L14	i2450	Y	L203	L572	i2451	Y	L203	L569	i2452	Y	L203	L528
i2453	Y	L204	L14	i2454	Y	L204	L572	i2455	Y	L204	L569	i2456	Y	L204	L528
i2457	Y	L205	L14	i2458	Y	L205	L572	i2459	Y	L205	L569	i2460	Y	L205	L528
i2461	Y	L206	L14	i2462	Y	L206	L572	i2463	Y	L206	L569	i2464	Y	L206	L528
i2465	Y	L207	L14	i2466	Y	L207	L572	i2467	Y	L207	L569	i2468	Y	L207	L528
i2469	Y	L208	L14	i2470	Y	L208	L572	i2471	Y	L208	L569	i2472	Y	L208	L528
i2473	Y	L209	L14	i2474	Y	L209	L572	i2475	Y	L209	L569	i2476	Y	L209	L528
i2477	Y	L210	L14	i2478	Y	L210	L572	i2479	Y	L210	L569	i2480	Y	L210	L528
i2481	Y	L211	L14	i2482	Y	L211	L572	i2483	Y	L211	L569	i2484	Y	L211	L528
i2485	Y	L212	L14	i2486	Y	L212	L572	i2487	Y	L212	L569	i2488	Y	L212	L528
i2489	Y	L213	L14	i2490	Y	L213	L572	i2491	Y	L213	L569	i2492	Y	L213	L528
i2493	Y	L214	L14	i2494	Y	L214	L572	i2495	Y	L214	L569	i2496	Y	L214	L528
i2497	Y	L215	L14	i2498	Y	L215	L572	i2499	Y	L215	L569	i2500	Y	L215	L528
i2501	Y	L216	L14	i2502	Y	L216	L572	i2503	Y	L216	L569	i2504	Y	L216	L528
i2505	Y	L217	L14	i2506	Y	L217	L572	i2507	Y	L217	L569	i2508	Y	L217	L528
i2509	Y	L218	L14	i2510	Y	L218	L572	i2511	Y	L218	L569	i2512	Y	L218	L528
i2513	Y	L219	L14	i2514	Y	L219	L572	i2515	Y	L219	L569	i2516	Y	L219	L528
i2517	Y	L220	L14	i2518	Y	L220	L572	i2519	Y	L220	L569	i2520	Y	L220	L528
i2521	Y	L221	L14	i2522	Y	L221	L572	i2523	Y	L221	L569	i2524	Y	L221	L528
i2525	Y	L222	L14	i2526	Y	L222	L572	i2527	Y	L222	L569	i2528	Y	L222	L528
i2529	Y	L401	L14	i2530	Y	L401	L572	i2531	Y	L401	L569	i2532	Y	L401	L528
i2533	Y	L402	L14	i2534	Y	L402	L572	i2535	Y	L402	L569	i2536	Y	L402	L528
i2537	Y	L403	L14	i2538	Y	L403	L572	i2539	Y	L403	L569	i2540	Y	L403	L528
i2541	Y	L404	L14	i2542	Y	L404	L572	i2543	Y	L404	L569	i2544	Y	L404	L528
i2545	Y	L405	L14	i2546	Y	L405	L572	i2547	Y	L405	L569	i2548	Y	L405	L528
i2549	Y	L406	L14	i2550	Y	L406	L572	i2551	Y	L406	L569	i2552	Y	L406	L528
i2553	Y	L407	L14	i2554	Y	L407	L572	i2555	Y	L407	L569	i2556	Y	L407	L528
i2557	Y	L408	L14	i2558	Y	L408	L572	i2559	Y	L408	L569	i2560	Y	L408	L528
i2561	Y	L409	L14	i2562	Y	L409	L572	i2563	Y	L409	L569	i2564	Y	L409	L528
i2565	Y	L410	L14	i2566	Y	L410	L572	i2567	Y	L410	L569	i2568	Y	L410	L528
i2569	Y	L411	L14	i2570	Y	L411	L572	i2571	Y	L411	L569	i2572	Y	L411	L528
i2573	Y	L412	L14	i2574	Y	L412	L572	i2575	Y	L412	L569	i2576	Y	L412	L528
i2577	Y	L413	L14	i2578	Y	L413	L572	i2579	Y	L413	L569	i2580	Y	L413	L528
i2581	Y	L414	L14	i2582	Y	L414	L572	i2583	Y	L414	L569	i2584	Y	L414	L528
i2585	Y	L415	L14	i2586	Y	L415	L572	i2587	Y	L415	L569	i2588	Y	L415	L528
i2589	Y	L416	L14	i2590	Y	L416	L572	i2591	Y	L416	L569	i2592	Y	L416	L528
i2593	Y	L417	L14	i2594	Y	L417	L572	i2595	Y	L417	L569	i2596	Y	L417	L528
i2597	Y	L418	L14	i2598	Y	L418	L572	i2599	Y	L418	L569	i2600	Y	L418	L528
i2601	Y	L419	L14	i2602	Y	L419	L572	i2603	Y	L419	L569	i2604	Y	L419	L528
i2605	Y	L420	L14	i2606	Y	L420	L572	i2607	Y	L420	L569	i2608	Y	L420	L528
i2609	Y	L421	L14	i2610	Y	L421	L572	i2611	Y	L421	L569	i2612	Y	L421	L528
i2613	Y	L422	L14	i2614	Y	L422	L572	i2615	Y	L422	L569	i2616	Y	L422	L528
i2617	Y	L423	L14	i2618	Y	L423	L572	i2619	Y	L423	L569	i2620	Y	L423	L528
i2621	Y	L424	L14	i2622	Y	L424	L572	i2623	Y	L424	L569	i2624	Y	L424	L528
i2625	Y	L425	L14	i2626	Y	L425	L572	i2627	Y	L425	L569	i2628	Y	L425	L528
i2629	Y	L501	L14	i2630	Y	L501	L572	i2631	Y	L501	L569	i2632	Y	L501	L528
i2633	Y	L502	L14	i2634	Y	L502	L572	i2635	Y	L502	L569	i2636	Y	L502	L528
i2637	Y	L503	L14	i2638	Y	L503	L572	i2639	Y	L503	L569	i2640	Y	L503	L528
i2641	Y	L504	L14	i2642	Y	L504	L572	i2643	Y	L504	L569	i2644	Y	L504	L528
i2645	Y	L505	L14	i2646	Y	L505	L572	i2647	Y	L505	L569	i2648	Y	L505	L528
i2649	Y	L506	L14	i2650	Y	L506	L572	i2651	Y	L506	L569	i2652	Y	L506	L528
i2653	Y	L507	L14	i2654	Y	L507	L572	i2655	Y	L507	L569	i2656	Y	L507	L528
i2657	Y	L508	L14	i2658	Y	L508	L572	i2659	Y	L508	L569	i2660	Y	L508	L528
i2661	Y	L509	L14	i2662	Y	L509	L572	i2663	Y	L509	L569	i2664	Y	L509	L528
i2665	Y	L510	L14	i2666	Y	L510	L572	i2667	Y	L510	L569	i2668	Y	L510	L528
i2669	Y	L511	L14	i2670	Y	L511	L572	i2671	Y	L511	L569	i2672	Y	L511	L528
i2673	Y	L512	L14	i2674	Y	L512	L572	i2675	Y	L512	L569	i2676	Y	L512	L528
i2677	Y	L513	L14	i2678	Y	L513	L572	i2679	Y	L513	L569	i2680	Y	L513	L528
i2681	Y	L514	L14	i2682	Y	L514	L572	i2683	Y	L514	L569	i2684	Y	L514	L528
i2685	Y	L515	L14	i2686	Y	L515	L572	i2687	Y	L515	L569	i2688	Y	L515	L528
i2689	Y	L516	L14	i2690	Y	L516	L572	i2691	Y	L516	L569	i2692	Y	L516	L528
i2693	Y	L517	L14	i2694	Y	L517	L572	i2695	Y	L517	L569	i2696	Y	L517	L528
i2697	Y	L518	L14	i2698	Y	L518	L572	i2699	Y	L518	L569	i2700	Y	L518	L528
i2701	Y	L519	L14	i2702	Y	L519	L572	i2703	Y	L519	L569	i2704	Y	L519	L528
i2705	Y	L520	L14	i2706	Y	L520	L572	i2707	Y	L520	L569	i2708	Y	L520	L528
i2709	Y	L521	L14	i2710	Y	L521	L572	i2711	Y	L521	L569	i2712	Y	L521	L528
i2713	Y	L522	L14	i2714	Y	L522	L572	i2715	Y	L522	L569	i2716	Y	L522	L528
i2717	Y	L523	L14	i2718	Y	L523	L572	i2719	Y	L523	L569	i2720	Y	L523	L528
i2721	Y	L524	L14	i2722	Y	L524	L572	i2723	Y	L524	L569	i2724	Y	L524	L528
i2725	Y	L525	L14	i2726	Y	L525	L572	i2727	Y	L525	L569	i2728	Y	L525	L528
i2729	Y	L526	L14	i2730	Y	L526	L572	i2731	Y	L526	L569	i2732	Y	L526	L528
i2733	Y	L527	L14	i2734	Y	L527	L572	i2735	Y	L527	L569	i2736	Y	L527	L528
i2737	Y	L528	L14	i2738	Y	L528	L572	i2739	Y	L528	L569	i2740	Y	L528	L528
i2741	Y	L529	L14	i2742	Y	L529	L572	i2743	Y	L529	L569	i2744	Y	L529	L528
i2745	Y	L530	L14	i2746	Y	L530	L572	i2747	Y	L530	L569	i2748	Y	L530	L528
i2749	Y	L531	L14	i2750	Y	L531	L572	i2751	Y	L531	L569	i2752	Y	L531	L528
i2753	Y	L532	L14	i2754	Y	L532	L572	i2755	Y	L532	L569	i2756	Y	L532	L528
i2757	Y	L533	L14	i2758	Y	L533	L572	i2759	Y	L533	L569	i2760	Y	L533	L528
i2761	Y	L534	L14	i2762	Y	L534	L572	i2763	Y	L534	L569	i2764	Y	L534	L528
i2765	Y	L535	L14	i2766	Y	L535	L572	i2767	Y	L535	L569	i2768	Y	L535	L528
i2769	Y	L536	L14	i2770	Y	L536	L572	i2771	Y	L536	L569	i2772	Y	L536	L528
i2773	Y	L537	L14	i2774	Y	L537	L572	i2775	Y	L537	L569	i2776	Y	L537	L528
i2777	Y	L538	L14	i2778	Y	L538	L572	i2779	Y	L538	L569	i2780	Y	L538	L528
i2781	Y	L539	L14	i2782	Y	L539	L572	i2783	Y	L539	L569	i2784	Y	L539	L528
i2785	Y	L540	L14	i2786	Y	L540	L572	i2787	Y	L540	L569	i2788	Y	L540	L528
i2789	Y	L541	L14	i2790	Y	L541	L572	i2791	Y	L541	L569	i2792	Y	L541	L528
i2793	Y	L542	L14	i2794	Y	L542	L572	i2795	Y	L542	L569	i2796	Y	L542	L528
i2797	Y	L543	L14	i2798	Y	L543	L572	i2799	Y	L543	L569	i2800	Y	L543	L528
i2801	Y	L544	L14	i2802	Y	L544	L572	i2803	Y	L544	L569	i2804	Y	L544	L528
i2805	Y	L545	L14	i2806	Y	L545	L572	i2807	Y	L545	L569	i2808	Y	L545	L528
i2809	Y	L546	L14	i2810	Y	L546	L572	i2811	Y	L546	L569	i2812	Y	L546	L528
i2813	Y	L547	L14	i2814	Y	L547	L572	i2815	Y	L547	L569	i2816	Y	L547	L528
i2817	Y	L548	L14	i2818	Y	L548	L572	i2819	Y	L548	L569	i2820	Y	L548	L528
i2821	Y	L549	L14	i2822	Y	L549	L572	i2823	Y	L549	L569	i2824	Y	L549	L528
i2825	Y	L550	L14	i2826	Y	L550	L572	i2827	Y	L550	L569	i2828	Y	L550	L528
i2829	Y	L551	L14	i2830	Y	L551	L572	i2831	Y	L551	L569	i2832	Y	L551	L528
i2833	Y	L552	L14	i2834	Y	L552	L572	i2835	Y	L552	L569	i2836	Y	L552	L528
i2837	Y	L553	L14	i2838	Y	L553	L572	i2839	Y	L553	L569	i2840	Y	L553	L528
i2841	Y	L554	L14	i2842	Y	L554	L572	i2843	Y	L554	L569	i2844	Y	L554	L528
i2845	Y	L555	L14	i2846	Y	L555	L572	i2847	Y	L555	L569	i2848	Y	L555	L528
i2849	Y	L556	L14	i2850	Y	L556	L572	i2851	Y	L556	L569	i2852	Y	L556	L528
i2853	Y	L557	L14	i2854	Y	L557	L572	i2855	Y	L557	L569	i2856	Y	L557	L528
i2857	Y	L558	L14	i2858	Y	L558	L572	i2859	Y	L558	L569	i2860	Y	L558	L528
i2861	Y	L559	L14	i2862	Y	L559	L572	i2863	Y	L559	L569	i2864	Y	L559	L528
i2865	Y	L560	L14	i2866	Y	L560	L572	i2867	Y	L560	L569	i2868	Y	L560	L528
i2869	Y	L561	L14	i2870	Y	L561	L572	i2871	Y	L561	L569	i2872	Y	L561	L528
i2873	Y	L562	L14	i2874	Y	L562	L572	i2875	Y	L562	L569	i2876	Y	L562	L528
i2877	Y	L563	L14	i2878	Y	L563	L572	i2879	Y	L563	L569	i2880	Y	L563	L528
i2881	Y	L564	L14	i2882	Y	L564	L572	i2883	Y	L564	L569	i2884	Y	L564	L528
i2885	Y	L565	L14	i2886	Y	L565	L572	i2887	Y	L565	L569	i2888	Y	L565	L528
i2889	Y	L566	L14	i2890	Y	L566	L572	i2891	Y	L566	L569	i2892	Y	L566	L528
i2893	Y	L567	L14	i2894	Y	L567	L572	i2895	Y	L567	L569	i2896	Y	L567	L528
i2897	Y	L568	L14	i2898	Y	L568	L572	i2899	Y	L568	L569	i2900	Y	L568	L528
i2901	Y	L569	L14	i2902	Y	L569	L572	i2903	Y	L569	L569	i2904	Y	L569	L528
i2905	Y	L570	L14	i2906	Y	L570	L572	i2907	Y	L570	L569	i2908	Y	L570	L528
i2909	Y	L571	L14	i2910	Y	L571	L572	i2911	Y	L571	L569	i2912	Y	L571	L528
i2913	Y	L572	L14	i2914	Y	L572	L572	i2915	Y	L572	L569	i2916	Y	L572	L528
i2917	Y	L843	L14	i2918	Y	L843	L572	i2919	Y	L843	L569	i2920	Y	L843	L528
i2921	Y	L844	L14	i2922	Y	L844	L572	i2923	Y	L844	L569	i2924	Y	L844	L528
i2925	Y	L845	L14	i2926	Y	L845	L572	i2927	Y	L845	L569	i2928	Y	L845	L528
i2929	Y	L846	L14	i2930	Y	L846	L572	i2931	Y	L846	L569	i2932	Y	L846	L528
i2933	Y	L847	L14	i2934	Y	L847	L572	i2935	Y	L847	L569	i2936	Y	L847	L528
i2937	Y	L848	L14	i2938	Y	L848	L572	i2939	Y	L848	L569	i2940	Y	L848	L528
i2941	Y	L10	L413	i2942	Y	L10	L404	i2943	Y	L10	L534	i2944	Y	L10	L188
i2945	Y	L11	L413	i2946	Y	L11	L404	i2947	Y	L11	L534	i2948	Y	L11	L188
i2949	Y	L20	L413	i2950	Y	L20	L404	i2951	Y	L20	L534	i2952	Y	L20	L188
i2953	Y	L21	L413	i2954	Y	L21	L404	i2955	Y	L21	L534	i2956	Y	L21	L188
i2957	Y	L22	L413	i2958	Y	L22	L404	i2959	Y	L22	L534	i2960	Y	L22	L188
i2961	Y	L23	L413	i2962	Y	L23	L404	i2963	Y	L23	L534	i2964	Y	L23	L188
i2965	Y	L24	L413	i2966	Y	L24	L404	i2967	Y	L24	L534	i2968	Y	L24	L188
i2969	Y	L25	L413	i2970	Y	L25	L404	i2971	Y	L25	L534	i2972	Y	L25	L188
i2973	Y	L26	L413	i2974	Y	L26	L404	i2975	Y	L26	L534	i2976	Y	L26	L188
i2977	Y	L27	L413	i2978	Y	L27	L404	i2979	Y	L27	L534	i2980	Y	L27	L188
i2981	Y	L28	L413	i2982	Y	L28	L404	i2983	Y	L28	L534	i2984	Y	L28	L188
i2985	Y	L12	L413	i2986	Y	L12	L404	i2987	Y	L12	L534	i2988	Y	L12	L188
i2989	Y	L13	L413	i2990	Y	L13	L404	i2991	Y	L13	L534	i2992	Y	L13	L188
i2993	Y	L14	L413	i2994	Y	L14	L404	i2995	Y	L14	L534	i2996	Y	L14	L188
i2997	Y	L15	L413	i2998	Y	L15	L404	i2999	Y	L15	L534	i3000	Y	L15	L188
i3001	Y	L16	L413	i3002	Y	L16	L404	i3003	Y	L16	L534	i3004	Y	L16	L188
i3005	Y	L17	L413	i3006	Y	L17	L404	i3007	Y	L17	L534	i3008	Y	L17	L188
i3009	Y	L18	L413	i3010	Y	L18	L404	i3011	Y	L18	L534	i3012	Y	L18	L188
i3013	Y	L19	L413	i3014	Y	L19	L404	i3015	Y	L19	L534	i3016	Y	L19	L188
i3017	Y	L2	L413	i3018	Y	L2	L404	i3019	Y	L2	L534	i3020	Y	L2	L188
i3021	Y	L101	L413	i3022	Y	L101	L404	i3023	Y	L101	L534	i3024	Y	L101	L188
i3025	Y	L102	L413	i3026	Y	L102	L404	i3027	Y	L102	L534	i3028	Y	L102	L188
i3029	Y	L103	L413	i3030	Y	L103	L404	i3031	Y	L103	L534	i3032	Y	L103	L188
i3033	Y	L104	L413	i3034	Y	L104	L404	i3035	Y	L104	L534	i3036	Y	L104	L188
i3037	Y	L105	L413	i3038	Y	L105	L404	i3039	Y	L105	L534	i3040	Y	L105	L188
i3041	Y	L106	L413	i3042	Y	L106	L404	i3043	Y	L106	L534	i3044	Y	L106	L188
i3045	Y	L107	L413	i3046	Y	L107	L404	i3047	Y	L107	L534	i3048	Y	L107	L188
i3049	Y	L108	L413	i3050	Y	L108	L404	i3051	Y	L108	L534	i3052	Y	L108	L188
i3053	Y	L109	L413	i3054	Y	L109	L404	i3055	Y	L109	L534	i3056	Y	L109	L188
i3057	Y	L110	L413	i3058	Y	L110	L404	i3059	Y	L110	L534	i3060	Y	L110	L188
i3061	Y	L111	L413	i3062	Y	L111	L404	i3063	Y	L111	L534	i3064	Y	L111	L188
i3065	Y	L112	L413	i3066	Y	L112	L404	i3067	Y	L112	L534	i3068	Y	L112	L188
i3069	Y	L113	L413	i3070	Y	L113	L404	i3071	Y	L113	L534	i3072	Y	L113	L188
i3073	Y	L114	L413	i3074	Y	L114	L404	i3075	Y	L114	L534	i3076	Y	L114	L188
i3077	Y	L115	L413	i3078	Y	L115	L404	i3079	Y	L115	L534	i3080	Y	L115	L188
i3081	Y	L116	L413	i3082	Y	L116	L404	i3083	Y	L116	L534	i3084	Y	L116	L188
i3085	Y	L117	L413	i3086	Y	L117	L404	i3087	Y	L117	L534	i3088	Y	L117	L188
i3089	Y	L118	L413	i3090	Y	L118	L404	i3091	Y	L118	L534	i3092	Y	L118	L188
i3093	Y	L119	L413	i3094	Y	L119	L404	i3095	Y	L119	L534	i3096	Y	L119	L188
i3097	Y	L120	L413	i3098	Y	L120	L404	i3099	Y	L120	L534	i3100	Y	L120	L188
i3101	Y	L121	L413	i3102	Y	L121	L404	i3103	Y	L121	L534	i3104	Y	L121	L188
i3105	Y	L122	L413	i3106	Y	L122	L404	i3107	Y	L122	L534	i3108	Y	L122	L188
i3109	Y	L123	L413	i3110	Y	L123	L404	i3111	Y	L123	L534	i3112	Y	L123	L188
i3113	Y	L124	L413	i3114	Y	L124	L404	i3115	Y	L124	L534	i3116	Y	L124	L188
i3117	Y	L125	L413	i3118	Y	L125	L404	i3119	Y	L125	L534	i3120	Y	L125	L188
i3121	Y	L126	L413	i3122	Y	L126	L404	i3123	Y	L126	L534	i3124	Y	L126	L188
i3125	Y	L127	L413	i3126	Y	L127	L404	i3127	Y	L127	L534	i3128	Y	L127	L188
i3129	Y	L128	L413	i3130	Y	L128	L404	i3131	Y	L128	L534	i3132	Y	L128	L188
i3133	Y	L129	L413	i3134	Y	L129	L404	i3135	Y	L129	L534	i3136	Y	L129	L188
i3137	Y	L130	L413	i3138	Y	L130	L404	i3139	Y	L130	L534	i3140	Y	L130	L188
i3141	Y	L131	L413	i3142	Y	L131	L404	i3143	Y	L131	L534	i3144	Y	L131	L188
i3145	Y	L132	L413	i3146	Y	L132	L404	i3147	Y	L132	L534	i3148	Y	L132	L188
i3149	Y	L133	L413	i3150	Y	L133	L404	i3151	Y	L133	L534	i3152	Y	L133	L188
i3153	Y	L134	L413	i3154	Y	L134	L404	i3155	Y	L134	L534	i3156	Y	L134	L188
i3157	Y	L135	L413	i3158	Y	L135	L404	i3159	Y	L135	L534	i3160	Y	L135	L188
i3161	Y	L136	L413	i3162	Y	L136	L404	i3163	Y	L136	L534	i3164	Y	L136	L188
i3165	Y	L137	L413	i3166	Y	L137	L404	i3167	Y	L137	L534	i3168	Y	L137	L188
i3169	Y	L138	L413	i3170	Y	L138	L404	i3171	Y	L138	L534	i3172	Y	L138	L188
i3173	Y	L139	L413	i3174	Y	L139	L404	i3175	Y	L139	L534	i3176	Y	L139	L188
i3177	Y	L140	L413	i3178	Y	L140	L404	i3179	Y	L140	L534	i3180	Y	L140	L188
i3181	Y	L141	L413	i3182	Y	L141	L404	i3183	Y	L141	L534	i3184	Y	L141	L188
i3185	Y	L142	L413	i3186	Y	L142	L404	i3187	Y	L142	L534	i3188	Y	L142	L188
i3189	Y	L143	L413	i3190	Y	L143	L404	i3191	Y	L143	L534	i3192	Y	L143	L188
i3193	Y	L144	L413	i3194	Y	L144	L404	i3195	Y	L144	L534	i3196	Y	L144	L188
i3197	Y	L145	L413	i3198	Y	L145	L404	i3199	Y	L145	L534	i3200	Y	L145	L188
i3201	Y	L146	L413	i3202	Y	L146	L404	i3203	Y	L146	L534	i3204	Y	L146	L188
i3205	Y	L147	L413	i3206	Y	L147	L404	i3207	Y	L147	L534	i3208	Y	L147	L188
i3209	Y	L148	L413	i3210	Y	L148	L404	i3211	Y	L148	L534	i3212	Y	L148	L188
i3213	Y	L149	L413	i3214	Y	L149	L404	i3215	Y	L149	L534	i3216	Y	L149	L188
i3217	Y	L150	L413	i3218	Y	L150	L404	i3219	Y	L150	L534	i3220	Y	L150	L188
i3221	Y	L151	L413	i3222	Y	L151	L404	i3223	Y	L151	L534	i3224	Y	L151	L188
i3225	Y	L152	L413	i3226	Y	L152	L404	i3227	Y	L152	L534	i3228	Y	L152	L188
i3229	Y	L153	L413	i3230	Y	L153	L404	i3231	Y	L153	L534	i3232	Y	L153	L188
i3233	Y	L154	L413	i3234	Y	L154	L404	i3235	Y	L154	L534	i3236	Y	L154	L188
i3237	Y	L155	L413	i3238	Y	L155	L404	i3239	Y	L155	L534	i3240	Y	L155	L188
i3241	Y	L156	L413	i3242	Y	L156	L404	i3243	Y	L156	L534	i3244	Y	L156	L188
i3245	Y	L157	L413	i3246	Y	L157	L404	i3247	Y	L157	L534	i3248	Y	L157	L188
i3249	Y	L158	L413	i3250	Y	L158	L404	i3251	Y	L158	L534	i3252	Y	L158	L188
i3253	Y	L159	L413	i3254	Y	L159	L404	i3255	Y	L159	L534	i3256	Y	L159	L188
i3257	Y	L160	L413	i3258	Y	L160	L404	i3259	Y	L160	L534	i3260	Y	L160	L188
i3261	Y	L161	L413	i3262	Y	L161	L404	i3263	Y	L161	L534	i3264	Y	L161	L188
i3265	Y	L162	L413	i3266	Y	L162	L404	i3267	Y	L162	L534	i3268	Y	L162	L188
i3269	Y	L163	L413	i3270	Y	L163	L404	i3271	Y	L163	L534	i3272	Y	L163	L188
i3273	Y	L164	L413	i3274	Y	L164	L404	i3275	Y	L164	L534	i3276	Y	L164	L188
i3277	Y	L165	L413	i3278	Y	L165	L404	i3279	Y	L165	L534	i3280	Y	L165	L188
i3281	Y	L166	L413	i3282	Y	L166	L404	i3283	Y	L166	L534	i3284	Y	L166	L188
i3285	Y	L167	L413	i3286	Y	L167	L404	i3287	Y	L167	L534	i3288	Y	L167	L188
i3289	Y	L168	L413	i3290	Y	L168	L404	i3291	Y	L168	L534	i3292	Y	L168	L188
i3293	Y	L169	L413	i3294	Y	L169	L404	i3295	Y	L169	L534	i3296	Y	L169	L188
i3297	Y	L170	L413	i3298	Y	L170	L404	i3299	Y	L170	L534	i3300	Y	L170	L188
i3301	Y	L171	L413	i3302	Y	L171	L404	i3303	Y	L171	L534	i3304	Y	L171	L188
i3305	Y	L172	L413	i3306	Y	L172	L404	i3307	Y	L172	L534	i3308	Y	L172	L188
i3309	Y	L173	L413	i3310	Y	L173	L404	i3311	Y	L173	L534	i3312	Y	L173	L188
i3313	Y	L174	L413	i3314	Y	L174	L404	i3315	Y	L174	L534	i3316	Y	L174	L188
i3317	Y	L175	L413	i3318	Y	L175	L404	i3319	Y	L175	L534	i3320	Y	L175	L188
i3321	Y	L176	L413	i3322	Y	L176	L404	i3323	Y	L176	L534	i3324	Y	L176	L188
i3325	Y	L177	L413	i3326	Y	L177	L404	i3327	Y	L177	L534	i3328	Y	L177	L188
i3329	Y	L178	L413	i3330	Y	L178	L404	i3331	Y	L178	L534	i3332	Y	L178	L188
i3333	Y	L179	L413	i3334	Y	L179	L404	i3335	Y	L179	L534	i3336	Y	L179	L188
i3337	Y	L180	L413	i3338	Y	L180	L404	i3339	Y	L180	L534	i3340	Y	L180	L188
i3341	Y	L181	L413	i3342	Y	L181	L404	i3343	Y	L181	L534	i3344	Y	L181	L188
i3345	Y	L182	L413	i3346	Y	L182	L404	i3347	Y	L182	L534	i3348	Y	L182	L188
i3349	Y	L183	L413	i3350	Y	L183	L404	i3351	Y	L183	L534	i3352	Y	L183	L188
i3353	Y	L184	L413	i3354	Y	L184	L404	i3355	Y	L184	L534	i3356	Y	L184	L188
i3357	Y	L185	L413	i3358	Y	L185	L404	i3359	Y	L185	L534	i3360	Y	L185	L188
i3361	Y	L186	L413	i3362	Y	L186	L404	i3363	Y	L186	L534	i3364	Y	L186	L188
i3365	Y	L187	L413	i3366	Y	L187	L404	i3367	Y	L187	L534	i3368	Y	L187	L188
i3369	Y	L188	L413	i3370	Y	L188	L404	i3371	Y	L188	L534	i3372	Y	L188	L188
i3373	Y	L189	L413	i3374	Y	L189	L404	i3375	Y	L189	L534	i3376	Y	L189	L188
i3377	Y	L190	L413	i3378	Y	L190	L404	i3379	Y	L190	L534	i3380	Y	L190	L188
i3381	Y	L191	L413	i3382	Y	L191	L404	i3383	Y	L191	L534	i3384	Y	L191	L188
i3385	Y	L192	L413	i3386	Y	L192	L404	i3387	Y	L192	L534	i3388	Y	L192	L188
i3389	Y	L193	L413	i3390	Y	L193	L404	i3391	Y	L193	L534	i3392	Y	L193	L188
i3393	Y	L194	L413	i3394	Y	L194	L404	i3395	Y	L194	L534	i3396	Y	L194	L188
i3397	Y	L195	L413	i3398	Y	L195	L404	i3399	Y	L195	L534	i3400	Y	L195	L188
i3401	Y	L196	L413	i3402	Y	L196	L404	i3403	Y	L196	L534	i3404	Y	L196	L188
i3405	Y	L197	L413	i3406	Y	L197	L404	i3407	Y	L197	L534	i3408	Y	L197	L188
i3409	Y	L198	L413	i3410	Y	L198	L404	i3411	Y	L198	L534	i3412	Y	L198	L188
i3413	Y	L199	L413	i3414	Y	L199	L404	i3415	Y	L199	L534	i3416	Y	L199	L188
i3417	Y	L200	L413	i3418	Y	L200	L404	i3419	Y	L200	L534	i3420	Y	L200	L188
i3421	Y	L201	L413	i3422	Y	L201	L404	i3423	Y	L201	L534	i3424	Y	L201	L188
i3425	Y	L202	L413	i3426	Y	L202	L404	i3427	Y	L202	L534	i3428	Y	L202	L188
i3429	Y	L203	L413	i3430	Y	L203	L404	i3431	Y	L203	L534	i3432	Y	L203	L188
i3433	Y	L204	L413	i3434	Y	L204	L404	i3435	Y	L204	L534	i3436	Y	L204	L188
i3437	Y	L205	L413	i3438	Y	L205	L404	i3439	Y	L205	L534	i3440	Y	L205	L188
i3441	Y	L206	L413	i3442	Y	L206	L404	i3443	Y	L206	L534	i3444	Y	L206	L188
i3445	Y	L207	L413	i3446	Y	L207	L404	i3447	Y	L207	L534	i3448	Y	L207	L188
i3449	Y	L208	L413	i3450	Y	L208	L404	i3451	Y	L208	L534	i3452	Y	L208	L188
i3453	Y	L209	L413	i3454	Y	L209	L404	i3455	Y	L209	L534	i3456	Y	L209	L188
i3457	Y	L210	L413	i3458	Y	L210	L404	i3459	Y	L210	L534	i3460	Y	L210	L188
i3461	Y	L211	L413	i3462	Y	L211	L404	i3463	Y	L211	L534	i3464	Y	L211	L188
i3465	Y	L212	L413	i3466	Y	L212	L404	i3467	Y	L212	L534	i3468	Y	L212	L188
i3469	Y	L213	L413	i3470	Y	L213	L404	i3471	Y	L213	L534	i3472	Y	L213	L188
i3473	Y	L214	L413	i3474	Y	L214	L404	i3475	Y	L214	L534	i3476	Y	L214	L188
i3477	Y	L215	L413	i3478	Y	L215	L404	i3479	Y	L215	L534	i3480	Y	L215	L188
i3481	Y	L216	L413	i3482	Y	L216	L404	i3483	Y	L216	L534	i3484	Y	L216	L188
i3485	Y	L217	L413	i3486	Y	L217	L404	i3487	Y	L217	L534	i3488	Y	L217	L188
i3489	Y	L218	L413	i3490	Y	L218	L404	i3491	Y	L218	L534	i3492	Y	L218	L188
i3493	Y	L219	L413	i3494	Y	L219	L404	i3495	Y	L219	L534	i3496	Y	L219	L188
i3497	Y	L220	L413	i3498	Y	L220	L404	i3499	Y	L220	L534	i3500	Y	L220	L188
i3501	Y	L221	L413	i3502	Y	L221	L404	i3503	Y	L221	L534	i3504	Y	L221	L188
i3505	Y	L222	L413	i3506	Y	L222	L404	i3507	Y	L222	L534	i3508	Y	L222	L188
i3509	Y	L401	L413	i3510	Y	L401	L404	i3511	Y	L401	L534	i3512	Y	L401	L188
i3513	Y	L402	L413	i3514	Y	L402	L404	i3515	Y	L402	L534	i3516	Y	L402	L188
i3517	Y	L403	L413	i3518	Y	L403	L404	i3519	Y	L403	L534	i3520	Y	L403	L188
i3521	Y	L404	L413	i3522	Y	L404	L404	i3523	Y	L404	L534	i3524	Y	L404	L188
i3525	Y	L405	L413	i3526	Y	L405	L404	i3527	Y	L405	L534	i3528	Y	L405	L188
i3529	Y	L406	L413	i3530	Y	L406	L404	i3531	Y	L406	L534	i3532	Y	L406	L188
i3533	Y	L407	L413	i3534	Y	L407	L404	i3535	Y	L407	L534	i3536	Y	L407	L188
i3537	Y	L408	L413	i3538	Y	L408	L404	i3539	Y	L408	L534	i3540	Y	L408	L188
i3541	Y	L409	L413	i3542	Y	L409	L404	i3543	Y	L409	L534	i3544	Y	L409	L188
i3545	Y	L410	L413	i3546	Y	L410	L404	i3547	Y	L410	L534	i3548	Y	L410	L188
i3549	Y	L411	L413	i3550	Y	L411	L404	i3551	Y	L411	L534	i3552	Y	L411	L188
i3553	Y	L412	L413	i3554	Y	L412	L404	i3555	Y	L412	L534	i3556	Y	L412	L188
i3557	Y	L413	L413	i3558	Y	L413	L404	i3559	Y	L413	L534	i3560	Y	L413	L188
i3561	Y	L414	L413	i3562	Y	L414	L404	i3563	Y	L414	L534	i3564	Y	L414	L188
i3565	Y	L415	L413	i3566	Y	L415	L404	i3567	Y	L415	L534	i3568	Y	L415	L188
i3569	Y	L416	L413	i3570	Y	L416	L404	i3571	Y	L416	L534	i3572	Y	L416	L188
i3573	Y	L417	L413	i3574	Y	L417	L404	i3575	Y	L417	L534	i3576	Y	L417	L188
i3577	Y	L418	L413	i3578	Y	L418	L404	i3579	Y	L418	L534	i3580	Y	L418	L188
i3581	Y	L419	L413	i3582	Y	L419	L404	i3583	Y	L419	L534	i3584	Y	L419	L188
i3585	Y	L420	L413	i3586	Y	L420	L404	i3587	Y	L420	L534	i3588	Y	L420	L188
i3589	Y	L421	L413	i3590	Y	L421	L404	i3591	Y	L421	L534	i3592	Y	L421	L188
i3593	Y	L422	L413	i3594	Y	L422	L404	i3595	Y	L422	L534	i3596	Y	L422	L188
i3597	Y	L423	L413	i3598	Y	L423	L404	i3599	Y	L423	L534	i3600	Y	L423	L188
i3601	Y	L424	L413	i3602	Y	L424	L404	i3603	Y	L424	L534	i3604	Y	L424	L188
i3605	Y	L425	L413	i3606	Y	L425	L404	i3607	Y	L425	L534	i3608	Y	L425	L188
i3609	Y	L501	L413	i3610	Y	L501	L404	i3611	Y	L501	L534	i3612	Y	L501	L188
i3613	Y	L502	L413	i3614	Y	L502	L404	i3615	Y	L502	L534	i3616	Y	L502	L188
i3617	Y	L503	L413	i3618	Y	L503	L404	i3619	Y	L503	L534	i3620	Y	L503	L188
i3621	Y	L504	L413	i3622	Y	L504	L404	i3623	Y	L504	L534	i3624	Y	L504	L188
i3625	Y	L505	L413	i3626	Y	L505	L404	i3627	Y	L505	L534	i3628	Y	L505	L188
i3629	Y	L506	L413	i3630	Y	L506	L404	i3631	Y	L506	L534	i3632	Y	L506	L188
i3633	Y	L507	L413	i3634	Y	L507	L404	i3635	Y	L507	L534	i3636	Y	L507	L188
i3637	Y	L508	L413	i3638	Y	L508	L404	i3639	Y	L508	L534	i3640	Y	L508	L188
i3641	Y	L509	L413	i3642	Y	L509	L404	i3643	Y	L509	L534	i3644	Y	L509	L188
i3645	Y	L510	L413	i3646	Y	L510	L404	i3647	Y	L510	L534	i3648	Y	L510	L188
i3649	Y	L511	L413	i3650	Y	L511	L404	i3651	Y	L511	L534	i3652	Y	L511	L188
i3653	Y	L512	L413	i3654	Y	L512	L404	i3655	Y	L512	L534	i3656	Y	L512	L188
i3657	Y	L513	L413	i3658	Y	L513	L404	i3659	Y	L513	L534	i3660	Y	L513	L188
i3661	Y	L514	L413	i3662	Y	L514	L404	i3663	Y	L514	L534	i3664	Y	L514	L188
i3665	Y	L515	L413	i3666	Y	L515	L404	i3667	Y	L515	L534	i3668	Y	L515	L188
i3669	Y	L516	L413	i3670	Y	L516	L404	i3671	Y	L516	L534	i3672	Y	L516	L188
i3673	Y	L517	L413	i3674	Y	L517	L404	i3675	Y	L517	L534	i3676	Y	L517	L188
i3677	Y	L518	L413	i3678	Y	L518	L404	i3679	Y	L518	L534	i3680	Y	L518	L188
i3681	Y	L519	L413	i3682	Y	L519	L404	i3683	Y	L519	L534	i3684	Y	L519	L188
i3685	Y	L520	L413	i3686	Y	L520	L404	i3687	Y	L520	L534	i3688	Y	L520	L188
i3689	Y	L521	L413	i3690	Y	L521	L404	i3691	Y	L521	L534	i3692	Y	L521	L188
i3693	Y	L522	L413	i3694	Y	L522	L404	i3695	Y	L522	L534	i3696	Y	L522	L188
i3697	Y	L523	L413	i3698	Y	L523	L404	i3699	Y	L523	L534	i3700	Y	L523	L188
i3701	Y	L524	L413	i3702	Y	L524	L404	i3703	Y	L524	L534	i3704	Y	L524	L188
i3705	Y	L525	L413	i3706	Y	L525	L404	i3707	Y	L525	L534	i3708	Y	L525	L188
i3709	Y	L526	L413	i3710	Y	L526	L404	i3711	Y	L526	L534	i3712	Y	L526	L188
i3713	Y	L527	L413	i3714	Y	L527	L404	i3715	Y	L527	L534	i3716	Y	L527	L188
i3717	Y	L528	L413	i3718	Y	L528	L404	i3719	Y	L528	L534	i3720	Y	L528	L188
i3721	Y	L529	L413	i3722	Y	L529	L404	i3723	Y	L529	L534	i3724	Y	L529	L188
i3725	Y	L530	L413	i3726	Y	L530	L404	i3727	Y	L530	L534	i3728	Y	L530	L188
i3729	Y	L531	L413	i3730	Y	L531	L404	i3731	Y	L531	L534	i3732	Y	L531	L188
i3733	Y	L532	L413	i3734	Y	L532	L404	i3735	Y	L532	L534	i3736	Y	L532	L188
i3737	Y	L533	L413	i3738	Y	L533	L404	i3739	Y	L533	L534	i3740	Y	L533	L188
i3741	Y	L534	L413	i3742	Y	L534	L404	i3743	Y	L534	L534	i3744	Y	L534	L188
i3745	Y	L535	L413	i3746	Y	L535	L404	i3747	Y	L535	L534	i3748	Y	L535	L188
i3749	Y	L536	L413	i3750	Y	L536	L404	i3751	Y	L536	L534	i3752	Y	L536	L188
i3753	Y	L537	L413	i3754	Y	L537	L404	i3755	Y	L537	L534	i3756	Y	L537	L188
i3757	Y	L538	L413	i3758	Y	L538	L404	i3759	Y	L538	L534	i3760	Y	L538	L188
i3761	Y	L539	L413	i3762	Y	L539	L404	i3763	Y	L539	L534	i3764	Y	L539	L188
i3765	Y	L540	L413	i3766	Y	L540	L404	i3767	Y	L540	L534	i3768	Y	L540	L188
i3769	Y	L541	L413	i3770	Y	L541	L404	i3771	Y	L541	L534	i3772	Y	L541	L188
i3773	Y	L542	L413	i3774	Y	L542	L404	i3775	Y	L542	L534	i3776	Y	L542	L188
i3777	Y	L543	L413	i3778	Y	L543	L404	i3779	Y	L543	L534	i3780	Y	L543	L188
i3781	Y	L544	L413	i3782	Y	L544	L404	i3783	Y	L544	L534	i3784	Y	L544	L188
i3785	Y	L545	L413	i3786	Y	L545	L404	i3787	Y	L545	L534	i3788	Y	L545	L188
i3789	Y	L546	L413	i3790	Y	L546	L404	i3791	Y	L546	L534	i3792	Y	L546	L188
i3793	Y	L547	L413	i3794	Y	L547	L404	i3795	Y	L547	L534	i3796	Y	L547	L188
i3797	Y	L548	L413	i3798	Y	L548	L404	i3799	Y	L548	L534	i3800	Y	L548	L188
i3801	Y	L549	L413	i3802	Y	L549	L404	i3803	Y	L549	L534	i3804	Y	L549	L188
i3805	Y	L550	L413	i3806	Y	L550	L404	i3807	Y	L550	L534	i3808	Y	L550	L188
i3809	Y	L551	L413	i3810	Y	L551	L404	i3811	Y	L551	L534	i3812	Y	L551	L188
i3813	Y	L552	L413	i3814	Y	L552	L404	i3815	Y	L552	L534	i3816	Y	L552	L188
i3817	Y	L553	L413	i3818	Y	L553	L404	i3819	Y	L553	L534	i3820	Y	L553	L188
i3821	Y	L554	L413	i3822	Y	L554	L404	i3823	Y	L554	L534	i3824	Y	L554	L188
i3825	Y	L555	L413	i3826	Y	L555	L404	i3827	Y	L555	L534	i3828	Y	L555	L188
i3829	Y	L556	L413	i3830	Y	L556	L404	i3831	Y	L556	L534	i3832	Y	L556	L188
i3833	Y	L557	L413	i3834	Y	L557	L404	i3835	Y	L557	L534	i3836	Y	L557	L188
i3837	Y	L558	L413	i3838	Y	L558	L404	i3839	Y	L558	L534	i3840	Y	L558	L188
i3841	Y	L559	L413	i3842	Y	L559	L404	i3843	Y	L559	L534	i3844	Y	L559	L188
i3845	Y	L560	L413	i3846	Y	L560	L404	i3847	Y	L560	L534	i3848	Y	L560	L188
i3849	Y	L561	L413	i3850	Y	L561	L404	i3851	Y	L561	L534	i3852	Y	L561	L188
i3853	Y	L562	L413	i3854	Y	L562	L404	i3855	Y	L562	L534	i3856	Y	L562	L188
i3857	Y	L563	L413	i3858	Y	L563	L404	i3859	Y	L563	L534	i3860	Y	L563	L188
i3861	Y	L564	L413	i3862	Y	L564	L404	i3863	Y	L564	L534	i3864	Y	L564	L188
i3865	Y	L565	L413	i3866	Y	L565	L404	i3867	Y	L565	L534	i3868	Y	L565	L188
i3869	Y	L566	L413	i3870	Y	L566	L404	i3871	Y	L566	L534	i3872	Y	L566	L188
i3873	Y	L567	L413	i3874	Y	L567	L404	i3875	Y	L567	L534	i3876	Y	L567	L188
i3877	Y	L568	L413	i3878	Y	L568	L404	i3879	Y	L568	L534	i3880	Y	L568	L188
i3881	Y	L569	L413	i3882	Y	L569	L404	i3883	Y	L569	L534	i3884	Y	L569	L188
i3885	Y	L570	L413	i3886	Y	L570	L404	i3887	Y	L570	L534	i3888	Y	L570	L188
i3889	Y	L571	L413	i3890	Y	L571	L404	i3891	Y	L571	L534	i3892	Y	L571	L188
i3893	Y	L572	L413	i3894	Y	L572	L404	i3895	Y	L572	L534	i3896	Y	L572	L188
i3897	Y	L843	L413	i3898	Y	L843	L404	i3899	Y	L843	L534	i3900	Y	L843	L188
i3901	Y	L844	L413	i3902	Y	L844	L404	i3903	Y	L844	L534	i3904	Y	L844	L188
i3905	Y	L845	L413	i3906	Y	L845	L404	i3907	Y	L845	L534	i3908	Y	L845	L188
i3909	Y	L846	L413	i3910	Y	L846	L404	i3911	Y	L846	L534	i3912	Y	L846	L188
i3913	Y	L847	L413	i3914	Y	L847	L404	i3915	Y	L847	L534	i3916	Y	L847	L188
i3917	Y	L848	L413	i3918	Y	L848	L404	i3919	Y	L848	L534	i3920	Y	L848	L188
i3921	Y	L10	L179	i3922	Y	L10	L180	i3923	Y	L10	L196	i3924	Y	L10	L217
i3925	Y	L11	L179	i3926	Y	L11	L180	i3927	Y	L11	L196	i3928	Y	L11	L217
i3929	Y	L20	L179	i3930	Y	L20	L180	i3931	Y	L20	L196	i3932	Y	L20	L217
i3933	Y	L21	L179	i3934	Y	L21	L180	i3935	Y	L21	L196	i3936	Y	L21	L217
i3937	Y	L22	L179	i3938	Y	L22	L180	i3939	Y	L22	L196	i3940	Y	L22	L217
i3941	Y	L23	L179	i3942	Y	L23	L180	i3943	Y	L23	L196	i3944	Y	L23	L217
i3945	Y	L24	L179	i3946	Y	L24	L180	i3947	Y	L24	L196	i3948	Y	L24	L217
i3949	Y	L25	L179	i3950	Y	L25	L180	i3951	Y	L25	L196	i3952	Y	L25	L217
i3953	Y	L26	L179	i3954	Y	L26	L180	i3955	Y	L26	L196	i3956	Y	L26	L217
i3957	Y	L27	L179	i3958	Y	L27	L180	i3959	Y	L27	L196	i3960	Y	L27	L217
i3961	Y	L28	L179	i3962	Y	L28	L180	i3963	Y	L28	L196	i3964	Y	L28	L217
i3965	Y	L12	L179	i3966	Y	L12	L180	i3967	Y	L12	L196	i3968	Y	L12	L217
i3969	Y	L13	L179	i3970	Y	L13	L180	i3971	Y	L13	L196	i3972	Y	L13	L217
i3973	Y	L14	L179	i3974	Y	L14	L180	i3975	Y	L14	L196	i3976	Y	L14	L217
i3977	Y	L15	L179	i3978	Y	L15	L180	i3979	Y	L15	L196	i3980	Y	L15	L217
i3981	Y	L16	L179	i3982	Y	L16	L180	i3983	Y	L16	L196	i3984	Y	L16	L217
i3985	Y	L17	L179	i3986	Y	L17	L180	i3987	Y	L17	L196	i3988	Y	L17	L217
i3989	Y	L18	L179	i3990	Y	L18	L180	i3991	Y	L18	L196	i3992	Y	L18	L217
i3993	Y	L19	L179	i3994	Y	L19	L180	i3995	Y	L19	L196	i3996	Y	L19	L217
i3997	Y	L2	L179	i3998	Y	L2	L180	i3999	Y	L2	L196	i4000	Y	L2	L217
i4001	Y	L101	L179	i4002	Y	L101	L180	i4003	Y	L101	L196	i4004	Y	L101	L217
i4005	Y	L102	L179	i4006	Y	L102	L180	i4007	Y	L102	L196	i4008	Y	L102	L217
i4009	Y	L103	L179	i4010	Y	L103	L180	i4011	Y	L103	L196	i4012	Y	L103	L217
i4013	Y	L104	L179	i4014	Y	L104	L180	i4015	Y	L104	L196	i4016	Y	L104	L217
i4017	Y	L105	L179	i4018	Y	L105	L180	i4019	Y	L105	L196	i4020	Y	L105	L217
i4021	Y	L106	L179	i4022	Y	L106	L180	i4023	Y	L106	L196	i4024	Y	L106	L217
i4025	Y	L107	L179	i4026	Y	L107	L180	i4027	Y	L107	L196	i4028	Y	L107	L217
i4029	Y	L108	L179	i4030	Y	L108	L180	i4031	Y	L108	L196	i4032	Y	L108	L217
i4033	Y	L109	L179	i4034	Y	L109	L180	i4035	Y	L109	L196	i4036	Y	L109	L217
i4037	Y	L110	L179	i4038	Y	L110	L180	i4039	Y	L110	L196	i4040	Y	L110	L217
i4041	Y	L111	L179	i4042	Y	L111	L180	i4043	Y	L111	L196	i4044	Y	L111	L217
i4045	Y	L112	L179	i4046	Y	L112	L180	i4047	Y	L112	L196	i4048	Y	L112	L217
i4049	Y	L113	L179	i4050	Y	L113	L180	i4051	Y	L113	L196	i4052	Y	L113	L217
i4053	Y	L114	L179	i4054	Y	L114	L180	i4055	Y	L114	L196	i4056	Y	L114	L217
i4057	Y	L115	L179	i4058	Y	L115	L180	i4059	Y	L115	L196	i4060	Y	L115	L217
i4061	Y	L116	L179	i4062	Y	L116	L180	i4063	Y	L116	L196	i4064	Y	L116	L217
i4065	Y	L117	L179	i4066	Y	L117	L180	i4067	Y	L117	L196	i4068	Y	L117	L217
i4069	Y	L118	L179	i4070	Y	L118	L180	i4071	Y	L118	L196	i4072	Y	L118	L217
i4073	Y	L119	L179	i4074	Y	L119	L180	i4075	Y	L119	L196	i4076	Y	L119	L217
i4077	Y	L120	L179	i4078	Y	L120	L180	i4079	Y	L120	L196	i4080	Y	L120	L217
i4081	Y	L121	L179	i4082	Y	L121	L180	i4083	Y	L121	L196	i4084	Y	L121	L217
i4085	Y	L122	L179	i4086	Y	L122	L180	i4087	Y	L122	L196	i4088	Y	L122	L217
i4089	Y	L123	L179	i4090	Y	L123	L180	i4091	Y	L123	L196	i4092	Y	L123	L217
i4093	Y	L124	L179	i4094	Y	L124	L180	i4095	Y	L124	L196	i4096	Y	L124	L217
i4097	Y	L125	L179	i4098	Y	L125	L180	i4099	Y	L125	L196	i4100	Y	L125	L217
i4101	Y	L126	L179	i4102	Y	L126	L180	i4103	Y	L126	L196	i4104	Y	L126	L217
i4105	Y	L127	L179	i4106	Y	L127	L180	i4107	Y	L127	L196	i4108	Y	L127	L217
i4109	Y	L128	L179	i4110	Y	L128	L180	i4111	Y	L128	L196	i4112	Y	L128	L217
i4113	Y	L129	L179	i4114	Y	L129	L180	i4115	Y	L129	L196	i4116	Y	L129	L217
i4117	Y	L130	L179	i4118	Y	L130	L180	i4119	Y	L130	L196	i4120	Y	L130	L217
i4121	Y	L131	L179	i4122	Y	L131	L180	i4123	Y	L131	L196	i4124	Y	L131	L217
i4125	Y	L132	L179	i4126	Y	L132	L180	i4127	Y	L132	L196	i4128	Y	L132	L217
i4129	Y	L133	L179	i4130	Y	L133	L180	i4131	Y	L133	L196	i4132	Y	L133	L217
i4133	Y	L134	L179	i4134	Y	L134	L180	i4135	Y	L134	L196	i4136	Y	L134	L217
i4137	Y	L135	L179	i4138	Y	L135	L180	i4139	Y	L135	L196	i4140	Y	L135	L217
i4141	Y	L136	L179	i4142	Y	L136	L180	i4143	Y	L136	L196	i4144	Y	L136	L217
i4145	Y	L137	L179	i4146	Y	L137	L180	i4147	Y	L137	L196	i4148	Y	L137	L217
i4149	Y	L138	L179	i4150	Y	L138	L180	i4151	Y	L138	L196	i4152	Y	L138	L217
i4153	Y	L139	L179	i4154	Y	L139	L180	i4155	Y	L139	L196	i4156	Y	L139	L217
i4157	Y	L140	L179	i4158	Y	L140	L180	i4159	Y	L140	L196	i4160	Y	L140	L217
i4161	Y	L141	L179	i4162	Y	L141	L180	i4163	Y	L141	L196	i4164	Y	L141	L217
i4165	Y	L142	L179	i4166	Y	L142	L180	i4167	Y	L142	L196	i4168	Y	L142	L217
i4169	Y	L143	L179	i4170	Y	L143	L180	i4171	Y	L143	L196	i4172	Y	L143	L217
i4173	Y	L144	L179	i4174	Y	L144	L180	i4175	Y	L144	L196	i4176	Y	L144	L217
i4177	Y	L145	L179	i4178	Y	L145	L180	i4179	Y	L145	L196	i4180	Y	L145	L217
i4181	Y	L146	L179	i4182	Y	L146	L180	i4183	Y	L146	L196	i4184	Y	L146	L217
i4185	Y	L147	L179	i4186	Y	L147	L180	i4187	Y	L147	L196	i4188	Y	L147	L217
i4189	Y	L148	L179	i4190	Y	L148	L180	i4191	Y	L148	L196	i4192	Y	L148	L217
i4193	Y	L149	L179	i4194	Y	L149	L180	i4195	Y	L149	L196	i4196	Y	L149	L217
i4197	Y	L150	L179	i4198	Y	L150	L180	i4199	Y	L150	L196	i4200	Y	L150	L217
i4201	Y	L151	L179	i4202	Y	L151	L180	i4203	Y	L151	L196	i4204	Y	L151	L217
i4205	Y	L152	L179	i4206	Y	L152	L180	i4207	Y	L152	L196	i4208	Y	L152	L217
i4209	Y	L153	L179	i4210	Y	L153	L180	i4211	Y	L153	L196	i4212	Y	L153	L217
i4213	Y	L154	L179	i4214	Y	L154	L180	i4215	Y	L154	L196	i4216	Y	L154	L217
i4217	Y	L155	L179	i4218	Y	L155	L180	i4219	Y	L155	L196	i4220	Y	L155	L217
i4221	Y	L156	L179	i4222	Y	L156	L180	i4223	Y	L156	L196	i4224	Y	L156	L217
i4225	Y	L157	L179	i4226	Y	L157	L180	i4227	Y	L157	L196	i4228	Y	L157	L217
i4229	Y	L158	L179	i4230	Y	L158	L180	i4231	Y	L158	L196	i4232	Y	L158	L217
i4233	Y	L159	L179	i4234	Y	L159	L180	i4235	Y	L159	L196	i4236	Y	L159	L217
i4237	Y	L160	L179	i4238	Y	L160	L180	i4239	Y	L160	L196	i4240	Y	L160	L217
i4241	Y	L161	L179	i4242	Y	L161	L180	i4243	Y	L161	L196	i4244	Y	L161	L217
i4245	Y	L162	L179	i4246	Y	L162	L180	i4247	Y	L162	L196	i4248	Y	L162	L217
i4249	Y	L163	L179	i4250	Y	L163	L180	i4251	Y	L163	L196	i4252	Y	L163	L217
i4253	Y	L164	L179	i4254	Y	L164	L180	i4255	Y	L164	L196	i4256	Y	L164	L217
i4257	Y	L165	L179	i4258	Y	L165	L180	i4259	Y	L165	L196	i4260	Y	L165	L217
i4261	Y	L166	L179	i4262	Y	L166	L180	i4263	Y	L166	L196	i4264	Y	L166	L217
i4265	Y	L167	L179	i4266	Y	L167	L180	i4267	Y	L167	L196	i4268	Y	L167	L217
i4269	Y	L168	L179	i4270	Y	L168	L180	i4271	Y	L168	L196	i4272	Y	L168	L217
i4273	Y	L169	L179	i4274	Y	L169	L180	i4275	Y	L169	L196	i4276	Y	L169	L217
i4277	Y	L170	L179	i4278	Y	L170	L180	i4279	Y	L170	L196	i4280	Y	L170	L217
i4281	Y	L171	L179	i4282	Y	L171	L180	i4283	Y	L171	L196	i4284	Y	L171	L217
i4285	Y	L172	L179	i4286	Y	L172	L180	i4287	Y	L172	L196	i4288	Y	L172	L217
i4289	Y	L173	L179	i4290	Y	L173	L180	i4291	Y	L173	L196	i4292	Y	L173	L217
i4293	Y	L174	L179	i4294	Y	L174	L180	i4295	Y	L174	L196	i4296	Y	L174	L217
i4297	Y	L175	L179	i4298	Y	L175	L180	i4299	Y	L175	L196	i4300	Y	L175	L217
i4301	Y	L176	L179	i4302	Y	L176	L180	i4303	Y	L176	L196	i4304	Y	L176	L217
i4305	Y	L177	L179	i4306	Y	L177	L180	i4307	Y	L177	L196	i4308	Y	L177	L217
i4309	Y	L178	L179	i4310	Y	L178	L180	i4311	Y	L178	L196	i4312	Y	L178	L217
i4313	Y	L179	L179	i4314	Y	L179	L180	i4315	Y	L179	L196	i4316	Y	L179	L217
i4317	Y	L180	L179	i4318	Y	L180	L180	i4319	Y	L180	L196	i4320	Y	L180	L217
i4321	Y	L181	L179	i4322	Y	L181	L180	i4323	Y	L181	L196	i4324	Y	L181	L217
i4325	Y	L182	L179	i4326	Y	L182	L180	i4327	Y	L182	L196	i4328	Y	L182	L217
i4329	Y	L183	L179	i4330	Y	L183	L180	i4331	Y	L183	L196	i4332	Y	L183	L217
i4333	Y	L184	L179	i4334	Y	L184	L180	i4335	Y	L184	L196	i4336	Y	L184	L217
i4337	Y	L185	L179	i4338	Y	L185	L180	i4339	Y	L185	L196	i4340	Y	L185	L217
i4341	Y	L186	L179	i4342	Y	L186	L180	i4343	Y	L186	L196	i4344	Y	L186	L217
i4345	Y	L187	L179	i4346	Y	L187	L180	i4347	Y	L187	L196	i4348	Y	L187	L217
i4349	Y	L188	L179	i4350	Y	L188	L180	i4351	Y	L188	L196	i4352	Y	L188	L217
i4353	Y	L189	L179	i4354	Y	L189	L180	i4355	Y	L189	L196	i4356	Y	L189	L217
i4357	Y	L190	L179	i4358	Y	L190	L180	i4359	Y	L190	L196	i4360	Y	L190	L217
i4361	Y	L191	L179	i4362	Y	L191	L180	i4363	Y	L191	L196	i4364	Y	L191	L217
i4365	Y	L192	L179	i4366	Y	L192	L180	i4367	Y	L192	L196	i4368	Y	L192	L217
i4369	Y	L193	L179	i4370	Y	L193	L180	i4371	Y	L193	L196	i4372	Y	L193	L217
i4373	Y	L194	L179	i4374	Y	L194	L180	i4375	Y	L194	L196	i4376	Y	L194	L217
i4377	Y	L195	L179	i4378	Y	L195	L180	i4379	Y	L195	L196	i4380	Y	L195	L217
i4381	Y	L196	L179	i4382	Y	L196	L180	i4383	Y	L196	L196	i4384	Y	L196	L217
i4385	Y	L197	L179	i4386	Y	L197	L180	i4387	Y	L197	L196	i4388	Y	L197	L217
i4389	Y	L198	L179	i4390	Y	L198	L180	i4391	Y	L198	L196	i4392	Y	L198	L217
i4393	Y	L199	L179	i4394	Y	L199	L180	i4395	Y	L199	L196	i4396	Y	L199	L217
i4397	Y	L200	L179	i4398	Y	L200	L180	i4399	Y	L200	L196	i4400	Y	L200	L217
i4401	Y	L201	L179	i4402	Y	L201	L180	i4403	Y	L201	L196	i4404	Y	L201	L217
i4405	Y	L202	L179	i4406	Y	L202	L180	i4407	Y	L202	L196	i4408	Y	L202	L217
i4409	Y	L203	L179	i4410	Y	L203	L180	i4411	Y	L203	L196	i4412	Y	L203	L217
i4413	Y	L204	L179	i4414	Y	L204	L180	i4415	Y	L204	L196	i4416	Y	L204	L217
i4417	Y	L205	L179	i4418	Y	L205	L180	i4419	Y	L205	L196	i4420	Y	L205	L217
i4421	Y	L206	L179	i4422	Y	L206	L180	i4423	Y	L206	L196	i4424	Y	L206	L217
i4425	Y	L207	L179	i4426	Y	L207	L180	i4427	Y	L207	L196	i4428	Y	L207	L217
i4429	Y	L208	L179	i4430	Y	L208	L180	i4431	Y	L208	L196	i4432	Y	L208	L217
i4433	Y	L209	L179	i4434	Y	L209	L180	i4435	Y	L209	L196	i4436	Y	L209	L217
i4437	Y	L210	L179	i4438	Y	L210	L180	i4439	Y	L210	L196	i4440	Y	L210	L217
i4441	Y	L211	L179	i4442	Y	L211	L180	i4443	Y	L211	L196	i4444	Y	L211	L217
i4445	Y	L212	L179	i4446	Y	L212	L180	i4447	Y	L212	L196	i4448	Y	L212	L217
i4449	Y	L213	L179	i4450	Y	L213	L180	i4451	Y	L213	L196	i4452	Y	L213	L217
i4453	Y	L214	L179	i4454	Y	L214	L180	i4455	Y	L214	L196	i4456	Y	L214	L217
i4457	Y	L215	L179	i4458	Y	L215	L180	i4459	Y	L215	L196	i4460	Y	L215	L217
i4461	Y	L216	L179	i4462	Y	L216	L180	i4463	Y	L216	L196	i4464	Y	L216	L217
i4465	Y	L217	L179	i4466	Y	L217	L180	i4467	Y	L217	L196	i4468	Y	L217	L217
i4469	Y	L218	L179	i4470	Y	L218	L180	i4471	Y	L218	L196	i4472	Y	L218	L217
i4473	Y	L219	L179	i4474	Y	L219	L180	i4475	Y	L219	L196	i4476	Y	L219	L217
i4477	Y	L220	L179	i4478	Y	L220	L180	i4479	Y	L220	L196	i4480	Y	L220	L217
i4481	Y	L221	L179	i4482	Y	L221	L180	i4483	Y	L221	L196	i4484	Y	L221	L217
i4485	Y	L222	L179	i4486	Y	L222	L180	i4487	Y	L222	L196	i4488	Y	L222	L217
i4489	Y	L401	L179	i4490	Y	L401	L180	i4491	Y	L401	L196	i4492	Y	L401	L217
i4493	Y	L402	L179	i4494	Y	L402	L180	i4495	Y	L402	L196	i4496	Y	L402	L217
i4497	Y	L403	L179	i4498	Y	L403	L180	i4499	Y	L403	L196	i4500	Y	L403	L217
i4501	Y	L404	L179	i4502	Y	L404	L180	i4503	Y	L404	L196	i4504	Y	L404	L217
i4505	Y	L405	L179	i4506	Y	L405	L180	i4507	Y	L405	L196	i4508	Y	L405	L217
i4509	Y	L406	L179	i4510	Y	L406	L180	i4511	Y	L406	L196	i4512	Y	L406	L217
i4513	Y	L407	L179	i4514	Y	L407	L180	i4515	Y	L407	L196	i4516	Y	L407	L217
i4517	Y	L408	L179	i4518	Y	L408	L180	i4519	Y	L408	L196	i4520	Y	L408	L217
i4521	Y	L409	L179	i4522	Y	L409	L180	i4523	Y	L409	L196	i4524	Y	L409	L217
i4525	Y	L410	L179	i4526	Y	L410	L180	i4527	Y	L410	L196	i4528	Y	L410	L217
i4529	Y	L411	L179	i4530	Y	L411	L180	i4531	Y	L411	L196	i4532	Y	L411	L217
i4533	Y	L412	L179	i4534	Y	L412	L180	i4535	Y	L412	L196	i4536	Y	L412	L217
i4537	Y	L413	L179	i4538	Y	L413	L180	i4539	Y	L413	L196	i4540	Y	L413	L217
i4541	Y	L414	L179	i4542	Y	L414	L180	i4543	Y	L414	L196	i4544	Y	L414	L217
i4545	Y	L415	L179	i4546	Y	L415	L180	i4547	Y	L415	L196	i4548	Y	L415	L217
i4549	Y	L416	L179	i4550	Y	L416	L180	i4551	Y	L416	L196	i4552	Y	L416	L217
i4553	Y	L417	L179	i4554	Y	L417	L180	i4555	Y	L417	L196	i4556	Y	L417	L217
i4557	Y	L418	L179	i4558	Y	L418	L180	i4559	Y	L418	L196	i4560	Y	L418	L217
i4561	Y	L419	L179	i4562	Y	L419	L180	i4563	Y	L419	L196	i4564	Y	L419	L217
i4565	Y	L420	L179	i4566	Y	L420	L180	i4567	Y	L420	L196	i4568	Y	L420	L217
i4569	Y	L421	L179	i4570	Y	L421	L180	i4571	Y	L421	L196	i4572	Y	L421	L217
i4573	Y	L422	L179	i4574	Y	L422	L180	i4575	Y	L422	L196	i4576	Y	L422	L217
i4577	Y	L423	L179	i4578	Y	L423	L180	i4579	Y	L423	L196	i4580	Y	L423	L217
i4581	Y	L424	L179	i4582	Y	L424	L180	i4583	Y	L424	L196	i4584	Y	L424	L217
i4585	Y	L425	L179	i4586	Y	L425	L180	i4587	Y	L425	L196	i4588	Y	L425	L217
i4589	Y	L501	L179	i4590	Y	L501	L180	i4591	Y	L501	L196	i4592	Y	L501	L217
i4593	Y	L502	L179	i4594	Y	L502	L180	i4595	Y	L502	L196	i4596	Y	L502	L217
i4597	Y	L503	L179	i4598	Y	L503	L180	i4599	Y	L503	L196	i4600	Y	L503	L217
i4601	Y	L504	L179	i4602	Y	L504	L180	i4603	Y	L504	L196	i4604	Y	L504	L217
i4605	Y	L505	L179	i4606	Y	L505	L180	i4607	Y	L505	L196	i4608	Y	L505	L217
i4609	Y	L506	L179	i4610	Y	L506	L180	i4611	Y	L506	L196	i4612	Y	L506	L217
i4613	Y	L507	L179	i4614	Y	L507	L180	i4615	Y	L507	L196	i4616	Y	L507	L217
i4617	Y	L508	L179	i4618	Y	L508	L180	i4619	Y	L508	L196	i4620	Y	L508	L217
i4621	Y	L509	L179	i4622	Y	L509	L180	i4623	Y	L509	L196	i4624	Y	L509	L217
i4625	Y	L510	L179	i4626	Y	L510	L180	i4627	Y	L510	L196	i4628	Y	L510	L217
i4629	Y	L511	L179	i4630	Y	L511	L180	i4631	Y	L511	L196	i4632	Y	L511	L217
i4633	Y	L512	L179	i4634	Y	L512	L180	i4635	Y	L512	L196	i4636	Y	L512	L217
i4637	Y	L513	L179	i4638	Y	L513	L180	i4639	Y	L513	L196	i4640	Y	L513	L217
i4641	Y	L514	L179	i4642	Y	L514	L180	i4643	Y	L514	L196	i4644	Y	L514	L217
i4645	Y	L515	L179	i4646	Y	L515	L180	i4647	Y	L515	L196	i4648	Y	L515	L217
i4649	Y	L516	L179	i4650	Y	L516	L180	i4651	Y	L516	L196	i4652	Y	L516	L217
i4653	Y	L517	L179	i4654	Y	L517	L180	i4655	Y	L517	L196	i4656	Y	L517	L217
i4657	Y	L518	L179	i4658	Y	L518	L180	i4659	Y	L518	L196	i4660	Y	L518	L217
i4661	Y	L519	L179	i4662	Y	L519	L180	i4663	Y	L519	L196	i4664	Y	L519	L217
i4665	Y	L520	L179	i4666	Y	L520	L180	i4667	Y	L520	L196	i4668	Y	L520	L217
i4669	Y	L521	L179	i4670	Y	L521	L180	i4671	Y	L521	L196	i4672	Y	L521	L217
i4673	Y	L522	L179	i4674	Y	L522	L180	i4675	Y	L522	L196	i4676	Y	L522	L217
i4677	Y	L523	L179	i4678	Y	L523	L180	i4679	Y	L523	L196	i4680	Y	L523	L217
i4681	Y	L524	L179	i4682	Y	L524	L180	i4683	Y	L524	L196	i4684	Y	L524	L217
i4685	Y	L525	L179	i4686	Y	L525	L180	i4687	Y	L525	L196	i4688	Y	L525	L217
i4689	Y	L526	L179	i4690	Y	L526	L180	i4691	Y	L526	L196	i4692	Y	L526	L217
i4693	Y	L527	L179	i4694	Y	L527	L180	i4695	Y	L527	L196	i4696	Y	L527	L217
i4697	Y	L528	L179	i4698	Y	L528	L180	i4699	Y	L528	L196	i4700	Y	L528	L217
i4701	Y	L529	L179	i4702	Y	L529	L180	i4703	Y	L529	L196	i4704	Y	L529	L217
i4705	Y	L530	L179	i4706	Y	L530	L180	i4707	Y	L530	L196	i4708	Y	L530	L217
i4709	Y	L531	L179	i4710	Y	L531	L180	i4711	Y	L531	L196	i4712	Y	L531	L217
i4713	Y	L532	L179	i4714	Y	L532	L180	i4715	Y	L532	L196	i4716	Y	L532	L217
i4717	Y	L533	L179	i4718	Y	L533	L180	i4719	Y	L533	L196	i4720	Y	L533	L217
i4721	Y	L534	L179	i4722	Y	L534	L180	i4723	Y	L534	L196	i4724	Y	L534	L217
i4725	Y	L535	L179	i4726	Y	L535	L180	i4727	Y	L535	L196	i4728	Y	L535	L217
i4729	Y	L536	L179	i4730	Y	L536	L180	i4731	Y	L536	L196	i4732	Y	L536	L217
i4733	Y	L537	L179	i4734	Y	L537	L180	i4735	Y	L537	L196	i4736	Y	L537	L217
i4737	Y	L538	L179	i4738	Y	L538	L180	i4739	Y	L538	L196	i4740	Y	L538	L217
i4741	Y	L539	L179	i4742	Y	L539	L180	i4743	Y	L539	L196	i4744	Y	L539	L217
i4745	Y	L540	L179	i4746	Y	L540	L180	i4747	Y	L540	L196	i4748	Y	L540	L217
i4749	Y	L541	L179	i4750	Y	L541	L180	i4751	Y	L541	L196	i4752	Y	L541	L217
i4753	Y	L542	L179	i4754	Y	L542	L180	i4755	Y	L542	L196	i4756	Y	L542	L217
i4757	Y	L543	L179	i4758	Y	L543	L180	i4759	Y	L543	L196	i4760	Y	L543	L217
i4761	Y	L544	L179	i4762	Y	L544	L180	i4763	Y	L544	L196	i4764	Y	L544	L217
i4765	Y	L545	L179	i4766	Y	L545	L180	i4767	Y	L545	L196	i4768	Y	L545	L217
i4769	Y	L546	L179	i4770	Y	L546	L180	i4771	Y	L546	L196	i4772	Y	L546	L217
i4773	Y	L547	L179	i4774	Y	L547	L180	i4775	Y	L547	L196	i4776	Y	L547	L217
i4777	Y	L548	L179	i4778	Y	L548	L180	i4779	Y	L548	L196	i4780	Y	L548	L217
i4781	Y	L549	L179	i4782	Y	L549	L180	i4783	Y	L549	L196	i4784	Y	L549	L217
i4785	Y	L550	L179	i4786	Y	L550	L180	i4787	Y	L550	L196	i4788	Y	L550	L217
i4789	Y	L551	L179	i4790	Y	L551	L180	i4791	Y	L551	L196	i4792	Y	L551	L217
i4793	Y	L552	L179	i4794	Y	L552	L180	i4795	Y	L552	L196	i4796	Y	L552	L217
i4797	Y	L553	L179	i4798	Y	L553	L180	i4799	Y	L553	L196	i4800	Y	L553	L217
i4801	Y	L554	L179	i4802	Y	L554	L180	i4803	Y	L554	L196	i4804	Y	L554	L217
i4805	Y	L555	L179	i4806	Y	L555	L180	i4807	Y	L555	L196	i4808	Y	L555	L217
i4809	Y	L556	L179	i4810	Y	L556	L180	i4811	Y	L556	L196	i4812	Y	L556	L217
i4813	Y	L557	L179	i4814	Y	L557	L180	i4815	Y	L557	L196	i4816	Y	L557	L217
i4817	Y	L558	L179	i4818	Y	L558	L180	i4819	Y	L558	L196	i4820	Y	L558	L217
i4821	Y	L559	L179	i4822	Y	L559	L180	i4823	Y	L559	L196	i4824	Y	L559	L217
i4825	Y	L560	L179	i4826	Y	L560	L180	i4827	Y	L560	L196	i4828	Y	L560	L217
i4829	Y	L561	L179	i4830	Y	L561	L180	i4831	Y	L561	L196	i4832	Y	L561	L217
i4833	Y	L562	L179	i4834	Y	L562	L180	i4835	Y	L562	L196	i4836	Y	L562	L217
i4837	Y	L563	L179	i4838	Y	L563	L180	i4839	Y	L563	L196	i4840	Y	L563	L217
i4841	Y	L564	L179	i4842	Y	L564	L180	i4843	Y	L564	L196	i4844	Y	L564	L217
i4845	Y	L565	L179	i4846	Y	L565	L180	i4847	Y	L565	L196	i4848	Y	L565	L217
i4849	Y	L566	L179	i4850	Y	L566	L180	i4851	Y	L566	L196	i4852	Y	L566	L217
i4853	Y	L567	L179	i4854	Y	L567	L180	i4855	Y	L567	L196	i4856	Y	L567	L217
i4857	Y	L568	L179	i4858	Y	L568	L180	i4859	Y	L568	L196	i4860	Y	L568	L217
i4861	Y	L569	L179	i4862	Y	L569	L180	i4863	Y	L569	L196	i4864	Y	L569	L217
i4865	Y	L570	L179	i4866	Y	L570	L180	i4867	Y	L570	L196	i4868	Y	L570	L217
i4869	Y	L571	L179	i4870	Y	L571	L180	i4871	Y	L571	L196	i4872	Y	L571	L217
i4873	Y	L572	L179	i4874	Y	L572	L180	i4875	Y	L572	L196	i4876	Y	L572	L217
i4877	Y	L843	L179	i4878	Y	L843	L180	i4879	Y	L843	L196	i4880	Y	L843	L217
i4881	Y	L844	L179	i4882	Y	L844	L180	i4883	Y	L844	L196	i4884	Y	L844	L217
i4885	Y	L845	L179	i4886	Y	L845	L180	i4887	Y	L845	L196	i4888	Y	L845	L217
i4889	Y	L846	L179	i4890	Y	L846	L180	i4891	Y	L846	L196	i4892	Y	L846	L217
i4893	Y	L847	L179	i4894	Y	L847	L180	i4895	Y	L847	L196	i4896	Y	L847	L217
i4897	Y	L848	L179	i4898	Y	L848	L180	i4899	Y	L848	L196	i4900	Y	L848	L217
i4901	Y	L10	L201	i4902	Y	L10	L206	i4903	Y	L10	L220	i4904	Y	L10	L215
i4905	Y	L11	L201	i4906	Y	L11	L206	i4907	Y	L11	L220	i4908	Y	L11	L215
i4909	Y	L20	L201	i4910	Y	L20	L206	i4911	Y	L20	L220	i4912	Y	L20	L215
i4913	Y	L21	L201	i4914	Y	L21	L206	i4915	Y	L21	L220	i4916	Y	L21	L215
i4917	Y	L22	L201	i4918	Y	L22	L206	i4919	Y	L22	L220	i4920	Y	L22	L215
i4921	Y	L23	L201	i4922	Y	L23	L206	i4923	Y	L23	L220	i4924	Y	L23	L215
i4925	Y	L24	L201	i4926	Y	L24	L206	i4927	Y	L24	L220	i4928	Y	L24	L215
i4929	Y	L25	L201	i4930	Y	L25	L206	i4931	Y	L25	L220	i4932	Y	L25	L215
i4933	Y	L26	L201	i4934	Y	L26	L206	i4935	Y	L26	L220	i4936	Y	L26	L215
i4937	Y	L27	L201	i4938	Y	L27	L206	i4939	Y	L27	L220	i4940	Y	L27	L215
i4941	Y	L28	L201	i4942	Y	L28	L206	i4943	Y	L28	L220	i4944	Y	L28	L215
i4945	Y	L12	L201	i4946	Y	L12	L206	i4947	Y	L12	L220	i4948	Y	L12	L215
i4949	Y	L13	L201	i4950	Y	L13	L206	i4951	Y	L13	L220	i4952	Y	L13	L215
i4953	Y	L14	L201	i4954	Y	L14	L206	i4955	Y	L14	L220	i4956	Y	L14	L215
i4957	Y	L15	L201	i4958	Y	L15	L206	i4959	Y	L15	L220	i4960	Y	L15	L215
i4961	Y	L16	L201	i4962	Y	L16	L206	i4963	Y	L16	L220	i4964	Y	L16	L215
i4965	Y	L17	L201	i4966	Y	L17	L206	i4967	Y	L17	L220	i4968	Y	L17	L215
i4969	Y	L18	L201	i4970	Y	L18	L206	i4971	Y	L18	L220	i4972	Y	L18	L215
i4973	Y	L19	L201	i4974	Y	L19	L206	i4975	Y	L19	L220	i4976	Y	L19	L215
i4977	Y	L2	L201	i4978	Y	L2	L206	i4979	Y	L2	L220	i4980	Y	L2	L215
i4981	Y	L101	L201	i4982	Y	L101	L206	i4983	Y	L101	L220	i4984	Y	L101	L215
i4985	Y	L102	L201	i4986	Y	L102	L206	i4987	Y	L102	L220	i4988	Y	L102	L215
i4989	Y	L103	L201	i4990	Y	L103	L206	i4991	Y	L103	L220	i4992	Y	L103	L215
i4993	Y	L104	L201	i4994	Y	L104	L206	i4995	Y	L104	L220	i4996	Y	L104	L215
i4997	Y	L105	L201	i4998	Y	L105	L206	i4999	Y	L105	L220	i5000	Y	L105	L215
i5001	Y	L106	L201	i5002	Y	L106	L206	i5003	Y	L106	L220	i5004	Y	L106	L215
i5005	Y	L107	L201	i5006	Y	L107	L206	i5007	Y	L107	L220	i5008	Y	L107	L215
i5009	Y	L108	L201	i5010	Y	L108	L206	i5011	Y	L108	L220	i5012	Y	L108	L215
i5013	Y	L109	L201	i5014	Y	L109	L206	i5015	Y	L109	L220	i5016	Y	L109	L215
i5017	Y	L110	L201	i5018	Y	L110	L206	i5019	Y	L110	L220	i5020	Y	L110	L215
i5021	Y	L111	L201	i5022	Y	L111	L206	i5023	Y	L111	L220	i5024	Y	L111	L215
i5025	Y	L112	L201	i5026	Y	L112	L206	i5027	Y	L112	L220	i5028	Y	L112	L215
i5029	Y	L113	L201	i5030	Y	L113	L206	i5031	Y	L113	L220	i5032	Y	L113	L215
i5033	Y	L114	L201	i5034	Y	L114	L206	i5035	Y	L114	L220	i5036	Y	L114	L215
i5037	Y	L115	L201	i5038	Y	L115	L206	i5039	Y	L115	L220	i5040	Y	L115	L215
i5041	Y	L116	L201	i5042	Y	L116	L206	i5043	Y	L116	L220	i5044	Y	L116	L215
i5045	Y	L117	L201	i5046	Y	L117	L206	i5047	Y	L117	L220	i5048	Y	L117	L215
i5049	Y	L118	L201	i5050	Y	L118	L206	i5051	Y	L118	L220	i5052	Y	L118	L215
i5053	Y	L119	L201	i5054	Y	L119	L206	i5055	Y	L119	L220	i5056	Y	L119	L215
i5057	Y	L120	L201	i5058	Y	L120	L206	i5059	Y	L120	L220	i5060	Y	L120	L215
i5061	Y	L121	L201	i5062	Y	L121	L206	i5063	Y	L121	L220	i5064	Y	L121	L215
i5065	Y	L122	L201	i5066	Y	L122	L206	i5067	Y	L122	L220	i5068	Y	L122	L215
i5069	Y	L123	L201	i5070	Y	L123	L206	i5071	Y	L123	L220	i5072	Y	L123	L215
i5073	Y	L124	L201	i5074	Y	L124	L206	i5075	Y	L124	L220	i5076	Y	L124	L215
i5077	Y	L125	L201	i5078	Y	L125	L206	i5079	Y	L125	L220	i5080	Y	L125	L215
i5081	Y	L126	L201	i5082	Y	L126	L206	i5083	Y	L126	L220	i5084	Y	L126	L215
i5085	Y	L127	L201	i5086	Y	L127	L206	i5087	Y	L127	L220	i5088	Y	L127	L215
i5089	Y	L128	L201	i5090	Y	L128	L206	i5091	Y	L128	L220	i5092	Y	L128	L215
i5093	Y	L129	L201	i5094	Y	L129	L206	i5095	Y	L129	L220	i5096	Y	L129	L215
i5097	Y	L130	L201	i5098	Y	L130	L206	i5099	Y	L130	L220	i5100	Y	L130	L215
i5101	Y	L131	L201	i5102	Y	L131	L206	i5103	Y	L131	L220	i5104	Y	L131	L215
i5105	Y	L132	L201	i5106	Y	L132	L206	i5107	Y	L132	L220	i5108	Y	L132	L215
i5109	Y	L133	L201	i5110	Y	L133	L206	i5111	Y	L133	L220	i5112	Y	L133	L215
i5113	Y	L134	L201	i5114	Y	L134	L206	i5115	Y	L134	L220	i5116	Y	L134	L215
i5117	Y	L135	L201	i5118	Y	L135	L206	i5119	Y	L135	L220	i5120	Y	L135	L215
i5121	Y	L136	L201	i5122	Y	L136	L206	i5123	Y	L136	L220	i5124	Y	L136	L215
i5125	Y	L137	L201	i5126	Y	L137	L206	i5127	Y	L137	L220	i5128	Y	L137	L215
i5129	Y	L138	L201	i5130	Y	L138	L206	i5131	Y	L138	L220	i5132	Y	L138	L215
i5133	Y	L139	L201	i5134	Y	L139	L206	i5135	Y	L139	L220	i5136	Y	L139	L215
i5137	Y	L140	L201	i5138	Y	L140	L206	i5139	Y	L140	L220	i5140	Y	L140	L215
i5141	Y	L141	L201	i5142	Y	L141	L206	i5143	Y	L141	L220	i5144	Y	L141	L215
i5145	Y	L142	L201	i5146	Y	L142	L206	i5147	Y	L142	L220	i5148	Y	L142	L215
i5149	Y	L143	L201	i5150	Y	L143	L206	i5151	Y	L143	L220	i5152	Y	L143	L215
i5153	Y	L144	L201	i5154	Y	L144	L206	i5155	Y	L144	L220	i5156	Y	L144	L215
i5157	Y	L145	L201	i5158	Y	L145	L206	i5159	Y	L145	L220	i5160	Y	L145	L215
i5161	Y	L146	L201	i5162	Y	L146	L206	i5163	Y	L146	L220	i5164	Y	L146	L215
i5165	Y	L147	L201	i5166	Y	L147	L206	i5167	Y	L147	L220	i5168	Y	L147	L215
i5169	Y	L148	L201	i5170	Y	L148	L206	i5171	Y	L148	L220	i5172	Y	L148	L215
i5173	Y	L149	L201	i5174	Y	L149	L206	i5175	Y	L149	L220	i5176	Y	L149	L215
i5177	Y	L150	L201	i5178	Y	L150	L206	i5179	Y	L150	L220	i5180	Y	L150	L215
i5181	Y	L151	L201	i5182	Y	L151	L206	i5183	Y	L151	L220	i5184	Y	L151	L215
i5185	Y	L152	L201	i5186	Y	L152	L206	i5187	Y	L152	L220	i5188	Y	L152	L215
i5189	Y	L153	L201	i5190	Y	L153	L206	i5191	Y	L153	L220	i5192	Y	L153	L215
i5193	Y	L154	L201	i5194	Y	L154	L206	i5195	Y	L154	L220	i5196	Y	L154	L215
i5197	Y	L155	L201	i5198	Y	L155	L206	i5199	Y	L155	L220	i5200	Y	L155	L215
i5201	Y	L156	L201	i5202	Y	L156	L206	i5203	Y	L156	L220	i5204	Y	L156	L215
i5205	Y	L157	L201	i5206	Y	L157	L206	i5207	Y	L157	L220	i5208	Y	L157	L215
i5209	Y	L158	L201	i5210	Y	L158	L206	i5211	Y	L158	L220	i5212	Y	L158	L215
i5213	Y	L159	L201	i5214	Y	L159	L206	i5215	Y	L159	L220	i5216	Y	L159	L215
i5217	Y	L160	L201	i5218	Y	L160	L206	i5219	Y	L160	L220	i5220	Y	L160	L215
i5221	Y	L161	L201	i5222	Y	L161	L206	i5223	Y	L161	L220	i5224	Y	L161	L215
i5225	Y	L162	L201	i5226	Y	L162	L206	i5227	Y	L162	L220	i5228	Y	L162	L215
i5229	Y	L163	L201	i5230	Y	L163	L206	i5231	Y	L163	L220	i5232	Y	L163	L215
i5233	Y	L164	L201	i5234	Y	L164	L206	i5235	Y	L164	L220	i5236	Y	L164	L215
i5237	Y	L165	L201	i5238	Y	L165	L206	i5239	Y	L165	L220	i5240	Y	L165	L215
i5241	Y	L166	L201	i5242	Y	L166	L206	i5243	Y	L166	L220	i5244	Y	L166	L215
i5245	Y	L167	L201	i5246	Y	L167	L206	i5247	Y	L167	L220	i5248	Y	L167	L215
i5249	Y	L168	L201	i5250	Y	L168	L206	i5251	Y	L168	L220	i5252	Y	L168	L215
i5253	Y	L169	L201	i5254	Y	L169	L206	i5255	Y	L169	L220	i5256	Y	L169	L215
i5257	Y	L170	L201	i5258	Y	L170	L206	i5259	Y	L170	L220	i5260	Y	L170	L215
i5261	Y	L171	L201	i5262	Y	L171	L206	i5263	Y	L171	L220	i5264	Y	L171	L215
i5265	Y	L172	L201	i5266	Y	L172	L206	i5267	Y	L172	L220	i5268	Y	L172	L215
i5269	Y	L173	L201	i5270	Y	L173	L206	i5271	Y	L173	L220	i5272	Y	L173	L215
i5273	Y	L174	L201	i5274	Y	L174	L206	i5275	Y	L174	L220	i5276	Y	L174	L215
i5277	Y	L175	L201	i5278	Y	L175	L206	i5279	Y	L175	L220	i5280	Y	L175	L215
i5281	Y	L176	L201	i5282	Y	L176	L206	i5283	Y	L176	L220	i5284	Y	L176	L215
i5285	Y	L177	L201	i5286	Y	L177	L206	i5287	Y	L177	L220	i5288	Y	L177	L215
i5289	Y	L178	L201	i5290	Y	L178	L206	i5291	Y	L178	L220	i5292	Y	L178	L215
i5293	Y	L179	L201	i5294	Y	L179	L206	i5295	Y	L179	L220	i5296	Y	L179	L215
i5297	Y	L180	L201	i5298	Y	L180	L206	i5299	Y	L180	L220	i5300	Y	L180	L215
i5301	Y	L181	L201	i5302	Y	L181	L206	i5303	Y	L181	L220	i5304	Y	L181	L215
i5305	Y	L182	L201	i5306	Y	L182	L206	i5307	Y	L182	L220	i5308	Y	L182	L215
i5309	Y	L183	L201	i5310	Y	L183	L206	i5311	Y	L183	L220	i5312	Y	L183	L215
i5313	Y	L184	L201	i5314	Y	L184	L206	i5315	Y	L184	L220	i5316	Y	L184	L215
i5317	Y	L185	L201	i5318	Y	L185	L206	i5319	Y	L185	L220	i5320	Y	L185	L215
i5321	Y	L186	L201	i5322	Y	L186	L206	i5323	Y	L186	L220	i5324	Y	L186	L215
i5325	Y	L187	L201	i5326	Y	L187	L206	i5327	Y	L187	L220	i5328	Y	L187	L215
i5329	Y	L188	L201	i5330	Y	L188	L206	i5331	Y	L188	L220	i5332	Y	L188	L215
i5333	Y	L189	L201	i5334	Y	L189	L206	i5335	Y	L189	L220	i5336	Y	L189	L215
i5337	Y	L190	L201	i5338	Y	L190	L206	i5339	Y	L190	L220	i5340	Y	L190	L215
i5341	Y	L191	L201	i5342	Y	L191	L206	i5343	Y	L191	L220	i5344	Y	L191	L215
i5345	Y	L192	L201	i5346	Y	L192	L206	i5347	Y	L192	L220	i5348	Y	L192	L215
i5349	Y	L193	L201	i5350	Y	L193	L206	i5351	Y	L193	L220	i5352	Y	L193	L215
i5353	Y	L194	L201	i5354	Y	L194	L206	i5355	Y	L194	L220	i5356	Y	L194	L215
i5357	Y	L195	L201	i5358	Y	L195	L206	i5359	Y	L195	L220	i5360	Y	L195	L215
i5361	Y	L196	L201	i5362	Y	L196	L206	i5363	Y	L196	L220	i5364	Y	L196	L215
i5365	Y	L197	L201	i5366	Y	L197	L206	i5367	Y	L197	L220	i5368	Y	L197	L215
i5369	Y	L198	L201	i5370	Y	L198	L206	i5371	Y	L198	L220	i5372	Y	L198	L215
i5373	Y	L199	L201	i5374	Y	L199	L206	i5375	Y	L199	L220	i5376	Y	L199	L215
i5377	Y	L200	L201	i5378	Y	L200	L206	i5379	Y	L200	L220	i5380	Y	L200	L215
i5381	Y	L201	L201	i5382	Y	L201	L206	i5383	Y	L201	L220	i5384	Y	L201	L215
i5385	Y	L202	L201	i5386	Y	L202	L206	i5387	Y	L202	L220	i5388	Y	L202	L215
i5389	Y	L203	L201	i5390	Y	L203	L206	i5391	Y	L203	L220	i5392	Y	L203	L215
i5393	Y	L204	L201	i5394	Y	L204	L206	i5395	Y	L204	L220	i5396	Y	L204	L215
i5397	Y	L205	L201	i5398	Y	L205	L206	i5399	Y	L205	L220	i5400	Y	L205	L215
i5401	Y	L206	L201	i5402	Y	L206	L206	i5403	Y	L206	L220	i5404	Y	L206	L215
i5405	Y	L207	L201	i5406	Y	L207	L206	i5407	Y	L207	L220	i5408	Y	L207	L215
i5409	Y	L208	L201	i5410	Y	L208	L206	i5411	Y	L208	L220	i5412	Y	L208	L215
i5413	Y	L209	L201	i5414	Y	L209	L206	i5415	Y	L209	L220	i5416	Y	L209	L215
i5417	Y	L210	L201	i5418	Y	L210	L206	i5419	Y	L210	L220	i5420	Y	L210	L215
i5421	Y	L211	L201	i5422	Y	L211	L206	i5423	Y	L211	L220	i5424	Y	L211	L215
i5425	Y	L212	L201	i5426	Y	L212	L206	i5427	Y	L212	L220	i5428	Y	L212	L215
i5429	Y	L213	L201	i5430	Y	L213	L206	i5431	Y	L213	L220	i5432	Y	L213	L215
i5433	Y	L214	L201	i5434	Y	L214	L206	i5435	Y	L214	L220	i5436	Y	L214	L215
i5437	Y	L215	L201	i5438	Y	L215	L206	i5439	Y	L215	L220	i5440	Y	L215	L215
i5441	Y	L216	L201	i5442	Y	L216	L206	i5443	Y	L216	L220	i5444	Y	L216	L215
i5445	Y	L217	L201	i5446	Y	L217	L206	i5447	Y	L217	L220	i5448	Y	L217	L215
i5449	Y	L218	L201	i5450	Y	L218	L206	i5451	Y	L218	L220	i5452	Y	L218	L215
i5453	Y	L219	L201	i5454	Y	L219	L206	i5455	Y	L219	L220	i5456	Y	L219	L215
i5457	Y	L220	L201	i5458	Y	L220	L206	i5459	Y	L220	L220	i5460	Y	L220	L215
i5461	Y	L221	L201	i5462	Y	L221	L206	i5463	Y	L221	L220	i5464	Y	L221	L215
i5465	Y	L222	L201	i5466	Y	L222	L206	i5467	Y	L222	L220	i5468	Y	L222	L215
i5469	Y	L401	L201	i5470	Y	L401	L206	i5471	Y	L401	L220	i5472	Y	L401	L215
i5473	Y	L402	L201	i5474	Y	L402	L206	i5475	Y	L402	L220	i5476	Y	L402	L215
i5477	Y	L403	L201	i5478	Y	L403	L206	i5479	Y	L403	L220	i5480	Y	L403	L215
i5481	Y	L404	L201	i5482	Y	L404	L206	i5483	Y	L404	L220	i5484	Y	L404	L215
i5485	Y	L405	L201	i5486	Y	L405	L206	i5487	Y	L405	L220	i5488	Y	L405	L215
i5489	Y	L406	L201	i5490	Y	L406	L206	i5491	Y	L406	L220	i5492	Y	L406	L215
i5493	Y	L407	L201	i5494	Y	L407	L206	i5495	Y	L407	L220	i5496	Y	L407	L215
i5497	Y	L408	L201	i5498	Y	L408	L206	i5499	Y	L408	L220	i5500	Y	L408	L215
i5501	Y	L409	L201	i5502	Y	L409	L206	i5503	Y	L409	L220	i5504	Y	L409	L215
i5505	Y	L410	L201	i5506	Y	L410	L206	i5507	Y	L410	L220	i5508	Y	L410	L215
i5509	Y	L411	L201	i5510	Y	L411	L206	i5511	Y	L411	L220	i5512	Y	L411	L215
i5513	Y	L412	L201	i5514	Y	L412	L206	i5515	Y	L412	L220	i5516	Y	L412	L215
i5517	Y	L413	L201	i5518	Y	L413	L206	i5519	Y	L413	L220	i5520	Y	L413	L215
i5521	Y	L414	L201	i5522	Y	L414	L206	i5523	Y	L414	L220	i5524	Y	L414	L215
i5525	Y	L415	L201	i5526	Y	L415	L206	i5527	Y	L415	L220	i5528	Y	L415	L215
i5529	Y	L416	L201	i5530	Y	L416	L206	i5531	Y	L416	L220	i5532	Y	L416	L215
i5533	Y	L417	L201	i5534	Y	L417	L206	i5535	Y	L417	L220	i5536	Y	L417	L215
i5537	Y	L418	L201	i5538	Y	L418	L206	i5539	Y	L418	L220	i5540	Y	L418	L215
i5541	Y	L419	L201	i5542	Y	L419	L206	i5543	Y	L419	L220	i5544	Y	L419	L215
i5545	Y	L420	L201	i5546	Y	L420	L206	i5547	Y	L420	L220	i5548	Y	L420	L215
i5549	Y	L421	L201	i5550	Y	L421	L206	i5551	Y	L421	L220	i5552	Y	L421	L215
i5553	Y	L422	L201	i5554	Y	L422	L206	i5555	Y	L422	L220	i5556	Y	L422	L215
i5557	Y	L423	L201	i5558	Y	L423	L206	i5559	Y	L423	L220	i5560	Y	L423	L215
i5561	Y	L424	L201	i5562	Y	L424	L206	i5563	Y	L424	L220	i5564	Y	L424	L215
i5565	Y	L425	L201	i5566	Y	L425	L206	i5567	Y	L425	L220	i5568	Y	L425	L215
i5569	Y	L501	L201	i5570	Y	L501	L206	i5571	Y	L501	L220	i5572	Y	L501	L215
i5573	Y	L502	L201	i5574	Y	L502	L206	i5575	Y	L502	L220	i5576	Y	L502	L215
i5577	Y	L503	L201	i5578	Y	L503	L206	i5579	Y	L503	L220	i5580	Y	L503	L215
i5581	Y	L504	L201	i5582	Y	L504	L206	i5583	Y	L504	L220	i5584	Y	L504	L215
i5585	Y	L505	L201	i5586	Y	L505	L206	i5587	Y	L505	L220	i5588	Y	L505	L215
i5589	Y	L506	L201	i5590	Y	L506	L206	i5591	Y	L506	L220	i5592	Y	L506	L215
i5593	Y	L507	L201	i5594	Y	L507	L206	i5595	Y	L507	L220	i5596	Y	L507	L215
i5597	Y	L508	L201	i5598	Y	L508	L206	i5599	Y	L508	L220	i5600	Y	L508	L215
i5601	Y	L509	L201	i5602	Y	L509	L206	i5603	Y	L509	L220	i5604	Y	L509	L215
i5605	Y	L510	L201	i5606	Y	L510	L206	i5607	Y	L510	L220	i5608	Y	L510	L215
i5609	Y	L511	L201	i5610	Y	L511	L206	i5611	Y	L511	L220	i5612	Y	L511	L215
i5613	Y	L512	L201	i5614	Y	L512	L206	i5615	Y	L512	L220	i5616	Y	L512	L215
i5617	Y	L513	L201	i5618	Y	L513	L206	i5619	Y	L513	L220	i5620	Y	L513	L215
i5621	Y	L514	L201	i5622	Y	L514	L206	i5623	Y	L514	L220	i5624	Y	L514	L215
i5625	Y	L515	L201	i5626	Y	L515	L206	i5627	Y	L515	L220	i5628	Y	L515	L215
i5629	Y	L516	L201	i5630	Y	L516	L206	i5631	Y	L516	L220	i5632	Y	L516	L215
i5633	Y	L517	L201	i5634	Y	L517	L206	i5635	Y	L517	L220	i5636	Y	L517	L215
i5637	Y	L518	L201	i5638	Y	L518	L206	i5639	Y	L518	L220	i5640	Y	L518	L215
i5641	Y	L519	L201	i5642	Y	L519	L206	i5643	Y	L519	L220	i5644	Y	L519	L215
i5645	Y	L520	L201	i5646	Y	L520	L206	i5647	Y	L520	L220	i5648	Y	L520	L215
i5649	Y	L521	L201	i5650	Y	L521	L206	i5651	Y	L521	L220	i5652	Y	L521	L215
i5653	Y	L522	L201	i5654	Y	L522	L206	i5655	Y	L522	L220	i5656	Y	L522	L215
i5657	Y	L523	L201	i5658	Y	L523	L206	i5659	Y	L523	L220	i5660	Y	L523	L215
i5661	Y	L524	L201	i5662	Y	L524	L206	i5663	Y	L524	L220	i5664	Y	L524	L215
i5665	Y	L525	L201	i5666	Y	L525	L206	i5667	Y	L525	L220	i5668	Y	L525	L215
i5669	Y	L526	L201	i5670	Y	L526	L206	i5671	Y	L526	L220	i5672	Y	L526	L215
i5673	Y	L527	L201	i5674	Y	L527	L206	i5675	Y	L527	L220	i5676	Y	L527	L215
i5677	Y	L528	L201	i5678	Y	L528	L206	i5679	Y	L528	L220	i5680	Y	L528	L215
i5681	Y	L529	L201	i5682	Y	L529	L206	i5683	Y	L529	L220	i5684	Y	L529	L215
i5685	Y	L530	L201	i5686	Y	L530	L206	i5687	Y	L530	L220	i5688	Y	L530	L215
i5689	Y	L531	L201	i5690	Y	L531	L206	i5691	Y	L531	L220	i5692	Y	L531	L215
i5693	Y	L532	L201	i5694	Y	L532	L206	i5695	Y	L532	L220	i5696	Y	L532	L215
i5697	Y	L533	L201	i5698	Y	L533	L206	i5699	Y	L533	L220	i5700	Y	L533	L215
i5701	Y	L534	L201	i5702	Y	L534	L206	i5703	Y	L534	L220	i5704	Y	L534	L215
i5705	Y	L535	L201	i5706	Y	L535	L206	i5707	Y	L535	L220	i5708	Y	L535	L215
i5709	Y	L536	L201	i5710	Y	L536	L206	i5711	Y	L536	L220	i5712	Y	L536	L215
i5713	Y	L537	L201	i5714	Y	L537	L206	i5715	Y	L537	L220	i5716	Y	L537	L215
i5717	Y	L538	L201	i5718	Y	L538	L206	i5719	Y	L538	L220	i5720	Y	L538	L215
i5721	Y	L539	L201	i5722	Y	L539	L206	i5723	Y	L539	L220	i5724	Y	L539	L215
i5725	Y	L540	L201	i5726	Y	L540	L206	i5727	Y	L540	L220	i5728	Y	L540	L215
i5729	Y	L541	L201	i5730	Y	L541	L206	i5731	Y	L541	L220	i5732	Y	L541	L215
i5733	Y	L542	L201	i5734	Y	L542	L206	i5735	Y	L542	L220	i5736	Y	L542	L215
i5737	Y	L543	L201	i5738	Y	L543	L206	i5739	Y	L543	L220	i5740	Y	L543	L215
i5741	Y	L544	L201	i5742	Y	L544	L206	i5743	Y	L544	L220	i5744	Y	L544	L215
i5745	Y	L545	L201	i5746	Y	L545	L206	i5747	Y	L545	L220	i5748	Y	L545	L215
i5749	Y	L546	L201	i5750	Y	L546	L206	i5751	Y	L546	L220	i5752	Y	L546	L215
i5753	Y	L547	L201	i5754	Y	L547	L206	i5755	Y	L547	L220	i5756	Y	L547	L215
i5757	Y	L548	L201	i5758	Y	L548	L206	i5759	Y	L548	L220	i5760	Y	L548	L215
i5761	Y	L549	L201	i5762	Y	L549	L206	i5763	Y	L549	L220	i5764	Y	L549	L215
i5765	Y	L550	L201	i5766	Y	L550	L206	i5767	Y	L550	L220	i5768	Y	L550	L215
i5769	Y	L551	L201	i5770	Y	L551	L206	i5771	Y	L551	L220	i5772	Y	L551	L215
i5773	Y	L552	L201	i5774	Y	L552	L206	i5775	Y	L552	L220	i5776	Y	L552	L215
i5777	Y	L553	L201	i5778	Y	L553	L206	i5779	Y	L553	L220	i5780	Y	L553	L215
i5781	Y	L554	L201	i5782	Y	L554	L206	i5783	Y	L554	L220	i5784	Y	L554	L215
i5785	Y	L555	L201	i5786	Y	L555	L206	i5787	Y	L555	L220	i5788	Y	L555	L215
i5789	Y	L556	L201	i5790	Y	L556	L206	i5791	Y	L556	L220	i5792	Y	L556	L215
i5793	Y	L557	L201	i5794	Y	L557	L206	i5795	Y	L557	L220	i5796	Y	L557	L215
i5797	Y	L558	L201	i5798	Y	L558	L206	i5799	Y	L558	L220	i5800	Y	L558	L215
i5801	Y	L559	L201	i5802	Y	L559	L206	i5803	Y	L559	L220	i5804	Y	L559	L215
i5805	Y	L560	L201	i5806	Y	L560	L206	i5807	Y	L560	L220	i5808	Y	L560	L215
i5809	Y	L561	L201	i5810	Y	L561	L206	i5811	Y	L561	L220	i5812	Y	L561	L215
i5813	Y	L562	L201	i5814	Y	L562	L206	i5815	Y	L562	L220	i5816	Y	L562	L215
i5817	Y	L563	L201	i5818	Y	L563	L206	i5819	Y	L563	L220	i5820	Y	L563	L215
i5821	Y	L564	L201	i5822	Y	L564	L206	i5823	Y	L564	L220	i5824	Y	L564	L215
i5825	Y	L565	L201	i5826	Y	L565	L206	i5827	Y	L565	L220	i5828	Y	L565	L215
i5829	Y	L566	L201	i5830	Y	L566	L206	i5831	Y	L566	L220	i5832	Y	L566	L215
i5833	Y	L567	L201	i5834	Y	L567	L206	i5835	Y	L567	L220	i5836	Y	L567	L215
i5837	Y	L568	L201	i5838	Y	L568	L206	i5839	Y	L568	L220	i5840	Y	L568	L215
i5841	Y	L569	L201	i5842	Y	L569	L206	i5843	Y	L569	L220	i5844	Y	L569	L215
i5845	Y	L570	L201	i5846	Y	L570	L206	i5847	Y	L570	L220	i5848	Y	L570	L215
i5849	Y	L571	L201	i5850	Y	L571	L206	i5851	Y	L571	L220	i5852	Y	L571	L215
i5853	Y	L572	L201	i5854	Y	L572	L206	i5855	Y	L572	L220	i5856	Y	L572	L215
i5857	Y	L843	L201	i5858	Y	L843	L206	i5859	Y	L843	L220	i5860	Y	L843	L215
i5861	Y	L844	L201	i5862	Y	L844	L206	i5863	Y	L844	L220	i5864	Y	L844	L215
i5865	Y	L845	L201	i5866	Y	L845	L206	i5867	Y	L845	L220	i5868	Y	L845	L215
i5869	Y	L846	L201	i5870	Y	L846	L206	i5871	Y	L846	L220	i5872	Y	L846	L215
i5873	Y	L847	L201	i5874	Y	L847	L206	i5875	Y	L847	L220	i5876	Y	L847	L215
i5877	Y	L848	L201	i5878	Y	L848	L206	i5879	Y	L848	L220	i5880	Y	L848	L215
i5881	Y	L10	L211	i5882	Y	L10	L212	i5883	Y	L10	L426	i5884	Y	L10	L427
i5885	Y	L11	L211	i5886	Y	L11	L212	i5887	Y	L11	L426	i5888	Y	L11	L427
i5889	Y	L20	L211	i5890	Y	L20	L212	i5891	Y	L20	L426	i5892	Y	L20	L427
i5893	Y	L21	L211	i5894	Y	L21	L212	i5895	Y	L21	L426	i5896	Y	L21	L427
i5897	Y	L22	L211	i5898	Y	L22	L212	i5899	Y	L22	L426	i5900	Y	L22	L427
i5901	Y	L23	L211	i5902	Y	L23	L212	i5903	Y	L23	L426	i5904	Y	L23	L427
i5905	Y	L24	L211	i5906	Y	L24	L212	i5907	Y	L24	L426	i5908	Y	L24	L427
i5909	Y	L25	L211	i5910	Y	L25	L212	i5911	Y	L25	L426	i5912	Y	L25	L427
i5913	Y	L26	L211	i5914	Y	L26	L212	i5915	Y	L26	L426	i5916	Y	L26	L427
i5917	Y	L27	L211	i5918	Y	L27	L212	i5919	Y	L27	L426	i5920	Y	L27	L427
i5921	Y	L28	L211	i5922	Y	L28	L212	i5923	Y	L28	L426	i5924	Y	L28	L427
i5925	Y	L12	L211	i5926	Y	L12	L212	i5927	Y	L12	L426	i5928	Y	L12	L427
i5929	Y	L13	L211	i5930	Y	L13	L212	i5931	Y	L13	L426	i5932	Y	L13	L427
i5933	Y	L14	L211	i5934	Y	L14	L212	i5935	Y	L14	L426	i5936	Y	L14	L427
i5937	Y	L15	L211	i5938	Y	L15	L212	i5939	Y	L15	L426	i5940	Y	L15	L427
i5941	Y	L16	L211	i5942	Y	L16	L212	i5943	Y	L16	L426	i5944	Y	L16	L427
i5945	Y	L17	L211	i5946	Y	L17	L212	i5947	Y	L17	L426	i5948	Y	L17	L427
i5949	Y	L18	L211	i5950	Y	L18	L212	i5951	Y	L18	L426	i5952	Y	L18	L427
i5953	Y	L19	L211	i5954	Y	L19	L212	i5955	Y	L19	L426	i5956	Y	L19	L427
i5957	Y	L2	L211	i5958	Y	L2	L212	i5959	Y	L2	L426	i5960	Y	L2	L427
i5961	Y	L101	L211	i5962	Y	L101	L212	i5963	Y	L101	L426	i5964	Y	L101	L427
i5965	Y	L102	L211	i5966	Y	L102	L212	i5967	Y	L102	L426	i5968	Y	L102	L427
i5969	Y	L103	L211	i5970	Y	L103	L212	i5971	Y	L103	L426	i5972	Y	L103	L427
i5973	Y	L104	L211	i5974	Y	L104	L212	i5975	Y	L104	L426	i5976	Y	L104	L427
i5977	Y	L105	L211	i5978	Y	L105	L212	i5979	Y	L105	L426	i5980	Y	L105	L427
i5981	Y	L106	L211	i5982	Y	L106	L212	i5983	Y	L106	L426	i5984	Y	L106	L427
i5985	Y	L107	L211	i5986	Y	L107	L212	i5987	Y	L107	L426	i5988	Y	L107	L427
i5989	Y	L108	L211	i5990	Y	L108	L212	i5991	Y	L108	L426	i5992	Y	L108	L427
i5993	Y	L109	L211	i5994	Y	L109	L212	i5995	Y	L109	L426	i5996	Y	L109	L427
i5997	Y	L110	L211	i5998	Y	L110	L212	i5999	Y	L110	L426	i6000	Y	L110	L427
i6001	Y	L111	L211	i6002	Y	L111	L212	i6003	Y	L111	L426	i6004	Y	L111	L427
i6005	Y	L112	L211	i6006	Y	L112	L212	i6007	Y	L112	L426	i6008	Y	L112	L427
i6009	Y	L113	L211	i6010	Y	L113	L212	i6011	Y	L113	L426	i6012	Y	L113	L427
i6013	Y	L114	L211	i6014	Y	L114	L212	i6015	Y	L114	L426	i6016	Y	L114	L427
i6017	Y	L115	L211	i6018	Y	L115	L212	i6019	Y	L115	L426	i6020	Y	L115	L427
i6021	Y	L116	L211	i6022	Y	L116	L212	i6023	Y	L116	L426	i6024	Y	L116	L427
i6025	Y	L117	L211	i6026	Y	L117	L212	i6027	Y	L117	L426	i6028	Y	L117	L427
i6029	Y	L118	L211	i6030	Y	L118	L212	i6031	Y	L118	L426	i6032	Y	L118	L427
i6033	Y	L119	L211	i6034	Y	L119	L212	i6035	Y	L119	L426	i6036	Y	L119	L427
i6037	Y	L120	L211	i6038	Y	L120	L212	i6039	Y	L120	L426	i6040	Y	L120	L427
i6041	Y	L121	L211	i6042	Y	L121	L212	i6043	Y	L121	L426	i6044	Y	L121	L427
i6045	Y	L122	L211	i6046	Y	L122	L212	i6047	Y	L122	L426	i6048	Y	L122	L427
i6049	Y	L123	L211	i6050	Y	L123	L212	i6051	Y	L123	L426	i6052	Y	L123	L427
i6053	Y	L124	L211	i6054	Y	L124	L212	i6055	Y	L124	L426	i6056	Y	L124	L427
i6057	Y	L125	L211	i6058	Y	L125	L212	i6059	Y	L125	L426	i6060	Y	L125	L427
i6061	Y	L126	L211	i6062	Y	L126	L212	i6063	Y	L126	L426	i6064	Y	L126	L427
i6065	Y	L127	L211	i6066	Y	L127	L212	i6067	Y	L127	L426	i6068	Y	L127	L427
i6069	Y	L128	L211	i6070	Y	L128	L212	i6071	Y	L128	L426	i6072	Y	L128	L427
i6073	Y	L129	L211	i6074	Y	L129	L212	i6075	Y	L129	L426	i6076	Y	L129	L427
i6077	Y	L130	L211	i6078	Y	L130	L212	i6079	Y	L130	L426	i6080	Y	L130	L427
i6081	Y	L131	L211	i6082	Y	L131	L212	i6083	Y	L131	L426	i6084	Y	L131	L427
i6085	Y	L132	L211	i6086	Y	L132	L212	i6087	Y	L132	L426	i6088	Y	L132	L427
i6089	Y	L133	L211	i6090	Y	L133	L212	i6091	Y	L133	L426	i6092	Y	L133	L427
i6093	Y	L134	L211	i6094	Y	L134	L212	i6095	Y	L134	L426	i6096	Y	L134	L427
i6097	Y	L135	L211	i6098	Y	L135	L212	i6099	Y	L135	L426	i6100	Y	L135	L427
i6101	Y	L136	L211	i6102	Y	L136	L212	i6103	Y	L136	L426	i6104	Y	L136	L427
i6105	Y	L137	L211	i6106	Y	L137	L212	i6107	Y	L137	L426	i6108	Y	L137	L427
i6109	Y	L138	L211	i6110	Y	L138	L212	i6111	Y	L138	L426	i6112	Y	L138	L427
i6113	Y	L139	L211	i6114	Y	L139	L212	i6115	Y	L139	L426	i6116	Y	L139	L427
i6117	Y	L140	L211	i6118	Y	L140	L212	i6119	Y	L140	L426	i6120	Y	L140	L427
i6121	Y	L141	L211	i6122	Y	L141	L212	i6123	Y	L141	L426	i6124	Y	L141	L427
i6125	Y	L142	L211	i6126	Y	L142	L212	i6127	Y	L142	L426	i6128	Y	L142	L427
i6129	Y	L143	L211	i6130	Y	L143	L212	i6131	Y	L143	L426	i6132	Y	L143	L427
i6133	Y	L144	L211	i6134	Y	L144	L212	i6135	Y	L144	L426	i6136	Y	L144	L427
i6137	Y	L145	L211	i6138	Y	L145	L212	i6139	Y	L145	L426	i6140	Y	L145	L427
i6141	Y	L146	L211	i6142	Y	L146	L212	i6143	Y	L146	L426	i6144	Y	L146	L427
i6145	Y	L147	L211	i6146	Y	L147	L212	i6147	Y	L147	L426	i6148	Y	L147	L427
i6149	Y	L148	L211	i6150	Y	L148	L212	i6151	Y	L148	L426	i6152	Y	L148	L427
i6153	Y	L149	L211	i6154	Y	L149	L212	i6155	Y	L149	L426	i6156	Y	L149	L427
i6157	Y	L150	L211	i6158	Y	L150	L212	i6159	Y	L150	L426	i6160	Y	L150	L427
i6161	Y	L151	L211	i6162	Y	L151	L212	i6163	Y	L151	L426	i6164	Y	L151	L427
i6165	Y	L152	L211	i6166	Y	L152	L212	i6167	Y	L152	L426	i6168	Y	L152	L427
i6169	Y	L153	L211	i6170	Y	L153	L212	i6171	Y	L153	L426	i6172	Y	L153	L427
i6173	Y	L154	L211	i6174	Y	L154	L212	i6175	Y	L154	L426	i6176	Y	L154	L427
i6177	Y	L155	L211	i6178	Y	L155	L212	i6179	Y	L155	L426	i6180	Y	L155	L427
i6181	Y	L156	L211	i6182	Y	L156	L212	i6183	Y	L156	L426	i6184	Y	L156	L427
i6185	Y	L157	L211	i6186	Y	L157	L212	i6187	Y	L157	L426	i6188	Y	L157	L427
i6189	Y	L158	L211	i6190	Y	L158	L212	i6191	Y	L158	L426	i6192	Y	L158	L427
i6193	Y	L159	L211	i6194	Y	L159	L212	i6195	Y	L159	L426	i6196	Y	L159	L427
i6197	Y	L160	L211	i6198	Y	L160	L212	i6199	Y	L160	L426	i6200	Y	L160	L427
i6201	Y	L161	L211	i6202	Y	L161	L212	i6203	Y	L161	L426	i6204	Y	L161	L427
i6205	Y	L162	L211	i6206	Y	L162	L212	i6207	Y	L162	L426	i6208	Y	L162	L427
i6209	Y	L163	L211	i6210	Y	L163	L212	i6211	Y	L163	L426	i6212	Y	L163	L427
i6213	Y	L164	L211	i6214	Y	L164	L212	i6215	Y	L164	L426	i6216	Y	L164	L427
i6217	Y	L165	L211	i6218	Y	L165	L212	i6219	Y	L165	L426	i6220	Y	L165	L427
i6221	Y	L166	L211	i6222	Y	L166	L212	i6223	Y	L166	L426	i6224	Y	L166	L427
i6225	Y	L167	L211	i6226	Y	L167	L212	i6227	Y	L167	L426	i6228	Y	L167	L427
i6229	Y	L168	L211	i6230	Y	L168	L212	i6231	Y	L168	L426	i6232	Y	L168	L427
i6233	Y	L169	L211	i6234	Y	L169	L212	i6235	Y	L169	L426	i6236	Y	L169	L427
i6237	Y	L170	L211	i6238	Y	L170	L212	i6239	Y	L170	L426	i6240	Y	L170	L427
i6241	Y	L171	L211	i6242	Y	L171	L212	i6243	Y	L171	L426	i6244	Y	L171	L427
i6245	Y	L172	L211	i6246	Y	L172	L212	i6247	Y	L172	L426	i6248	Y	L172	L427
i6249	Y	L173	L211	i6250	Y	L173	L212	i6251	Y	L173	L426	i6252	Y	L173	L427
i6253	Y	L174	L211	i6254	Y	L174	L212	i6255	Y	L174	L426	i6256	Y	L174	L427
i6257	Y	L175	L211	i6258	Y	L175	L212	i6259	Y	L175	L426	i6260	Y	L175	L427
i6261	Y	L176	L211	i6262	Y	L176	L212	i6263	Y	L176	L426	i6264	Y	L176	L427
i6265	Y	L177	L211	i6266	Y	L177	L212	i6267	Y	L177	L426	i6268	Y	L177	L427
i6269	Y	L178	L211	i6270	Y	L178	L212	i6271	Y	L178	L426	i6272	Y	L178	L427
i6273	Y	L179	L211	i6274	Y	L179	L212	i6275	Y	L179	L426	i6276	Y	L179	L427
i6277	Y	L180	L211	i6278	Y	L180	L212	i6279	Y	L180	L426	i6280	Y	L180	L427
i6281	Y	L181	L211	i6282	Y	L181	L212	i6283	Y	L181	L426	i6284	Y	L181	L427
i6285	Y	L182	L211	i6286	Y	L182	L212	i6287	Y	L182	L426	i6288	Y	L182	L427
i6289	Y	L183	L211	i6290	Y	L183	L212	i6291	Y	L183	L426	i6292	Y	L183	L427
i6293	Y	L184	L211	i6294	Y	L184	L212	i6295	Y	L184	L426	i6296	Y	L184	L427
i6297	Y	L185	L211	i6298	Y	L185	L212	i6299	Y	L185	L426	i6300	Y	L185	L427
i6301	Y	L186	L211	i6302	Y	L186	L212	i6303	Y	L186	L426	i6304	Y	L186	L427
i6305	Y	L187	L211	i6306	Y	L187	L212	i6307	Y	L187	L426	i6308	Y	L187	L427
i6309	Y	L188	L211	i6310	Y	L188	L212	i6311	Y	L188	L426	i6312	Y	L188	L427
i6313	Y	L189	L211	i6314	Y	L189	L212	i6315	Y	L189	L426	i6316	Y	L189	L427
i6317	Y	L190	L211	i6318	Y	L190	L212	i6319	Y	L190	L426	i6320	Y	L190	L427
i6321	Y	L191	L211	i6322	Y	L191	L212	i6323	Y	L191	L426	i6324	Y	L191	L427
i6325	Y	L192	L211	i6326	Y	L192	L212	i6327	Y	L192	L426	i6328	Y	L192	L427
i6329	Y	L193	L211	i6330	Y	L193	L212	i6331	Y	L193	L426	i6332	Y	L193	L427
i6333	Y	L194	L211	i6334	Y	L194	L212	i6335	Y	L194	L426	i6336	Y	L194	L427
i6337	Y	L195	L211	i6338	Y	L195	L212	i6339	Y	L195	L426	i6340	Y	L195	L427
i6341	Y	L196	L211	i6342	Y	L196	L212	i6343	Y	L196	L426	i6344	Y	L196	L427
i6345	Y	L197	L211	i6346	Y	L197	L212	i6347	Y	L197	L426	i6348	Y	L197	L427
i6349	Y	L198	L211	i6350	Y	L198	L212	i6351	Y	L198	L426	i6352	Y	L198	L427
i6353	Y	L199	L211	i6354	Y	L199	L212	i6355	Y	L199	L426	i6356	Y	L199	L427
i6357	Y	L200	L211	i6358	Y	L200	L212	i6359	Y	L200	L426	i6360	Y	L200	L427
i6361	Y	L201	L211	i6362	Y	L201	L212	i6363	Y	L201	L426	i6364	Y	L201	L427
i6365	Y	L202	L211	i6366	Y	L202	L212	i6367	Y	L202	L426	i6368	Y	L202	L427
i6369	Y	L203	L211	i6370	Y	L203	L212	i6371	Y	L203	L426	i6372	Y	L203	L427
i6373	Y	L204	L211	i6374	Y	L204	L212	i6375	Y	L204	L426	i6376	Y	L204	L427
i6377	Y	L205	L211	i6378	Y	L205	L212	i6379	Y	L205	L426	i6380	Y	L205	L427
i6381	Y	L206	L211	i6382	Y	L206	L212	i6383	Y	L206	L426	i6384	Y	L206	L427
i6385	Y	L207	L211	i6386	Y	L207	L212	i6387	Y	L207	L426	i6388	Y	L207	L427
i6389	Y	L208	L211	i6390	Y	L208	L212	i6391	Y	L208	L426	i6392	Y	L208	L427
i6393	Y	L209	L211	i6394	Y	L209	L212	i6395	Y	L209	L426	i6396	Y	L209	L427
i6397	Y	L210	L211	i6398	Y	L210	L212	i6399	Y	L210	L426	i6400	Y	L210	L427
i6401	Y	L211	L211	i6402	Y	L211	L212	i6403	Y	L211	L426	i6404	Y	L211	L427
i6405	Y	L212	L211	i6406	Y	L212	L212	i6407	Y	L212	L426	i6408	Y	L212	L427
i6409	Y	L213	L211	i6410	Y	L213	L212	i6411	Y	L213	L426	i6412	Y	L213	L427
i6413	Y	L214	L211	i6414	Y	L214	L212	i6415	Y	L214	L426	i6416	Y	L214	L427
i6417	Y	L215	L211	i6418	Y	L215	L212	i6419	Y	L215	L426	i6420	Y	L215	L427
i6421	Y	L216	L211	i6422	Y	L216	L212	i6423	Y	L216	L426	i6424	Y	L216	L427
i6425	Y	L217	L211	i6426	Y	L217	L212	i6427	Y	L217	L426	i6428	Y	L217	L427
i6429	Y	L218	L211	i6430	Y	L218	L212	i6431	Y	L218	L426	i6432	Y	L218	L427
i6433	Y	L219	L211	i6434	Y	L219	L212	i6435	Y	L219	L426	i6436	Y	L219	L427
i6437	Y	L220	L211	i6438	Y	L220	L212	i6439	Y	L220	L426	i6440	Y	L220	L427
i6441	Y	L221	L211	i6442	Y	L221	L212	i6443	Y	L221	L426	i6444	Y	L221	L427
i6445	Y	L222	L211	i6446	Y	L222	L212	i6447	Y	L222	L426	i6448	Y	L222	L427
i6449	Y	L401	L211	i6450	Y	L401	L212	i6451	Y	L401	L426	i6452	Y	L401	L427
i6453	Y	L402	L211	i6454	Y	L402	L212	i6455	Y	L402	L426	i6456	Y	L402	L427
i6457	Y	L403	L211	i6458	Y	L403	L212	i6459	Y	L403	L426	i6460	Y	L403	L427
i6461	Y	L404	L211	i6462	Y	L404	L212	i6463	Y	L404	L426	i6464	Y	L404	L427
i6465	Y	L405	L211	i6466	Y	L405	L212	i6467	Y	L405	L426	i6468	Y	L405	L427
i6469	Y	L406	L211	i6470	Y	L406	L212	i6471	Y	L406	L426	i6472	Y	L406	L427
i6473	Y	L407	L211	i6474	Y	L407	L212	i6475	Y	L407	L426	i6476	Y	L407	L427
i6477	Y	L408	L211	i6478	Y	L408	L212	i6479	Y	L408	L426	i6480	Y	L408	L427
i6481	Y	L409	L211	i6482	Y	L409	L212	i6483	Y	L409	L426	i6484	Y	L409	L427
i6485	Y	L410	L211	i6486	Y	L410	L212	i6487	Y	L410	L426	i6488	Y	L410	L427
i6489	Y	L411	L211	i6490	Y	L411	L212	i6491	Y	L411	L426	i6492	Y	L411	L427
i6493	Y	L412	L211	i6494	Y	L412	L212	i6495	Y	L412	L426	i6496	Y	L412	L427
i6497	Y	L413	L211	i6498	Y	L413	L212	i6499	Y	L413	L426	i6500	Y	L413	L427
i6501	Y	L414	L211	i6502	Y	L414	L212	i6503	Y	L414	L426	i6504	Y	L414	L427
i6505	Y	L415	L211	i6506	Y	L415	L212	i6507	Y	L415	L426	i6508	Y	L415	L427
i6509	Y	L416	L211	i6510	Y	L416	L212	i6511	Y	L416	L426	i6512	Y	L416	L427
i6513	Y	L417	L211	i6514	Y	L417	L212	i6515	Y	L417	L426	i6516	Y	L417	L427
i6517	Y	L418	L211	i6518	Y	L418	L212	i6519	Y	L418	L426	i6520	Y	L418	L427
i6521	Y	L419	L211	i6522	Y	L419	L212	i6523	Y	L419	L426	i6524	Y	L419	L427
i6525	Y	L420	L211	i6526	Y	L420	L212	i6527	Y	L420	L426	i6528	Y	L420	L427
i6529	Y	L421	L211	i6530	Y	L421	L212	i6531	Y	L421	L426	i6532	Y	L421	L427
i6533	Y	L422	L211	i6534	Y	L422	L212	i6535	Y	L422	L426	i6536	Y	L422	L427
i6537	Y	L423	L211	i6538	Y	L423	L212	i6539	Y	L423	L426	i6540	Y	L423	L427
i6541	Y	L424	L211	i6542	Y	L424	L212	i6543	Y	L424	L426	i6544	Y	L424	L427
i6545	Y	L425	L211	i6546	Y	L425	L212	i6547	Y	L425	L426	i6548	Y	L425	L427
i6549	Y	L501	L211	i6550	Y	L501	L212	i6551	Y	L501	L426	i6552	Y	L501	L427
i6553	Y	L502	L211	i6554	Y	L502	L212	i6555	Y	L502	L426	i6556	Y	L502	L427
i6557	Y	L503	L211	i6558	Y	L503	L212	i6559	Y	L503	L426	i6560	Y	L503	L427
i6561	Y	L504	L211	i6562	Y	L504	L212	i6563	Y	L504	L426	i6564	Y	L504	L427
i6565	Y	L505	L211	i6566	Y	L505	L212	i6567	Y	L505	L426	i6568	Y	L505	L427
i6569	Y	L506	L211	i6570	Y	L506	L212	i6571	Y	L506	L426	i6572	Y	L506	L427
i6573	Y	L507	L211	i6574	Y	L507	L212	i6575	Y	L507	L426	i6576	Y	L507	L427
i6577	Y	L508	L211	i6578	Y	L508	L212	i6579	Y	L508	L426	i6580	Y	L508	L427
i6581	Y	L509	L211	i6582	Y	L509	L212	i6583	Y	L509	L426	i6584	Y	L509	L427
i6585	Y	L510	L211	i6586	Y	L510	L212	i6587	Y	L510	L426	i6588	Y	L510	L427
i6589	Y	L511	L211	i6590	Y	L511	L212	i6591	Y	L511	L426	i6592	Y	L511	L427
i6593	Y	L512	L211	i6594	Y	L512	L212	i6595	Y	L512	L426	i6596	Y	L512	L427
i6597	Y	L513	L211	i6598	Y	L513	L212	i6599	Y	L513	L426	i6600	Y	L513	L427
i6601	Y	L514	L211	i6602	Y	L514	L212	i6603	Y	L514	L426	i6604	Y	L514	L427
i6605	Y	L515	L211	i6606	Y	L515	L212	i6607	Y	L515	L426	i6608	Y	L515	L427
i6609	Y	L516	L211	i6610	Y	L516	L212	i6611	Y	L516	L426	i6612	Y	L516	L427
i6613	Y	L517	L211	i6614	Y	L517	L212	i6615	Y	L517	L426	i6616	Y	L517	L427
i6617	Y	L518	L211	i6618	Y	L518	L212	i6619	Y	L518	L426	i6620	Y	L518	L427
i6621	Y	L519	L211	i6622	Y	L519	L212	i6623	Y	L519	L426	i6624	Y	L519	L427
i6625	Y	L520	L211	i6626	Y	L520	L212	i6627	Y	L520	L426	i6628	Y	L520	L427
i6629	Y	L521	L211	i6630	Y	L521	L212	i6631	Y	L521	L426	i6632	Y	L521	L427
i6633	Y	L522	L211	i6634	Y	L522	L212	i6635	Y	L522	L426	i6636	Y	L522	L427
i6637	Y	L523	L211	i6638	Y	L523	L212	i6639	Y	L523	L426	i6640	Y	L523	L427
i6641	Y	L524	L211	i6642	Y	L524	L212	i6643	Y	L524	L426	i6644	Y	L524	L427
i6645	Y	L525	L211	i6646	Y	L525	L212	i6647	Y	L525	L426	i6648	Y	L525	L427
i6649	Y	L526	L211	i6650	Y	L526	L212	i6651	Y	L526	L426	i6652	Y	L526	L427
i6653	Y	L527	L211	i6654	Y	L527	L212	i6655	Y	L527	L426	i6656	Y	L527	L427
i6657	Y	L528	L211	i6658	Y	L528	L212	i6659	Y	L528	L426	i6660	Y	L528	L427
i6661	Y	L529	L211	i6662	Y	L529	L212	i6663	Y	L529	L426	i6664	Y	L529	L427
i6665	Y	L530	L211	i6666	Y	L530	L212	i6667	Y	L530	L426	i6668	Y	L530	L427
i6669	Y	L531	L211	i6670	Y	L531	L212	i6671	Y	L531	L426	i6672	Y	L531	L427
i6673	Y	L532	L211	i6674	Y	L532	L212	i6675	Y	L532	L426	i6676	Y	L532	L427
i6677	Y	L533	L211	i6678	Y	L533	L212	i6679	Y	L533	L426	i6680	Y	L533	L427
i6681	Y	L534	L211	i6682	Y	L534	L212	i6683	Y	L534	L426	i6684	Y	L534	L427
i6685	Y	L535	L211	i6686	Y	L535	L212	i6687	Y	L535	L426	i6688	Y	L535	L427
i6689	Y	L536	L211	i6690	Y	L536	L212	i6691	Y	L536	L426	i6692	Y	L536	L427
i6693	Y	L537	L211	i6694	Y	L537	L212	i6695	Y	L537	L426	i6696	Y	L537	L427
i6697	Y	L538	L211	i6698	Y	L538	L212	i6699	Y	L538	L426	i6700	Y	L538	L427
i6701	Y	L539	L211	i6702	Y	L539	L212	i6703	Y	L539	L426	i6704	Y	L539	L427
i6705	Y	L540	L211	i6706	Y	L540	L212	i6707	Y	L540	L426	i6708	Y	L540	L427
i6709	Y	L541	L211	i6710	Y	L541	L212	i6711	Y	L541	L426	i6712	Y	L541	L427
i6713	Y	L542	L211	i6714	Y	L542	L212	i6715	Y	L542	L426	i6716	Y	L542	L427
i6717	Y	L543	L211	i6718	Y	L543	L212	i6719	Y	L543	L426	i6720	Y	L543	L427
i6721	Y	L544	L211	i6722	Y	L544	L212	i6723	Y	L544	L426	i6724	Y	L544	L427
i6725	Y	L545	L211	i6726	Y	L545	L212	i6727	Y	L545	L426	i6728	Y	L545	L427
i6729	Y	L546	L211	i6730	Y	L546	L212	i6731	Y	L546	L426	i6732	Y	L546	L427
i6733	Y	L547	L211	i6734	Y	L547	L212	i6735	Y	L547	L426	i6736	Y	L547	L427
i6737	Y	L548	L211	i6738	Y	L548	L212	i6739	Y	L548	L426	i6740	Y	L548	L427
i6741	Y	L549	L211	i6742	Y	L549	L212	i6743	Y	L549	L426	i6744	Y	L549	L427
i6745	Y	L550	L211	i6746	Y	L550	L212	i6747	Y	L550	L426	i6748	Y	L550	L427
i6749	Y	L551	L211	i6750	Y	L551	L212	i6751	Y	L551	L426	i6752	Y	L551	L427
i6753	Y	L552	L211	i6754	Y	L552	L212	i6755	Y	L552	L426	i6756	Y	L552	L427
i6757	Y	L553	L211	i6758	Y	L553	L212	i6759	Y	L553	L426	i6760	Y	L553	L427
i6761	Y	L554	L211	i6762	Y	L554	L212	i6763	Y	L554	L426	i6764	Y	L554	L427
i6765	Y	L555	L211	i6766	Y	L555	L212	i6767	Y	L555	L426	i6768	Y	L555	L427
i6769	Y	L556	L211	i6770	Y	L556	L212	i6771	Y	L556	L426	i6772	Y	L556	L427
i6773	Y	L557	L211	i6774	Y	L557	L212	i6775	Y	L557	L426	i6776	Y	L557	L427
i6777	Y	L558	L211	i6778	Y	L558	L212	i6779	Y	L558	L426	i6780	Y	L558	L427
i6781	Y	L559	L211	i6782	Y	L559	L212	i6783	Y	L559	L426	i6784	Y	L559	L427
i6785	Y	L560	L211	i6786	Y	L560	L212	i6787	Y	L560	L426	i6788	Y	L560	L427
i6789	Y	L561	L211	i6790	Y	L561	L212	i6791	Y	L561	L426	i6792	Y	L561	L427
i6793	Y	L562	L211	i6794	Y	L562	L212	i6795	Y	L562	L426	i6796	Y	L562	L427
i6797	Y	L563	L211	i6798	Y	L563	L212	i6799	Y	L563	L426	i6800	Y	L563	L427
i6801	Y	L564	L211	i6802	Y	L564	L212	i6803	Y	L564	L426	i6804	Y	L564	L427
i6805	Y	L565	L211	i6806	Y	L565	L212	i6807	Y	L565	L426	i6808	Y	L565	L427
i6809	Y	L566	L211	i6810	Y	L566	L212	i6811	Y	L566	L426	i6812	Y	L566	L427
i6813	Y	L567	L211	i6814	Y	L567	L212	i6815	Y	L567	L426	i6816	Y	L567	L427
i6817	Y	L568	L211	i6818	Y	L568	L212	i6819	Y	L568	L426	i6820	Y	L568	L427
i6821	Y	L569	L211	i6822	Y	L569	L212	i6823	Y	L569	L426	i6824	Y	L569	L427
i6825	Y	L570	L211	i6826	Y	L570	L212	i6827	Y	L570	L426	i6828	Y	L570	L427
i6829	Y	L571	L211	i6830	Y	L571	L212	i6831	Y	L571	L426	i6832	Y	L571	L427
i6833	Y	L572	L211	i6834	Y	L572	L212	i6835	Y	L572	L426	i6836	Y	L572	L427
i6837	Y	L843	L211	i6838	Y	L843	L212	i6839	Y	L843	L426	i6840	Y	L843	L427
i6841	Y	L844	L211	i6842	Y	L844	L212	i6843	Y	L844	L426	i6844	Y	L844	L427
i6845	Y	L845	L211	i6846	Y	L845	L212	i6847	Y	L845	L426	i6848	Y	L845	L427
i6849	Y	L846	L211	i6850	Y	L846	L212	i6851	Y	L846	L426	i6852	Y	L846	L427
i6853	Y	L847	L211	i6854	Y	L847	L212	i6855	Y	L847	L426	i6856	Y	L847	L427
i6857	Y	L848	L211	i6858	Y	L848	L212	i6859	Y	L848	L426	i6860	Y	L848	L427
i6861	Y	L10	L428	i6862	Y	L10	L429	i6863	Y	L10	L430	i6864	Y	L10	L431
i6865	Y	L11	L428	i6866	Y	L11	L429	i6867	Y	L11	L430	i6868	Y	L11	L431
i6869	Y	L20	L428	i6870	Y	L20	L429	i6871	Y	L20	L430	i6872	Y	L20	L431
i6873	Y	L21	L428	i6874	Y	L21	L429	i6875	Y	L21	L430	i6876	Y	L21	L431
i6877	Y	L22	L428	i6878	Y	L22	L429	i6879	Y	L22	L430	i6880	Y	L22	L431
i6881	Y	L23	L428	i6882	Y	L23	L429	i6883	Y	L23	L430	i6884	Y	L23	L431
i6885	Y	L24	L428	i6886	Y	L24	L429	i6887	Y	L24	L430	i6888	Y	L24	L431
i6889	Y	L25	L428	i6890	Y	L25	L429	i6891	Y	L25	L430	i6892	Y	L25	L431
i6893	Y	L26	L428	i6894	Y	L26	L429	i6895	Y	L26	L430	i6896	Y	L26	L431
i6897	Y	L27	L428	i6898	Y	L27	L429	i6899	Y	L27	L430	i6900	Y	L27	L431
i6901	Y	L28	L428	i6902	Y	L28	L429	i6903	Y	L28	L430	i6904	Y	L28	L431
i6905	Y	L12	L428	i6906	Y	L12	L429	i6907	Y	L12	L430	i6908	Y	L12	L431
i6909	Y	L13	L428	i6910	Y	L13	L429	i6911	Y	L13	L430	i6912	Y	L13	L431
i6913	Y	L14	L428	i6914	Y	L14	L429	i6915	Y	L14	L430	i6916	Y	L14	L431
i6917	Y	L15	L428	i6918	Y	L15	L429	i6919	Y	L15	L430	i6920	Y	L15	L431
i6921	Y	L16	L428	i6922	Y	L16	L429	i6923	Y	L16	L430	i6924	Y	L16	L431
i6925	Y	L17	L428	i6926	Y	L17	L429	i6927	Y	L17	L430	i6928	Y	L17	L431
i6929	Y	L18	L428	i6930	Y	L18	L429	i6931	Y	L18	L430	i6932	Y	L18	L431
i6933	Y	L19	L428	i6934	Y	L19	L429	i6935	Y	L19	L430	i6936	Y	L19	L431
i6937	Y	L2	L428	i6938	Y	L2	L429	i6939	Y	L2	L430	i6940	Y	L2	L431
i6941	Y	L101	L428	i6942	Y	L101	L429	i6943	Y	L101	L430	i6944	Y	L101	L431
i6945	Y	L102	L428	i6946	Y	L102	L429	i6947	Y	L102	L430	i6948	Y	L102	L431
i6949	Y	L103	L428	i6950	Y	L103	L429	i6951	Y	L103	L430	i6952	Y	L103	L431
i6953	Y	L104	L428	i6954	Y	L104	L429	i6955	Y	L104	L430	i6956	Y	L104	L431
i6957	Y	L105	L428	i6958	Y	L105	L429	i6959	Y	L105	L430	i6960	Y	L105	L431
i6961	Y	L106	L428	i6962	Y	L106	L429	i6963	Y	L106	L430	i6964	Y	L106	L431
i6965	Y	L107	L428	i6966	Y	L107	L429	i6967	Y	L107	L430	i6968	Y	L107	L431
i6969	Y	L108	L428	i6970	Y	L108	L429	i6971	Y	L108	L430	i6972	Y	L108	L431
i6973	Y	L109	L428	i6974	Y	L109	L429	i6975	Y	L109	L430	i6976	Y	L109	L431
i6977	Y	L110	L428	i6978	Y	L110	L429	i6979	Y	L110	L430	i6980	Y	L110	L431
i6981	Y	L111	L428	i6982	Y	L111	L429	i6983	Y	L111	L430	i6984	Y	L111	L431
i6985	Y	L112	L428	i6986	Y	L112	L429	i6987	Y	L112	L430	i6988	Y	L112	L431
i6989	Y	L113	L428	i6990	Y	L113	L429	i6991	Y	L113	L430	i6992	Y	L113	L431
i6993	Y	L114	L428	i6994	Y	L114	L429	i6995	Y	L114	L430	i6996	Y	L114	L431
i6997	Y	L115	L428	i6998	Y	L115	L429	i6999	Y	L115	L430	i7000	Y	L115	L431
i7001	Y	L116	L428	i7002	Y	L116	L429	i7003	Y	L116	L430	i7004	Y	L116	L431
i7005	Y	L117	L428	i7006	Y	L117	L429	i7007	Y	L117	L430	i7008	Y	L117	L431
i7009	Y	L118	L428	i7010	Y	L118	L429	i7011	Y	L118	L430	i7012	Y	L118	L431
i7013	Y	L119	L428	i7014	Y	L119	L429	i7015	Y	L119	L430	i7016	Y	L119	L431
i7017	Y	L120	L428	i7018	Y	L120	L429	i7019	Y	L120	L430	i7020	Y	L120	L431
i7021	Y	L121	L428	i7022	Y	L121	L429	i7023	Y	L121	L430	i7024	Y	L121	L431
i7025	Y	L122	L428	i7026	Y	L122	L429	i7027	Y	L122	L430	i7028	Y	L122	L431
i7029	Y	L123	L428	i7030	Y	L123	L429	i7031	Y	L123	L430	i7032	Y	L123	L431
i7033	Y	L124	L428	i7034	Y	L124	L429	i7035	Y	L124	L430	i7036	Y	L124	L431
i7037	Y	L125	L428	i7038	Y	L125	L429	i7039	Y	L125	L430	i7040	Y	L125	L431
i7041	Y	L126	L428	i7042	Y	L126	L429	i7043	Y	L126	L430	i7044	Y	L126	L431
i7045	Y	L127	L428	i7046	Y	L127	L429	i7047	Y	L127	L430	i7048	Y	L127	L431
i7049	Y	L128	L428	i7050	Y	L128	L429	i7051	Y	L128	L430	i7052	Y	L128	L431
i7053	Y	L129	L428	i7054	Y	L129	L429	i7055	Y	L129	L430	i7056	Y	L129	L431
i7057	Y	L130	L428	i7058	Y	L130	L429	i7059	Y	L130	L430	i7060	Y	L130	L431
i7061	Y	L131	L428	i7062	Y	L131	L429	i7063	Y	L131	L430	i7064	Y	L131	L431
i7065	Y	L132	L428	i7066	Y	L132	L429	i7067	Y	L132	L430	i7068	Y	L132	L431
i7069	Y	L133	L428	i7070	Y	L133	L429	i7071	Y	L133	L430	i7072	Y	L133	L431
i7073	Y	L134	L428	i7074	Y	L134	L429	i7075	Y	L134	L430	i7076	Y	L134	L431
i7077	Y	L135	L428	i7078	Y	L135	L429	i7079	Y	L135	L430	i7080	Y	L135	L431
i7081	Y	L136	L428	i7082	Y	L136	L429	i7083	Y	L136	L430	i7084	Y	L136	L431
i7085	Y	L137	L428	i7086	Y	L137	L429	i7087	Y	L137	L430	i7088	Y	L137	L431
i7089	Y	L138	L428	i7090	Y	L138	L429	i7091	Y	L138	L430	i7092	Y	L138	L431
i7093	Y	L139	L428	i7094	Y	L139	L429	i7095	Y	L139	L430	i7096	Y	L139	L431
i7097	Y	L140	L428	i7098	Y	L140	L429	i7099	Y	L140	L430	i7100	Y	L140	L431
i7101	Y	L141	L428	i7102	Y	L141	L429	i7103	Y	L141	L430	i7104	Y	L141	L431
i7105	Y	L142	L428	i7106	Y	L142	L429	i7107	Y	L142	L430	i7108	Y	L142	L431
i7109	Y	L143	L428	i7110	Y	L143	L429	i7111	Y	L143	L430	i7112	Y	L143	L431
i7113	Y	L144	L428	i7114	Y	L144	L429	i7115	Y	L144	L430	i7116	Y	L144	L431
i7117	Y	L145	L428	i7118	Y	L145	L429	i7119	Y	L145	L430	i7120	Y	L145	L431
i7121	Y	L146	L428	i7122	Y	L146	L429	i7123	Y	L146	L430	i7124	Y	L146	L431
i7125	Y	L147	L428	i7126	Y	L147	L429	i7127	Y	L147	L430	i7128	Y	L147	L431
i7129	Y	L148	L428	i7130	Y	L148	L429	i7131	Y	L148	L430	i7132	Y	L148	L431
i7133	Y	L149	L428	i7134	Y	L149	L429	i7135	Y	L149	L430	i7136	Y	L149	L431
i7137	Y	L150	L428	i7138	Y	L150	L429	i7139	Y	L150	L430	i7140	Y	L150	L431
i7141	Y	L151	L428	i7142	Y	L151	L429	i7143	Y	L151	L430	i7144	Y	L151	L431
i7145	Y	L152	L428	i7146	Y	L152	L429	i7147	Y	L152	L430	i7148	Y	L152	L431
i7149	Y	L153	L428	i7150	Y	L153	L429	i7151	Y	L153	L430	i7152	Y	L153	L431
i7153	Y	L154	L428	i7154	Y	L154	L429	i7155	Y	L154	L430	i7156	Y	L154	L431
i7157	Y	L155	L428	i7158	Y	L155	L429	i7159	Y	L155	L430	i7160	Y	L155	L431
i7161	Y	L156	L428	i7162	Y	L156	L429	i7163	Y	L156	L430	i7164	Y	L156	L431
i7165	Y	L157	L428	i7166	Y	L157	L429	i7167	Y	L157	L430	i7168	Y	L157	L431
i7169	Y	L158	L428	i7170	Y	L158	L429	i7171	Y	L158	L430	i7172	Y	L158	L431
i7173	Y	L159	L428	i7174	Y	L159	L429	i7175	Y	L159	L430	i7176	Y	L159	L431
i7177	Y	L160	L428	i7178	Y	L160	L429	i7179	Y	L160	L430	i7180	Y	L160	L431
i7181	Y	L161	L428	i7182	Y	L161	L429	i7183	Y	L161	L430	i7184	Y	L161	L431
i7185	Y	L162	L428	i7186	Y	L162	L429	i7187	Y	L162	L430	i7188	Y	L162	L431
i7189	Y	L163	L428	i7190	Y	L163	L429	i7191	Y	L163	L430	i7192	Y	L163	L431
i7193	Y	L164	L428	i7194	Y	L164	L429	i7195	Y	L164	L430	i7196	Y	L164	L431
i7197	Y	L165	L428	i7198	Y	L165	L429	i7199	Y	L165	L430	i7200	Y	L165	L431
i7201	Y	L166	L428	i7202	Y	L166	L429	i7203	Y	L166	L430	i7204	Y	L166	L431
i7205	Y	L167	L428	i7206	Y	L167	L429	i7207	Y	L167	L430	i7208	Y	L167	L431
i7209	Y	L168	L428	i7210	Y	L168	L429	i7211	Y	L168	L430	i7212	Y	L168	L431
i7213	Y	L169	L428	i7214	Y	L169	L429	i7215	Y	L169	L430	i7216	Y	L169	L431
i7217	Y	L170	L428	i7218	Y	L170	L429	i7219	Y	L170	L430	i7220	Y	L170	L431
i7221	Y	L171	L428	i7222	Y	L171	L429	i7223	Y	L171	L430	i7224	Y	L171	L431
i7225	Y	L172	L428	i7226	Y	L172	L429	i7227	Y	L172	L430	i7228	Y	L172	L431
i7229	Y	L173	L428	i7230	Y	L173	L429	i7231	Y	L173	L430	i7232	Y	L173	L431
i7233	Y	L174	L428	i7234	Y	L174	L429	i7235	Y	L174	L430	i7236	Y	L174	L431
i7237	Y	L175	L428	i7238	Y	L175	L429	i7239	Y	L175	L430	i7240	Y	L175	L431
i7241	Y	L176	L428	i7242	Y	L176	L429	i7243	Y	L176	L430	i7244	Y	L176	L431
i7245	Y	L177	L428	i7246	Y	L177	L429	i7247	Y	L177	L430	i7248	Y	L177	L431
i7249	Y	L178	L428	i7250	Y	L178	L429	i7251	Y	L178	L430	i7252	Y	L178	L431
i7253	Y	L179	L428	i7254	Y	L179	L429	i7255	Y	L179	L430	i7256	Y	L179	L431
i7257	Y	L180	L428	i7258	Y	L180	L429	i7259	Y	L180	L430	i7260	Y	L180	L431
i7261	Y	L181	L428	i7262	Y	L181	L429	i7263	Y	L181	L430	i7264	Y	L181	L431
i7265	Y	L182	L428	i7266	Y	L182	L429	i7267	Y	L182	L430	i7268	Y	L182	L431
i7269	Y	L183	L428	i7270	Y	L183	L429	i7271	Y	L183	L430	i7272	Y	L183	L431
i7273	Y	L184	L428	i7274	Y	L184	L429	i7275	Y	L184	L430	i7276	Y	L184	L431
i7277	Y	L185	L428	i7278	Y	L185	L429	i7279	Y	L185	L430	i7280	Y	L185	L431
i7281	Y	L186	L428	i7282	Y	L186	L429	i7283	Y	L186	L430	i7284	Y	L186	L431
i7285	Y	L187	L428	i7286	Y	L187	L429	i7287	Y	L187	L430	i7288	Y	L187	L431
i7289	Y	L188	L428	i7290	Y	L188	L429	i7291	Y	L188	L430	i7292	Y	L188	L431
i7293	Y	L189	L428	i7294	Y	L189	L429	i7295	Y	L189	L430	i7296	Y	L189	L431
i7297	Y	L190	L428	i7298	Y	L190	L429	i7299	Y	L190	L430	i7300	Y	L190	L431
i7301	Y	L191	L428	i7302	Y	L191	L429	i7303	Y	L191	L430	i7304	Y	L191	L431
i7305	Y	L192	L428	i7306	Y	L192	L429	i7307	Y	L192	L430	i7308	Y	L192	L431
i7309	Y	L193	L428	i7310	Y	L193	L429	i7311	Y	L193	L430	i7312	Y	L193	L431
i7313	Y	L194	L428	i7314	Y	L194	L429	i7315	Y	L194	L430	i7316	Y	L194	L431
i7317	Y	L195	L428	i7318	Y	L195	L429	i7319	Y	L195	L430	i7320	Y	L195	L431
i7321	Y	L196	L428	i7322	Y	L196	L429	i7323	Y	L196	L430	i7324	Y	L196	L431
i7325	Y	L197	L428	i7326	Y	L197	L429	i7327	Y	L197	L430	i7328	Y	L197	L431
i7329	Y	L198	L428	i7330	Y	L198	L429	i7331	Y	L198	L430	i7332	Y	L198	L431
i7333	Y	L199	L428	i7334	Y	L199	L429	i7335	Y	L199	L430	i7336	Y	L199	L431
i7337	Y	L200	L428	i7338	Y	L200	L429	i7339	Y	L200	L430	i7340	Y	L200	L431
i7341	Y	L201	L428	i7342	Y	L201	L429	i7343	Y	L201	L430	i7344	Y	L201	L431
i7345	Y	L202	L428	i7346	Y	L202	L429	i7347	Y	L202	L430	i7348	Y	L202	L431
i7349	Y	L203	L428	i7350	Y	L203	L429	i7351	Y	L203	L430	i7352	Y	L203	L431
i7353	Y	L204	L428	i7354	Y	L204	L429	i7355	Y	L204	L430	i7356	Y	L204	L431
i7357	Y	L205	L428	i7358	Y	L205	L429	i7359	Y	L205	L430	i7360	Y	L205	L431
i7361	Y	L206	L428	i7362	Y	L206	L429	i7363	Y	L206	L430	i7364	Y	L206	L431
i7365	Y	L207	L428	i7366	Y	L207	L429	i7367	Y	L207	L430	i7368	Y	L207	L431
i7369	Y	L208	L428	i7370	Y	L208	L429	i7371	Y	L208	L430	i7372	Y	L208	L431
i7373	Y	L209	L428	i7374	Y	L209	L429	i7375	Y	L209	L430	i7376	Y	L209	L431
i7377	Y	L210	L428	i7378	Y	L210	L429	i7379	Y	L210	L430	i7380	Y	L210	L431
i7381	Y	L211	L428	i7382	Y	L211	L429	i7383	Y	L211	L430	i7384	Y	L211	L431
i7385	Y	L212	L428	i7386	Y	L212	L429	i7387	Y	L212	L430	i7388	Y	L212	L431
i7389	Y	L213	L428	i7390	Y	L213	L429	i7391	Y	L213	L430	i7392	Y	L213	L431
i7393	Y	L214	L428	i7394	Y	L214	L429	i7395	Y	L214	L430	i7396	Y	L214	L431
i7397	Y	L215	L428	i7398	Y	L215	L429	i7399	Y	L215	L430	i7400	Y	L215	L431
i7401	Y	L216	L428	i7402	Y	L216	L429	i7403	Y	L216	L430	i7404	Y	L216	L431
i7405	Y	L217	L428	i7406	Y	L217	L429	i7407	Y	L217	L430	i7408	Y	L217	L431
i7409	Y	L218	L428	i7410	Y	L218	L429	i7411	Y	L218	L430	i7412	Y	L218	L431
i7413	Y	L219	L428	i7414	Y	L219	L429	i7415	Y	L219	L430	i7416	Y	L219	L431
i7417	Y	L220	L428	i7418	Y	L220	L429	i7419	Y	L220	L430	i7420	Y	L220	L431
i7421	Y	L221	L428	i7422	Y	L221	L429	i7423	Y	L221	L430	i7424	Y	L221	L431
i7425	Y	L222	L428	i7426	Y	L222	L429	i7427	Y	L222	L430	i7428	Y	L222	L431
i7429	Y	L401	L428	i7430	Y	L401	L429	i7431	Y	L401	L430	i7432	Y	L401	L431
i7433	Y	L402	L428	i7434	Y	L402	L429	i7435	Y	L402	L430	i7436	Y	L402	L431
i7437	Y	L403	L428	i7438	Y	L403	L429	i7439	Y	L403	L430	i7440	Y	L403	L431
i7441	Y	L404	L428	i7442	Y	L404	L429	i7443	Y	L404	L430	i7444	Y	L404	L431
i7445	Y	L405	L428	i7446	Y	L405	L429	i7447	Y	L405	L430	i7448	Y	L405	L431
i7449	Y	L406	L428	i7450	Y	L406	L429	i7451	Y	L406	L430	i7452	Y	L406	L431
i7453	Y	L407	L428	i7454	Y	L407	L429	i7455	Y	L407	L430	i7456	Y	L407	L431
i7457	Y	L408	L428	i7458	Y	L408	L429	i7459	Y	L408	L430	i7460	Y	L408	L431
i7461	Y	L409	L428	i7462	Y	L409	L429	i7463	Y	L409	L430	i7464	Y	L409	L431
i7465	Y	L410	L428	i7466	Y	L410	L429	i7467	Y	L410	L430	i7468	Y	L410	L431
i7469	Y	L411	L428	i7470	Y	L411	L429	i7471	Y	L411	L430	i7472	Y	L411	L431
i7473	Y	L412	L428	i7474	Y	L412	L429	i7475	Y	L412	L430	i7476	Y	L412	L431
i7477	Y	L413	L428	i7478	Y	L413	L429	i7479	Y	L413	L430	i7480	Y	L413	L431
i7481	Y	L414	L428	i7482	Y	L414	L429	i7483	Y	L414	L430	i7484	Y	L414	L431
i7485	Y	L415	L428	i7486	Y	L415	L429	i7487	Y	L415	L430	i7488	Y	L415	L431
i7489	Y	L416	L428	i7490	Y	L416	L429	i7491	Y	L416	L430	i7492	Y	L416	L431
i7493	Y	L417	L428	i7494	Y	L417	L429	i7495	Y	L417	L430	i7496	Y	L417	L431
i7497	Y	L418	L428	i7498	Y	L418	L429	i7499	Y	L418	L430	i7500	Y	L418	L431
i7501	Y	L419	L428	i7502	Y	L419	L429	i7503	Y	L419	L430	i7504	Y	L419	L431
i7505	Y	L420	L428	i7506	Y	L420	L429	i7507	Y	L420	L430	i7508	Y	L420	L431
i7509	Y	L421	L428	i7510	Y	L421	L429	i7511	Y	L421	L430	i7512	Y	L421	L431
i7513	Y	L422	L428	i7514	Y	L422	L429	i7515	Y	L422	L430	i7516	Y	L422	L431
i7517	Y	L423	L428	i7518	Y	L423	L429	i7519	Y	L423	L430	i7520	Y	L423	L431
i7521	Y	L424	L428	i7522	Y	L424	L429	i7523	Y	L424	L430	i7524	Y	L424	L431
i7525	Y	L425	L428	i7526	Y	L425	L429	i7527	Y	L425	L430	i7528	Y	L425	L431
i7529	Y	L501	L428	i7530	Y	L501	L429	i7531	Y	L501	L430	i7532	Y	L501	L431
i7533	Y	L502	L428	i7534	Y	L502	L429	i7535	Y	L502	L430	i7536	Y	L502	L431
i7537	Y	L503	L428	i7538	Y	L503	L429	i7539	Y	L503	L430	i7540	Y	L503	L431
i7541	Y	L504	L428	i7542	Y	L504	L429	i7543	Y	L504	L430	i7544	Y	L504	L431
i7545	Y	L505	L428	i7546	Y	L505	L429	i7547	Y	L505	L430	i7548	Y	L505	L431
i7549	Y	L506	L428	i7550	Y	L506	L429	i7551	Y	L506	L430	i7552	Y	L506	L431
i7553	Y	L507	L428	i7554	Y	L507	L429	i7555	Y	L507	L430	i7556	Y	L507	L431
i7557	Y	L508	L428	i7558	Y	L508	L429	i7559	Y	L508	L430	i7560	Y	L508	L431
i7561	Y	L509	L428	i7562	Y	L509	L429	i7563	Y	L509	L430	i7564	Y	L509	L431
i7565	Y	L510	L428	i7566	Y	L510	L429	i7567	Y	L510	L430	i7568	Y	L510	L431
i7569	Y	L511	L428	i7570	Y	L511	L429	i7571	Y	L511	L430	i7572	Y	L511	L431
i7573	Y	L512	L428	i7574	Y	L512	L429	i7575	Y	L512	L430	i7576	Y	L512	L431
i7577	Y	L513	L428	i7578	Y	L513	L429	i7579	Y	L513	L430	i7580	Y	L513	L431
i7581	Y	L514	L428	i7582	Y	L514	L429	i7583	Y	L514	L430	i7584	Y	L514	L431
i7585	Y	L515	L428	i7586	Y	L515	L429	i7587	Y	L515	L430	i7588	Y	L515	L431
i7589	Y	L516	L428	i7590	Y	L516	L429	i7591	Y	L516	L430	i7592	Y	L516	L431
i7593	Y	L517	L428	i7594	Y	L517	L429	i7595	Y	L517	L430	i7596	Y	L517	L431
i7597	Y	L518	L428	i7598	Y	L518	L429	i7599	Y	L518	L430	i7600	Y	L518	L431
i7601	Y	L519	L428	i7602	Y	L519	L429	i7603	Y	L519	L430	i7604	Y	L519	L431
i7605	Y	L520	L428	i7606	Y	L520	L429	i7607	Y	L520	L430	i7608	Y	L520	L431
i7609	Y	L521	L428	i7610	Y	L521	L429	i7611	Y	L521	L430	i7612	Y	L521	L431
i7613	Y	L522	L428	i7614	Y	L522	L429	i7615	Y	L522	L430	i7616	Y	L522	L431
i7617	Y	L523	L428	i7618	Y	L523	L429	i7619	Y	L523	L430	i7620	Y	L523	L431
i7621	Y	L524	L428	i7622	Y	L524	L429	i7623	Y	L524	L430	i7624	Y	L524	L431
i7625	Y	L525	L428	i7626	Y	L525	L429	i7627	Y	L525	L430	i7628	Y	L525	L431
i7629	Y	L526	L428	i7630	Y	L526	L429	i7631	Y	L526	L430	i7632	Y	L526	L431
i7633	Y	L527	L428	i7634	Y	L527	L429	i7635	Y	L527	L430	i7636	Y	L527	L431
i7637	Y	L528	L428	i7638	Y	L528	L429	i7639	Y	L528	L430	i7640	Y	L528	L431
i7641	Y	L529	L428	i7642	Y	L529	L429	i7643	Y	L529	L430	i7644	Y	L529	L431
i7645	Y	L530	L428	i7646	Y	L530	L429	i7647	Y	L530	L430	i7648	Y	L530	L431
i7649	Y	L531	L428	i7650	Y	L531	L429	i7651	Y	L531	L430	i7652	Y	L531	L431
i7653	Y	L532	L428	i7654	Y	L532	L429	i7655	Y	L532	L430	i7656	Y	L532	L431
i7657	Y	L533	L428	i7658	Y	L533	L429	i7659	Y	L533	L430	i7660	Y	L533	L431
i7661	Y	L534	L428	i7662	Y	L534	L429	i7663	Y	L534	L430	i7664	Y	L534	L431
i7665	Y	L535	L428	i7666	Y	L535